@charset "UTF-8";
._back-to-top-button_1bijw_3 {
    width: 40px;
    height: 40px;
    margin: 20px;
    position: fixed;
    bottom: 0;
    right: 0;
    z-index: 500;
}

.banner-img[data-v-ea601442] {
  width: 100%;
  height: auto;
  display: block;
  border-radius: 5px;
}
.image-close[data-v-ea601442] {
  position: absolute;
  top: 15px;
  right: 15px;
  color:white;
}
.announcement-wrapper[data-v-ea601442] {
  display: flex;
  flex-direction: column;
  gap: 12px;
}
.announcement[data-v-ea601442] {
  position: relative;
  display: flex;
  align-items: center;
  justify-content: space-between;
  padding: 12px 16px;
  border-radius: 8px;
  box-shadow: 0 2px 6px rgba(0, 0, 0, 0.1);
  margin-bottom: 25px;
}
.announcement-text[data-v-ea601442] {
  font-size: 0.9rem;
  font-weight: 500;
}
.announcement-image[data-v-ea601442]{
  position: relative;
  display: flex;
  align-items: center;
  justify-content: space-between;
  padding: 0px;
  border-radius: 8px;
  box-shadow: 0 2px 6px rgba(0, 0, 0, 0.1);
  margin-bottom: 25px;
}

.legalDisclaimer[data-v-c5143f38]{
    display: block;
    margin-top: 50px;
    margin-bottom: -100px;
    font-size: 13px;
    color: #666;
}
.rView[data-v-c5143f38]{
    min-height: 450px;
}
@media (max-width: 767px) {
.mView[data-v-c5143f38] {
      margin-bottom: 11rem !important;
      margin-right: 10px;
}
}

/*important for wieland.com contact */
/*!
 * Bootstrap v4.6.2 (https://getbootstrap.com/)
 * Copyright 2011-2022 The Bootstrap Authors
 * Copyright 2011-2022 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */
.dp__input_wrap{position:relative;width:100%;box-sizing:unset}
.dp__input_wrap:focus{border-color:var(--dp-border-color-hover);outline:none}
.dp__input{background-color:var(--dp-background-color);border-radius:4px;font-family:-apple-system,blinkmacsystemfont,"Segoe UI",roboto,oxygen,ubuntu,cantarell,"Open Sans","Helvetica Neue",sans-serif;border:1px solid var(--dp-border-color);outline:none;transition:border-color .2s cubic-bezier(0.645, 0.045, 0.355, 1);width:100%;font-size:1rem;line-height:1.5rem;padding:6px 12px;color:var(--dp-text-color);box-sizing:border-box}
.dp__input::placeholder{opacity:.7}
.dp__input:hover{border-color:var(--dp-border-color-hover)}
.dp__input_reg{caret-color:rgba(0,0,0,0)}
.dp__input_focus{border-color:var(--dp-border-color-hover)}
.dp__disabled{background:var(--dp-disabled-color)}
.dp__disabled::placeholder{color:var(--dp-disabled-color-text)}
.dp__input_icons{display:inline-block;width:1rem;height:1rem;stroke-width:0;font-size:1rem;line-height:1.5rem;padding:6px 12px;color:var(--dp-icon-color);box-sizing:content-box}
.dp__input_icon{cursor:pointer;position:absolute;top:50%;left:0;transform:translateY(-50%);color:var(--dp-icon-color)}
.dp__clear_icon{position:absolute;top:50%;right:0;transform:translateY(-50%);cursor:pointer;color:var(--dp-icon-color)}
.dp__input_icon_pad{padding-left:35px}
.dp__input_valid{box-shadow:0 0 4px var(--dp-success-color);border-color:var(--dp-success-color)}
.dp__input_valid:hover{border-color:var(--dp-success-color)}
.dp__input_invalid{box-shadow:0 0 4px var(--dp-danger-color);border-color:var(--dp-danger-color)}
.dp__input_invalid:hover{border-color:var(--dp-danger-color)}
.dp__menu{position:absolute;background:var(--dp-background-color);border-radius:4px;min-width:260px;font-family:-apple-system,blinkmacsystemfont,"Segoe UI",roboto,oxygen,ubuntu,cantarell,"Open Sans","Helvetica Neue",sans-serif;font-size:1rem;user-select:none;border:1px solid var(--dp-menu-border-color);box-sizing:border-box}
.dp__menu::after{box-sizing:border-box}
.dp__menu::before{box-sizing:border-box}
.dp__menu:focus{border:1px solid var(--dp-menu-border-color);outline:none}
.dp__menu_index{z-index:99999}
.dp__menu_readonly,.dp__menu_disabled{position:absolute;top:0;left:0;right:0;bottom:0;z-index:1}
.dp__menu_disabled{background:rgba(255,255,255,.5);cursor:not-allowed}
.dp__menu_readonly{background:rgba(0,0,0,0);cursor:default}
.dp__arrow_top{left:50%;top:-1px;height:12px;width:12px;background-color:var(--dp-background-color);position:absolute;border-left:1px solid var(--dp-menu-border-color);border-top:1px solid var(--dp-menu-border-color);transform:translate(-50%, -50%) rotate(45deg)}
.dp__arrow_bottom{left:50%;bottom:-1px;height:12px;width:12px;background-color:var(--dp-background-color);position:absolute;border-right:1px solid var(--dp-menu-border-color);border-bottom:1px solid var(--dp-menu-border-color);transform:translate(-50%, 50%) rotate(45deg)}
.dp__now_wrap{text-align:center;padding:2px 0}
.dp__now_button{border:1px solid var(--dp-primary-color);color:var(--dp-primary-color);padding:0 4px;font-weight:bold;border-radius:4px;font-size:1rem;cursor:pointer;background:rgba(0,0,0,0)}
.dp__preset_ranges{padding:5px;border-right:1px solid var(--dp-border-color)}
.dp__sidebar_left{padding:5px;border-right:1px solid var(--dp-border-color)}
.dp__sidebar_right{padding:5px;border-left:1px solid var(--dp-border-color)}
.dp__preset_range{padding:5px}
.dp__preset_range:hover{background-color:var(--dp-hover-color);cursor:pointer}
.dp__menu_content_wrapper{display:flex}
.dp__calendar_wrap{display:flex;justify-content:center;align-items:center;flex-direction:column;font-family:-apple-system,blinkmacsystemfont,"Segoe UI",roboto,oxygen,ubuntu,cantarell,"Open Sans","Helvetica Neue",sans-serif;flex:0}
.dp__calendar_header{position:relative;display:flex;justify-content:center;align-items:center;color:var(--dp-text-color);white-space:nowrap;font-weight:bold}
.dp__calendar_header_item{text-align:center;flex-grow:1;height:35px;padding:5px;width:35px;box-sizing:border-box}
.dp__calendar_row{display:flex;justify-content:center;align-items:center;margin:5px 0}
.dp__calendar_item{text-align:center;flex-grow:1;box-sizing:border-box;color:var(--dp-text-color)}
.dp__calendar{position:relative}
.dp__calendar_header_cell{border-bottom:thin solid var(--dp-border-color);padding:.5rem}
.dp__cell_inner{display:flex;align-items:center;text-align:center;justify-content:center;border-radius:4px;height:35px;padding:5px;width:35px;border:1px solid rgba(0,0,0,0);box-sizing:border-box;position:relative}
.dp__cell_auto_range_start,.dp__date_hover_start:hover,.dp__range_start{border-bottom-right-radius:0;border-top-right-radius:0}
.dp__cell_auto_range_end,.dp__date_hover_end:hover,.dp__range_end{border-bottom-left-radius:0;border-top-left-radius:0}
.dp__range_end,.dp__range_start,.dp__active_date{background:var(--dp-primary-color);color:var(--dp-primary-text-color)}
.dp__cell_auto_range_end,.dp__cell_auto_range_start{border-top:1px dashed var(--dp-primary-color);border-bottom:1px dashed var(--dp-primary-color)}
.dp__date_hover_end:hover,.dp__date_hover_start:hover,.dp__date_hover:hover{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}
.dp__cell_offset{color:var(--dp-secondary-color)}
.dp__cell_disabled{color:var(--dp-secondary-color);cursor:not-allowed}
.dp__range_between{background:var(--dp-hover-color);border-radius:0;border-top:1px solid var(--dp-hover-color);border-bottom:1px solid var(--dp-hover-color)}
.dp__range_between_week{background:var(--dp-primary-color);color:var(--dp-primary-text-color);border-radius:0;border-top:1px solid var(--dp-primary-color);border-bottom:1px solid var(--dp-primary-color)}
.dp__today{border:1px solid var(--dp-primary-color)}
.dp__week_num{color:var(--dp-secondary-color);text-align:center}
.dp__cell_auto_range{border-radius:0;border-top:1px dashed var(--dp-primary-color);border-bottom:1px dashed var(--dp-primary-color)}
.dp__cell_auto_range_start{border-left:1px dashed var(--dp-primary-color)}
.dp__cell_auto_range_end{border-right:1px dashed var(--dp-primary-color)}
.dp__calendar_header_separator{width:100%;height:1px;background:var(--dp-border-color)}
.dp__calendar_next{margin-left:10px}
.dp__marker_line,.dp__marker_dot{height:5px;background-color:var(--dp-marker-color);position:absolute;bottom:0}
.dp__marker_dot{width:5px;border-radius:50%;left:50%;transform:translateX(-50%)}
.dp__marker_line{width:100%;left:0}
.dp__marker_tooltip{position:absolute;border-radius:4px;background-color:var(--dp-tooltip-color);padding:5px;border:1px solid var(--dp-border-color);z-index:99999;box-sizing:border-box;cursor:default}
.dp__tooltip_content{white-space:nowrap}
.dp__tooltip_text{display:flex;align-items:center;flex-flow:row nowrap;color:var(--dp-text-color)}
.dp__tooltip_mark{height:5px;width:5px;border-radius:50%;background-color:var(--dp-text-color);color:var(--dp-text-color);margin-right:5px}
.dp__arrow_bottom_tp{left:50%;bottom:0;height:8px;width:8px;background-color:var(--dp-tooltip-color);position:absolute;border-right:1px solid var(--dp-border-color);border-bottom:1px solid var(--dp-border-color);transform:translate(-50%, 50%) rotate(45deg)}
.dp__instance_calendar{position:relative;width:100%}
@media only screen and (max-width: 600px){.dp__flex_display{flex-direction:column}}
.dp__cell_highlight{background-color:var(--dp-highlight-color)}
.dp__month_year_row{display:flex;align-items:center;height:35px;color:var(--dp-text-color);box-sizing:border-box}
.dp__inner_nav{display:flex;align-items:center;justify-content:center;cursor:pointer;height:25px;width:25px;color:var(--dp-icon-color);text-align:center;border-radius:50%}
.dp__inner_nav svg{height:20px;width:20px}
.dp__inner_nav:hover{background:var(--dp-hover-color);color:var(--dp-hover-icon-color)}
.dp__inner_nav_disabled:hover,.dp__inner_nav_disabled{background:var(--dp-disabled-color);color:var(--dp-disabled-color-text);cursor:not-allowed}
.dp__month_year_select{width:50%;text-align:center;cursor:pointer;height:35px;display:flex;align-items:center;justify-content:center;border-radius:4px;box-sizing:border-box}
.dp__month_year_select:hover{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}
.dp__month_year_wrap{display:flex;width:100%}
.dp__overlay{position:absolute;width:100%;height:100%;background:var(--dp-background-color);top:0;left:0;transition:opacity 1s ease-out;z-index:99999;font-family:-apple-system,blinkmacsystemfont,"Segoe UI",roboto,oxygen,ubuntu,cantarell,"Open Sans","Helvetica Neue",sans-serif;color:var(--dp-text-color);box-sizing:border-box}
.dp__overlay_container::-webkit-scrollbar-track{box-shadow:var(--dp-scroll-bar-background);background-color:var(--dp-scroll-bar-background)}
.dp__overlay_container::-webkit-scrollbar{width:5px;background-color:var(--dp-scroll-bar-background)}
.dp__overlay_container::-webkit-scrollbar-thumb{background-color:var(--dp-scroll-bar-color);border-radius:10px}
.dp__overlay:focus{border:none;outline:none}
.dp__container_flex{display:flex}
.dp__container_block{display:block}
.dp__overlay_container{flex-direction:column;overflow-y:auto}
.dp__time_picker_overlay_container{height:100%}
.dp__overlay_row{padding:0;box-sizing:border-box;display:flex;margin-left:auto;margin-right:auto;flex-wrap:wrap;max-width:100%;width:100%;align-items:center}
.dp__overlay_container>.dp__overlay_row{flex:1}
.dp__overlay_col{box-sizing:border-box;width:33%;padding:3px;white-space:nowrap}
.dp__overlay_cell_pad{padding:10px 0}
.dp__overlay_cell_active{cursor:pointer;border-radius:4px;text-align:center;background:var(--dp-primary-color);color:var(--dp-primary-text-color)}
.dp__overlay_cell{cursor:pointer;border-radius:4px;text-align:center}
.dp__overlay_cell:hover{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}
.dp__cell_in_between{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}
.dp__overlay_action{position:sticky;bottom:0;background:#fff}
.dp__over_action_scroll{right:5px;box-sizing:border-box}
.dp__overlay_cell_disabled{cursor:not-allowed;background:var(--dp-disabled-color)}
.dp__overlay_cell_disabled:hover{background:var(--dp-disabled-color)}
.dp__overlay_cell_active_disabled{cursor:not-allowed;background:var(--dp-primary-disabled-color)}
.dp__overlay_cell_active_disabled:hover{background:var(--dp-primary-disabled-color)}
.dp__month_picker_header{display:flex;width:100%;align-items:center;justify-content:space-between;height:35px}
.dp__time_input{width:100%;display:flex;align-items:center;justify-content:center;user-select:none;font-family:-apple-system,blinkmacsystemfont,"Segoe UI",roboto,oxygen,ubuntu,cantarell,"Open Sans","Helvetica Neue",sans-serif;color:var(--dp-text-color)}
.dp__time_col_reg{padding:0 20px}
.dp__time_col_reg_with_button{padding:0 15px}
.dp__time_col_sec{padding:0 10px}
.dp__time_col_sec_with_button{padding:0 5px}
.dp__time_col{font-size:2rem;text-align:center;display:flex;align-items:center;justify-content:center;flex-direction:column}
.dp__time_display{cursor:pointer;color:var(--dp-text-color);border-radius:4px;display:flex;align-items:center;justify-content:center;padding:0 3px}
.dp__time_display:hover{background:var(--dp-hover-color);color:var(--dp-hover-text-color)}
.dp__inc_dec_button{padding:5px;margin:0;height:32px;width:32px;display:flex;align-items:center;justify-content:center;cursor:pointer;border-radius:50%;color:var(--dp-icon-color);box-sizing:border-box}
.dp__inc_dec_button svg{height:32px;width:32px}
.dp__inc_dec_button:hover{background:var(--dp-hover-color);color:var(--dp-primary-color)}
.dp__inc_dec_button_disabled:hover,.dp__inc_dec_button_disabled{background:var(--dp-disabled-color);color:var(--dp-disabled-color-text);cursor:not-allowed}
.dp__pm_am_button{background:var(--dp-primary-color);color:var(--dp-primary-text-color);border:none;padding:10px;border-radius:4px;cursor:pointer}
.dp__action_row{display:flex;align-items:center;width:100%;padding:10px;box-sizing:border-box;color:var(--dp-text-color);background:var(--dp-background-color)}
.dp__action_row svg{height:20px;width:auto}
.dp__selection_preview{width:50%;color:var(--dp-text-color);font-size:.8rem}
.dp__action_buttons{width:50%;text-align:right}
.dp__action{font-weight:bold;cursor:pointer;padding:2px 5px;border-radius:4px;display:inline-flex;align-items:center}
.dp__select{color:var(--dp-success-color)}
.dp__action_disabled{color:var(--dp-success-color-disabled);cursor:not-allowed}
.dp__cancel{color:var(--dp-secondary-color)}
.dp__theme_dark{--dp-background-color: #212121;--dp-text-color: #fff;--dp-hover-color: #484848;--dp-hover-text-color: #fff;--dp-hover-icon-color: #959595;--dp-primary-color: #005cb2;--dp-primary-disabled-color: #61a8ea;--dp-primary-text-color: #fff;--dp-secondary-color: #a9a9a9;--dp-border-color: #2d2d2d;--dp-menu-border-color: #2d2d2d;--dp-border-color-hover: #aaaeb7;--dp-disabled-color: #737373;--dp-disabled-color-text: #d0d0d0;--dp-scroll-bar-background: #212121;--dp-scroll-bar-color: #484848;--dp-success-color: #00701a;--dp-success-color-disabled: #428f59;--dp-icon-color: #959595;--dp-danger-color: #e53935;--dp-marker-color: #e53935;--dp-tooltip-color: #3e3e3e;--dp-highlight-color: rgb(0 92 178 / 20%)}
.dp__theme_light{--dp-background-color: #fff;--dp-text-color: #212121;--dp-hover-color: #f3f3f3;--dp-hover-text-color: #212121;--dp-hover-icon-color: #959595;--dp-primary-color: #1976d2;--dp-primary-disabled-color: #6bacea;--dp-primary-text-color: #f8f5f5;--dp-secondary-color: #c0c4cc;--dp-border-color: #ddd;--dp-menu-border-color: #ddd;--dp-border-color-hover: #aaaeb7;--dp-disabled-color: #f6f6f6;--dp-scroll-bar-background: #f3f3f3;--dp-scroll-bar-color: #959595;--dp-success-color: #76d275;--dp-success-color-disabled: #a3d9b1;--dp-icon-color: #959595;--dp-danger-color: #ff6f60;--dp-marker-color: #ff6f60;--dp-tooltip-color: #fafafa;--dp-disabled-color-text: #8e8e8e;--dp-highlight-color: rgb(25 118 210 / 10%)}
.dp__main{font-family:-apple-system,blinkmacsystemfont,"Segoe UI",roboto,oxygen,ubuntu,cantarell,"Open Sans","Helvetica Neue",sans-serif;user-select:none;box-sizing:border-box}
.dp__pointer{cursor:pointer}
.dp__icon{stroke:currentcolor;fill:currentcolor}
.dp__button{width:100%;text-align:center;color:var(--dp-icon-color);background:var(--dp-background-color);cursor:pointer;display:flex;align-items:center;align-content:center;justify-content:center;padding:10px;box-sizing:border-box;height:35px}
.dp__button:hover{background:var(--dp-hover-color);color:var(--dp-hover-icon-color)}
.dp__button svg{height:20px;width:auto}
.dp__button_bottom{border-bottom-left-radius:4px;border-bottom-right-radius:4px}
.dp__flex_display{display:flex}
.dp__flex_display_with_input{flex-direction:column;align-items:start}
.dp__relative{position:relative}
.calendar-next-enter-active,.calendar-next-leave-active,.calendar-prev-enter-active,.calendar-prev-leave-active{transition:all .1s ease-out}
.calendar-next-enter-from{opacity:0;transform:translateX(22px)}
.calendar-next-leave-to{opacity:0;transform:translateX(-22px)}
.calendar-prev-enter-from{opacity:0;transform:translateX(-22px)}
.calendar-prev-leave-to{opacity:0;transform:translateX(22px)}
.dp-menu-appear-enter-active,.dp-menu-appear-leave-active,.dp-slide-up-enter-active,.dp-slide-up-leave-active,.dp-slide-down-enter-active,.dp-slide-down-leave-active{transition:all .1s ease-out}
.dp-slide-down-leave-to,.dp-slide-up-enter-from{opacity:0;transform:translateY(22px)}
.dp-slide-down-enter-from,.dp-slide-up-leave-to{opacity:0;transform:translateY(-22px)}
.dp-menu-appear-enter-from{opacity:0}
.dp-menu-appear-enter-active,.dp-menu-appear-leave-active{transition:opacity .1s ease}
.dp-menu-appear-leave-to{opacity:1}
/*# sourceMappingURL=main.css.map */
:root {
  /* Color */
  --vc-clr-primary: #000;
  --vc-clr-secondary: #090f207f;
  --vc-clr-white: #ffffff;

  /* Icon */
  --vc-icn-width: 1.2em;

  /* Navigation */
  --vc-nav-width: 30px;
  --vc-nav-height: 30px;
  --vc-nav-border-radius: 0;
  --vc-nav-color: var(--vc-clr-primary);
  --vc-nav-color-hover: var(--vc-clr-secondary);
  --vc-nav-background: transparent;

  /* Pagination */
  --vc-pgn-width: 12px;
  --vc-pgn-height: 4px;
  --vc-pgn-margin: 4px;
  --vc-pgn-border-radius: 0;
  --vc-pgn-background-color: var(--vc-clr-secondary);
  --vc-pgn-active-color: var(--vc-clr-primary);
}
.carousel__pagination {
  display: flex;
  justify-content: center;
  list-style: none;
  line-height: 0;
  margin: 10px 0 0;
}
.carousel__pagination-button {
  display: block;
  border: 0;
  margin: 0;
  cursor: pointer;
  padding: var(--vc-pgn-margin);
  background: transparent;
}
.carousel__pagination-button::after {
  display: block;
  content: '';
  width: var(--vc-pgn-width);
  height: var(--vc-pgn-height);
  border-radius: var(--vc-pgn-border-radius);
  background-color: var(--vc-pgn-background-color);
}
.carousel__pagination-button:hover::after,
.carousel__pagination-button--active::after {
  background-color: var(--vc-pgn-active-color);
}
.carousel__prev,
.carousel__next {
  box-sizing: content-box;
  background: var(--vc-nav-background);
  border-radius: var(--vc-nav-border-radius);
  width: var(--vc-nav-width);
  height: var(--vc-nav-height);
  text-align: center;
  font-size: var(--vc-nav-height);
  padding: 0;
  color: var(--vc-nav-color);
  display: flex;
  justify-content: center;
  align-items: center;
  position: absolute;
  border: 0;
  cursor: pointer;
  margin: 0 10px;
  top: 50%;
  transform: translateY(-50%);
}
.carousel__prev:hover,
.carousel__next:hover {
  color: var(--vc-nav-color-hover);
}
.carousel__next--disabled,
.carousel__prev--disabled {
  cursor: not-allowed;
  opacity: 0.5;
}
.carousel__prev {
  left: 0;
}
.carousel__next {
  right: 0;
}
.carousel--rtl .carousel__prev {
  left: auto;
  right: 0;
}
.carousel--rtl .carousel__next {
  right: auto;
  left: 0;
}
.carousel {
  position: relative;
  text-align: center;
  box-sizing: border-box;
}
.carousel * {
  box-sizing: border-box;
}
.carousel__track {
  display: flex;
  padding: 0 !important;
  position: relative;
  touch-action: none;
  overscroll-behavior: none;
}
.carousel__viewport {
  overflow: hidden;
}
.carousel__sr-only {
  position: absolute;
  width: 1px;
  height: 1px;
  padding: 0;
  margin: -1px;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  border: 0;
}
.carousel__icon {
  width: var(--vc-icn-width);
  height: var(--vc-icn-width);
  fill: currentColor;
}
.carousel__slide {
  scroll-snap-stop: auto;
  flex-shrink: 0;
  margin: 0;
  position: relative;

  display: flex;
  justify-content: center;
  align-items: center;

  /* Fix iOS scrolling #22 */
  transform: translateZ(0);
}
:root {
  --blue: #0075a8;
  --indigo: #6610f2;
  --purple: #6f42c1;
  --pink: #e83e8c;
  --red: #E12326;
  --orange: #ffa300;
  --yellow: #fed600;
  --green: #6aa539;
  --teal: #20c997;
  --cyan: #17a2b8;
  --white: white;
  --gray: #98999b;
  --gray-dark: #53555a;
  --primary: #E12326;
  --secondary: #53555a;
  --success: #6aa539;
  --info: #17a2b8;
  --warning: #fed600;
  --danger: #E12326;
  --light: #f2f2f2;
  --dark: #53555a;
  --border: #d4d4d5;
  --headings: #cb8671;
  --breakpoint-xs: 0;
  --breakpoint-sm: 576px;
  --breakpoint-md: 768px;
  --breakpoint-lg: 992px;
  --breakpoint-xl: 1200px;
  --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  --font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
}
*,
*::before,
*::after {
  box-sizing: border-box;
}
html {
  font-family: sans-serif;
  line-height: 1.15;
  -webkit-text-size-adjust: 100%;
  -webkit-tap-highlight-color: rgba(33, 37, 41, 0);
}
article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
  display: block;
}
body {
  margin: 0;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #3a3c41;
  text-align: left;
  background-color: white;
}
[tabindex="-1"]:focus:not(:focus-visible) {
  outline: 0 !important;
}
hr {
  box-sizing: content-box;
  height: 0;
  overflow: visible;
}
h1, h2, h3, h4, h5, h6 {
  margin-top: 0;
  margin-bottom: 0.5rem;
}
p {
  margin-top: 0;
  margin-bottom: 1rem;
}
abbr[title],
abbr[data-original-title] {
  text-decoration: underline;
  text-decoration: underline dotted;
  cursor: help;
  border-bottom: 0;
  text-decoration-skip-ink: none;
}
address {
  margin-bottom: 1rem;
  font-style: normal;
  line-height: inherit;
}
ol,
ul,
dl {
  margin-top: 0;
  margin-bottom: 1rem;
}
ol ol,
ul ul,
ol ul,
ul ol {
  margin-bottom: 0;
}
dt {
  font-weight: 700;
}
dd {
  margin-bottom: 0.5rem;
  margin-left: 0;
}
blockquote {
  margin: 0 0 1rem;
}
b,
strong {
  font-weight: bolder;
}
small {
  font-size: 80%;
}
sub,
sup {
  position: relative;
  font-size: 75%;
  line-height: 0;
  vertical-align: baseline;
}
sub {
  bottom: -0.25em;
}
sup {
  top: -0.5em;
}
a {
  color: #E12326;
  text-decoration: none;
  background-color: transparent;
}
a:hover {
  color: #a11618;
  text-decoration: underline;
}
a:not([href]):not([class]) {
  color: inherit;
  text-decoration: none;
}
a:not([href]):not([class]):hover {
  color: inherit;
  text-decoration: none;
}
pre,
code,
kbd,
samp {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
  font-size: 1em;
}
pre {
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto;
  -ms-overflow-style: scrollbar;
}
figure {
  margin: 0 0 1rem;
}
img {
  vertical-align: middle;
  border-style: none;
}
svg {
  overflow: hidden;
  vertical-align: middle;
}
table {
  border-collapse: collapse;
}
caption {
  padding-top: 0.75rem;
  padding-bottom: 0.75rem;
  color: #98999b;
  text-align: left;
  caption-side: bottom;
}
th {
  text-align: inherit;
  text-align: -webkit-match-parent;
}
label {
  display: inline-block;
  margin-bottom: 0.5rem;
}
button {
  border-radius: 0;
}
button:focus:not(:focus-visible) {
  outline: 0;
}
input,
button,
select,
optgroup,
textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit;
}
button,
input {
  overflow: visible;
}
button,
select {
  text-transform: none;
}
[role=button] {
  cursor: pointer;
}
select {
  word-wrap: normal;
}
button,
[type=button],
[type=reset],
[type=submit] {
  -webkit-appearance: button;
}
button:not(:disabled),
[type=button]:not(:disabled),
[type=reset]:not(:disabled),
[type=submit]:not(:disabled) {
  cursor: pointer;
}
button::-moz-focus-inner,
[type=button]::-moz-focus-inner,
[type=reset]::-moz-focus-inner,
[type=submit]::-moz-focus-inner {
  padding: 0;
  border-style: none;
}
input[type=radio],
input[type=checkbox] {
  box-sizing: border-box;
  padding: 0;
}
textarea {
  overflow: auto;
  resize: vertical;
}
fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0;
}
legend {
  display: block;
  width: 100%;
  max-width: 100%;
  padding: 0;
  margin-bottom: 0.5rem;
  font-size: 1.5rem;
  line-height: inherit;
  color: inherit;
  white-space: normal;
}
progress {
  vertical-align: baseline;
}
[type=number]::-webkit-inner-spin-button,
[type=number]::-webkit-outer-spin-button {
  height: auto;
}
[type=search] {
  outline-offset: -2px;
  -webkit-appearance: none;
}
[type=search]::-webkit-search-decoration {
  -webkit-appearance: none;
}
::-webkit-file-upload-button {
  font: inherit;
  -webkit-appearance: button;
}
output {
  display: inline-block;
}
summary {
  display: list-item;
  cursor: pointer;
}
template {
  display: none;
}
[hidden] {
  display: none !important;
}
h1, h2, h3, h4, h5, h6,
.h1, .h2, .h3, .h4, .h5, .h6 {
  margin-bottom: 0.5rem;
  font-weight: 500;
  line-height: 1.2;
}
h1, .h1 {
  font-size: 2.5rem;
}
h2, .h2 {
  font-size: 2rem;
}
h3, .h3 {
  font-size: 1.75rem;
}
h4, .h4 {
  font-size: 1.5rem;
}
h5, .h5 {
  font-size: 1.25rem;
}
h6, .h6 {
  font-size: 1rem;
}
.lead {
  font-size: 1.25rem;
  font-weight: 300;
}
.display-1 {
  font-size: 6rem;
  font-weight: 300;
  line-height: 1.2;
}
.display-2 {
  font-size: 5.5rem;
  font-weight: 300;
  line-height: 1.2;
}
.display-3 {
  font-size: 4.5rem;
  font-weight: 300;
  line-height: 1.2;
}
.display-4 {
  font-size: 3.5rem;
  font-weight: 300;
  line-height: 1.2;
}
hr {
  margin-top: 1rem;
  margin-bottom: 1rem;
  border: 0;
  border-top: 1px solid rgba(33, 37, 41, 0.1);
}
small,
.small {
  font-size: 0.875em;
  font-weight: 400;
}
mark,
.mark {
  padding: 0.2em;
  background-color: #fcf8e3;
}
.list-unstyled {
  padding-left: 0;
  list-style: none;
}
.list-inline {
  padding-left: 0;
  list-style: none;
}
.list-inline-item {
  display: inline-block;
}
.list-inline-item:not(:last-child) {
  margin-right: 0.5rem;
}
.initialism {
  font-size: 90%;
  text-transform: uppercase;
}
.blockquote {
  margin-bottom: 1rem;
  font-size: 1.25rem;
}
.blockquote-footer {
  display: block;
  font-size: 0.875em;
  color: #98999b;
}
.blockquote-footer::before {
  content: "— ";
}
.img-fluid {
  max-width: 100%;
  height: auto;
}
.img-thumbnail {
  padding: 0.25rem;
  background-color: white;
  border: 1px solid #d4d4d5;
  border-radius: 0.25rem;
  max-width: 100%;
  height: auto;
}
.figure {
  display: inline-block;
}
.figure-img {
  margin-bottom: 0.5rem;
  line-height: 1;
}
.figure-caption {
  font-size: 90%;
  color: #98999b;
}
code {
  font-size: 87.5%;
  color: #e83e8c;
  word-wrap: break-word;
}
a > code {
  color: inherit;
}
kbd {
  padding: 0.2rem 0.4rem;
  font-size: 87.5%;
  color: white;
  background-color: #3a3c41;
  border-radius: 0.2rem;
}
kbd kbd {
  padding: 0;
  font-size: 100%;
  font-weight: 700;
}
pre {
  display: block;
  font-size: 87.5%;
  color: #3a3c41;
}
pre code {
  font-size: inherit;
  color: inherit;
  word-break: normal;
}
.pre-scrollable {
  max-height: 340px;
  overflow-y: scroll;
}
.container,
.container-fluid,
.container-xl,
.container-lg,
.container-md,
.container-sm {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto;
}
@media (min-width: 576px) {
  .container-sm, .container {
    max-width: 540px;
  }
}
@media (min-width: 768px) {
  .container-md, .container-sm, .container {
    max-width: 720px;
  }
}
@media (min-width: 992px) {
  .container-lg, .container-md, .container-sm, .container {
    max-width: 960px;
  }
}
@media (min-width: 1200px) {
  .container-xl, .container-lg, .container-md, .container-sm, .container {
    max-width: 1140px;
  }
}
.row {
  display: flex;
  flex-wrap: wrap;
  margin-right: -15px;
  margin-left: -15px;
}
.no-gutters {
  margin-right: 0;
  margin-left: 0;
}
.no-gutters > .col,
.no-gutters > [class*=col-] {
  padding-right: 0;
  padding-left: 0;
}
.col-xl,
.col-xl-auto, .col-xl-12, .col-xl-11, .col-xl-10, .col-xl-9, .col-xl-8, .col-xl-7, .col-xl-6, .col-xl-5, .col-xl-4, .col-xl-3, .col-xl-2, .col-xl-1, .col-lg,
.col-lg-auto, .col-lg-12, .col-lg-11, .col-lg-10, .col-lg-9, .col-lg-8, .col-lg-7, .col-lg-6, .col-lg-5, .col-lg-4, .col-lg-3, .col-lg-2, .col-lg-1, .col-md,
.col-md-auto, .col-md-12, .col-md-11, .col-md-10, .col-md-9, .col-md-8, .col-md-7, .col-md-6, .col-md-5, .col-md-4, .col-md-3, .col-md-2, .col-md-1, .col-sm,
.col-sm-auto, .col-sm-12, .col-sm-11, .col-sm-10, .col-sm-9, .col-sm-8, .col-sm-7, .col-sm-6, .col-sm-5, .col-sm-4, .col-sm-3, .col-sm-2, .col-sm-1, .col,
.col-auto, .col-12, .col-11, .col-10, .col-9, .col-8, .col-7, .col-6, .col-5, .col-4, .col-3, .col-2, .col-1 {
  position: relative;
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
}
.col {
  flex-basis: 0;
  flex-grow: 1;
  max-width: 100%;
}
.row-cols-1 > * {
  flex: 0 0 100%;
  max-width: 100%;
}
.row-cols-2 > * {
  flex: 0 0 50%;
  max-width: 50%;
}
.row-cols-3 > * {
  flex: 0 0 33.3333333333%;
  max-width: 33.3333333333%;
}
.row-cols-4 > * {
  flex: 0 0 25%;
  max-width: 25%;
}
.row-cols-5 > * {
  flex: 0 0 20%;
  max-width: 20%;
}
.row-cols-6 > * {
  flex: 0 0 16.6666666667%;
  max-width: 16.6666666667%;
}
.col-auto {
  flex: 0 0 auto;
  width: auto;
  max-width: 100%;
}
.col-1 {
  flex: 0 0 8.33333333%;
  max-width: 8.33333333%;
}
.col-2 {
  flex: 0 0 16.66666667%;
  max-width: 16.66666667%;
}
.col-3 {
  flex: 0 0 25%;
  max-width: 25%;
}
.col-4 {
  flex: 0 0 33.33333333%;
  max-width: 33.33333333%;
}
.col-5 {
  flex: 0 0 41.66666667%;
  max-width: 41.66666667%;
}
.col-6 {
  flex: 0 0 50%;
  max-width: 50%;
}
.col-7 {
  flex: 0 0 58.33333333%;
  max-width: 58.33333333%;
}
.col-8 {
  flex: 0 0 66.66666667%;
  max-width: 66.66666667%;
}
.col-9 {
  flex: 0 0 75%;
  max-width: 75%;
}
.col-10 {
  flex: 0 0 83.33333333%;
  max-width: 83.33333333%;
}
.col-11 {
  flex: 0 0 91.66666667%;
  max-width: 91.66666667%;
}
.col-12 {
  flex: 0 0 100%;
  max-width: 100%;
}
.order-first {
  order: -1;
}
.order-last {
  order: 13;
}
.order-0 {
  order: 0;
}
.order-1 {
  order: 1;
}
.order-2 {
  order: 2;
}
.order-3 {
  order: 3;
}
.order-4 {
  order: 4;
}
.order-5 {
  order: 5;
}
.order-6 {
  order: 6;
}
.order-7 {
  order: 7;
}
.order-8 {
  order: 8;
}
.order-9 {
  order: 9;
}
.order-10 {
  order: 10;
}
.order-11 {
  order: 11;
}
.order-12 {
  order: 12;
}
.offset-1 {
  margin-left: 8.33333333%;
}
.offset-2 {
  margin-left: 16.66666667%;
}
.offset-3 {
  margin-left: 25%;
}
.offset-4 {
  margin-left: 33.33333333%;
}
.offset-5 {
  margin-left: 41.66666667%;
}
.offset-6 {
  margin-left: 50%;
}
.offset-7 {
  margin-left: 58.33333333%;
}
.offset-8 {
  margin-left: 66.66666667%;
}
.offset-9 {
  margin-left: 75%;
}
.offset-10 {
  margin-left: 83.33333333%;
}
.offset-11 {
  margin-left: 91.66666667%;
}
@media (min-width: 576px) {
  .col-sm {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-sm-1 > * {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-sm-2 > * {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-sm-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-sm-4 > * {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-sm-5 > * {
    flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-sm-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-sm-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-sm-1 {
    flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-sm-2 {
    flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-sm-3 {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .col-sm-4 {
    flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-sm-5 {
    flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-sm-6 {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .col-sm-7 {
    flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-sm-8 {
    flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-sm-9 {
    flex: 0 0 75%;
    max-width: 75%;
  }
  .col-sm-10 {
    flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-sm-11 {
    flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-sm-12 {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .order-sm-first {
    order: -1;
  }
  .order-sm-last {
    order: 13;
  }
  .order-sm-0 {
    order: 0;
  }
  .order-sm-1 {
    order: 1;
  }
  .order-sm-2 {
    order: 2;
  }
  .order-sm-3 {
    order: 3;
  }
  .order-sm-4 {
    order: 4;
  }
  .order-sm-5 {
    order: 5;
  }
  .order-sm-6 {
    order: 6;
  }
  .order-sm-7 {
    order: 7;
  }
  .order-sm-8 {
    order: 8;
  }
  .order-sm-9 {
    order: 9;
  }
  .order-sm-10 {
    order: 10;
  }
  .order-sm-11 {
    order: 11;
  }
  .order-sm-12 {
    order: 12;
  }
  .offset-sm-0 {
    margin-left: 0;
  }
  .offset-sm-1 {
    margin-left: 8.33333333%;
  }
  .offset-sm-2 {
    margin-left: 16.66666667%;
  }
  .offset-sm-3 {
    margin-left: 25%;
  }
  .offset-sm-4 {
    margin-left: 33.33333333%;
  }
  .offset-sm-5 {
    margin-left: 41.66666667%;
  }
  .offset-sm-6 {
    margin-left: 50%;
  }
  .offset-sm-7 {
    margin-left: 58.33333333%;
  }
  .offset-sm-8 {
    margin-left: 66.66666667%;
  }
  .offset-sm-9 {
    margin-left: 75%;
  }
  .offset-sm-10 {
    margin-left: 83.33333333%;
  }
  .offset-sm-11 {
    margin-left: 91.66666667%;
  }
}
@media (min-width: 768px) {
  .col-md {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-md-1 > * {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-md-2 > * {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-md-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-md-4 > * {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-md-5 > * {
    flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-md-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-md-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-md-1 {
    flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-md-2 {
    flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-md-3 {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .col-md-4 {
    flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-md-5 {
    flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-md-6 {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .col-md-7 {
    flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-md-8 {
    flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-md-9 {
    flex: 0 0 75%;
    max-width: 75%;
  }
  .col-md-10 {
    flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-md-11 {
    flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-md-12 {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .order-md-first {
    order: -1;
  }
  .order-md-last {
    order: 13;
  }
  .order-md-0 {
    order: 0;
  }
  .order-md-1 {
    order: 1;
  }
  .order-md-2 {
    order: 2;
  }
  .order-md-3 {
    order: 3;
  }
  .order-md-4 {
    order: 4;
  }
  .order-md-5 {
    order: 5;
  }
  .order-md-6 {
    order: 6;
  }
  .order-md-7 {
    order: 7;
  }
  .order-md-8 {
    order: 8;
  }
  .order-md-9 {
    order: 9;
  }
  .order-md-10 {
    order: 10;
  }
  .order-md-11 {
    order: 11;
  }
  .order-md-12 {
    order: 12;
  }
  .offset-md-0 {
    margin-left: 0;
  }
  .offset-md-1 {
    margin-left: 8.33333333%;
  }
  .offset-md-2 {
    margin-left: 16.66666667%;
  }
  .offset-md-3 {
    margin-left: 25%;
  }
  .offset-md-4 {
    margin-left: 33.33333333%;
  }
  .offset-md-5 {
    margin-left: 41.66666667%;
  }
  .offset-md-6 {
    margin-left: 50%;
  }
  .offset-md-7 {
    margin-left: 58.33333333%;
  }
  .offset-md-8 {
    margin-left: 66.66666667%;
  }
  .offset-md-9 {
    margin-left: 75%;
  }
  .offset-md-10 {
    margin-left: 83.33333333%;
  }
  .offset-md-11 {
    margin-left: 91.66666667%;
  }
}
@media (min-width: 992px) {
  .col-lg {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-lg-1 > * {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-lg-2 > * {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-lg-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-lg-4 > * {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-lg-5 > * {
    flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-lg-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-lg-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-lg-1 {
    flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-lg-2 {
    flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-lg-3 {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .col-lg-4 {
    flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-lg-5 {
    flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-lg-6 {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .col-lg-7 {
    flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-lg-8 {
    flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-lg-9 {
    flex: 0 0 75%;
    max-width: 75%;
  }
  .col-lg-10 {
    flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-lg-11 {
    flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-lg-12 {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .order-lg-first {
    order: -1;
  }
  .order-lg-last {
    order: 13;
  }
  .order-lg-0 {
    order: 0;
  }
  .order-lg-1 {
    order: 1;
  }
  .order-lg-2 {
    order: 2;
  }
  .order-lg-3 {
    order: 3;
  }
  .order-lg-4 {
    order: 4;
  }
  .order-lg-5 {
    order: 5;
  }
  .order-lg-6 {
    order: 6;
  }
  .order-lg-7 {
    order: 7;
  }
  .order-lg-8 {
    order: 8;
  }
  .order-lg-9 {
    order: 9;
  }
  .order-lg-10 {
    order: 10;
  }
  .order-lg-11 {
    order: 11;
  }
  .order-lg-12 {
    order: 12;
  }
  .offset-lg-0 {
    margin-left: 0;
  }
  .offset-lg-1 {
    margin-left: 8.33333333%;
  }
  .offset-lg-2 {
    margin-left: 16.66666667%;
  }
  .offset-lg-3 {
    margin-left: 25%;
  }
  .offset-lg-4 {
    margin-left: 33.33333333%;
  }
  .offset-lg-5 {
    margin-left: 41.66666667%;
  }
  .offset-lg-6 {
    margin-left: 50%;
  }
  .offset-lg-7 {
    margin-left: 58.33333333%;
  }
  .offset-lg-8 {
    margin-left: 66.66666667%;
  }
  .offset-lg-9 {
    margin-left: 75%;
  }
  .offset-lg-10 {
    margin-left: 83.33333333%;
  }
  .offset-lg-11 {
    margin-left: 91.66666667%;
  }
}
@media (min-width: 1200px) {
  .col-xl {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%;
  }
  .row-cols-xl-1 > * {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .row-cols-xl-2 > * {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .row-cols-xl-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%;
  }
  .row-cols-xl-4 > * {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .row-cols-xl-5 > * {
    flex: 0 0 20%;
    max-width: 20%;
  }
  .row-cols-xl-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%;
  }
  .col-xl-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%;
  }
  .col-xl-1 {
    flex: 0 0 8.33333333%;
    max-width: 8.33333333%;
  }
  .col-xl-2 {
    flex: 0 0 16.66666667%;
    max-width: 16.66666667%;
  }
  .col-xl-3 {
    flex: 0 0 25%;
    max-width: 25%;
  }
  .col-xl-4 {
    flex: 0 0 33.33333333%;
    max-width: 33.33333333%;
  }
  .col-xl-5 {
    flex: 0 0 41.66666667%;
    max-width: 41.66666667%;
  }
  .col-xl-6 {
    flex: 0 0 50%;
    max-width: 50%;
  }
  .col-xl-7 {
    flex: 0 0 58.33333333%;
    max-width: 58.33333333%;
  }
  .col-xl-8 {
    flex: 0 0 66.66666667%;
    max-width: 66.66666667%;
  }
  .col-xl-9 {
    flex: 0 0 75%;
    max-width: 75%;
  }
  .col-xl-10 {
    flex: 0 0 83.33333333%;
    max-width: 83.33333333%;
  }
  .col-xl-11 {
    flex: 0 0 91.66666667%;
    max-width: 91.66666667%;
  }
  .col-xl-12 {
    flex: 0 0 100%;
    max-width: 100%;
  }
  .order-xl-first {
    order: -1;
  }
  .order-xl-last {
    order: 13;
  }
  .order-xl-0 {
    order: 0;
  }
  .order-xl-1 {
    order: 1;
  }
  .order-xl-2 {
    order: 2;
  }
  .order-xl-3 {
    order: 3;
  }
  .order-xl-4 {
    order: 4;
  }
  .order-xl-5 {
    order: 5;
  }
  .order-xl-6 {
    order: 6;
  }
  .order-xl-7 {
    order: 7;
  }
  .order-xl-8 {
    order: 8;
  }
  .order-xl-9 {
    order: 9;
  }
  .order-xl-10 {
    order: 10;
  }
  .order-xl-11 {
    order: 11;
  }
  .order-xl-12 {
    order: 12;
  }
  .offset-xl-0 {
    margin-left: 0;
  }
  .offset-xl-1 {
    margin-left: 8.33333333%;
  }
  .offset-xl-2 {
    margin-left: 16.66666667%;
  }
  .offset-xl-3 {
    margin-left: 25%;
  }
  .offset-xl-4 {
    margin-left: 33.33333333%;
  }
  .offset-xl-5 {
    margin-left: 41.66666667%;
  }
  .offset-xl-6 {
    margin-left: 50%;
  }
  .offset-xl-7 {
    margin-left: 58.33333333%;
  }
  .offset-xl-8 {
    margin-left: 66.66666667%;
  }
  .offset-xl-9 {
    margin-left: 75%;
  }
  .offset-xl-10 {
    margin-left: 83.33333333%;
  }
  .offset-xl-11 {
    margin-left: 91.66666667%;
  }
}
.table {
  width: 100%;
  margin-bottom: 1rem;
  color: #3a3c41;
}
.table th,
.table td {
  padding: 0.75rem;
  vertical-align: top;
  border-top: 1px solid #d4d4d5;
}
.table thead th {
  vertical-align: bottom;
  border-bottom: 2px solid #d4d4d5;
}
.table tbody + tbody {
  border-top: 2px solid #d4d4d5;
}
.table-sm th,
.table-sm td {
  padding: 0.3rem;
}
.table-bordered {
  border: 1px solid #d4d4d5;
}
.table-bordered th,
.table-bordered td {
  border: 1px solid #d4d4d5;
}
.table-bordered thead th,
.table-bordered thead td {
  border-bottom-width: 2px;
}
.table-borderless th,
.table-borderless td,
.table-borderless thead th,
.table-borderless tbody + tbody {
  border: 0;
}
.table-striped tbody tr:nth-of-type(odd) {
  background-color: rgba(33, 37, 41, 0.05);
}
.table-hover tbody tr:hover {
  color: #3a3c41;
  background-color: rgba(33, 37, 41, 0.075);
}
.table-primary,
.table-primary > th,
.table-primary > td {
  background-color: #f7c1c2;
}
.table-primary th,
.table-primary td,
.table-primary thead th,
.table-primary tbody + tbody {
  border-color: #ef8d8e;
}
.table-hover .table-primary:hover {
  background-color: #f4aaac;
}
.table-hover .table-primary:hover > td,
.table-hover .table-primary:hover > th {
  background-color: #f4aaac;
}
.table-secondary,
.table-secondary > th,
.table-secondary > td {
  background-color: #cfcfd1;
}
.table-secondary th,
.table-secondary td,
.table-secondary thead th,
.table-secondary tbody + tbody {
  border-color: #a6a7a9;
}
.table-hover .table-secondary:hover {
  background-color: #c2c2c5;
}
.table-hover .table-secondary:hover > td,
.table-hover .table-secondary:hover > th {
  background-color: #c2c2c5;
}
.table-success,
.table-success > th,
.table-success > td {
  background-color: #d5e6c8;
}
.table-success th,
.table-success td,
.table-success thead th,
.table-success tbody + tbody {
  border-color: #b2d098;
}
.table-hover .table-success:hover {
  background-color: #c8deb6;
}
.table-hover .table-success:hover > td,
.table-hover .table-success:hover > th {
  background-color: #c8deb6;
}
.table-info,
.table-info > th,
.table-info > td {
  background-color: #bee5eb;
}
.table-info th,
.table-info td,
.table-info thead th,
.table-info tbody + tbody {
  border-color: #86cfda;
}
.table-hover .table-info:hover {
  background-color: #abdde5;
}
.table-hover .table-info:hover > td,
.table-hover .table-info:hover > th {
  background-color: #abdde5;
}
.table-warning,
.table-warning > th,
.table-warning > td {
  background-color: #fff4b8;
}
.table-warning th,
.table-warning td,
.table-warning thead th,
.table-warning tbody + tbody {
  border-color: #feea7a;
}
.table-hover .table-warning:hover {
  background-color: #fff09f;
}
.table-hover .table-warning:hover > td,
.table-hover .table-warning:hover > th {
  background-color: #fff09f;
}
.table-danger,
.table-danger > th,
.table-danger > td {
  background-color: #f7c1c2;
}
.table-danger th,
.table-danger td,
.table-danger thead th,
.table-danger tbody + tbody {
  border-color: #ef8d8e;
}
.table-hover .table-danger:hover {
  background-color: #f4aaac;
}
.table-hover .table-danger:hover > td,
.table-hover .table-danger:hover > th {
  background-color: #f4aaac;
}
.table-light,
.table-light > th,
.table-light > td {
  background-color: #fbfbfb;
}
.table-light th,
.table-light td,
.table-light thead th,
.table-light tbody + tbody {
  border-color: #f8f8f8;
}
.table-hover .table-light:hover {
  background-color: #eeeeee;
}
.table-hover .table-light:hover > td,
.table-hover .table-light:hover > th {
  background-color: #eeeeee;
}
.table-dark,
.table-dark > th,
.table-dark > td {
  background-color: #cfcfd1;
}
.table-dark th,
.table-dark td,
.table-dark thead th,
.table-dark tbody + tbody {
  border-color: #a6a7a9;
}
.table-hover .table-dark:hover {
  background-color: #c2c2c5;
}
.table-hover .table-dark:hover > td,
.table-hover .table-dark:hover > th {
  background-color: #c2c2c5;
}
.table-border,
.table-border > th,
.table-border > td {
  background-color: #f3f3f3;
}
.table-border th,
.table-border td,
.table-border thead th,
.table-border tbody + tbody {
  border-color: #e9e9e9;
}
.table-hover .table-border:hover {
  background-color: #e6e6e6;
}
.table-hover .table-border:hover > td,
.table-hover .table-border:hover > th {
  background-color: #e6e6e6;
}
.table-headings,
.table-headings > th,
.table-headings > td {
  background-color: #f0ddd7;
}
.table-headings th,
.table-headings td,
.table-headings thead th,
.table-headings tbody + tbody {
  border-color: #e4c0b5;
}
.table-hover .table-headings:hover {
  background-color: #e9cdc4;
}
.table-hover .table-headings:hover > td,
.table-hover .table-headings:hover > th {
  background-color: #e9cdc4;
}
.table-active,
.table-active > th,
.table-active > td {
  background-color: rgba(33, 37, 41, 0.075);
}
.table-hover .table-active:hover {
  background-color: rgba(22, 24, 27, 0.075);
}
.table-hover .table-active:hover > td,
.table-hover .table-active:hover > th {
  background-color: rgba(22, 24, 27, 0.075);
}
.table .thead-dark th {
  color: white;
  background-color: #53555a;
  border-color: #65686e;
}
.table .thead-light th {
  color: #7c7d80;
  background-color: #e3e4e4;
  border-color: #d4d4d5;
}
.table-dark {
  color: white;
  background-color: #53555a;
}
.table-dark th,
.table-dark td,
.table-dark thead th {
  border-color: #65686e;
}
.table-dark.table-bordered {
  border: 0;
}
.table-dark.table-striped tbody tr:nth-of-type(odd) {
  background-color: rgba(255, 255, 255, 0.05);
}
.table-dark.table-hover tbody tr:hover {
  color: white;
  background-color: rgba(255, 255, 255, 0.075);
}
@media (max-width: 575.98px) {
  .table-responsive-sm {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
  .table-responsive-sm > .table-bordered {
    border: 0;
  }
}
@media (max-width: 767.98px) {
  .table-responsive-md {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
  .table-responsive-md > .table-bordered {
    border: 0;
  }
}
@media (max-width: 991.98px) {
  .table-responsive-lg {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
  .table-responsive-lg > .table-bordered {
    border: 0;
  }
}
@media (max-width: 1199.98px) {
  .table-responsive-xl {
    display: block;
    width: 100%;
    overflow-x: auto;
    -webkit-overflow-scrolling: touch;
  }
  .table-responsive-xl > .table-bordered {
    border: 0;
  }
}
.table-responsive {
  display: block;
  width: 100%;
  overflow-x: auto;
  -webkit-overflow-scrolling: touch;
}
.table-responsive > .table-bordered {
  border: 0;
}
.form-control {
  display: block;
  width: 100%;
  height: calc(1.5em + 0.75rem + 2px);
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #53555a;
  background-color: white;
  background-clip: padding-box;
  border: 1px solid #c3c3c4;
  border-radius: 0.25rem;
  transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .form-control {
    transition: none;
  }
}
.form-control::-ms-expand {
  background-color: transparent;
  border: 0;
}
.form-control:focus {
  color: #53555a;
  background-color: white;
  border-color: #92949a;
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.form-control::placeholder {
  color: #98999b;
  opacity: 1;
}
.form-control:disabled, .form-control[readonly] {
  background-color: #e3e4e4;
  opacity: 1;
}
input[type=date].form-control,
input[type=time].form-control,
input[type=datetime-local].form-control,
input[type=month].form-control {
  appearance: none;
}
select.form-control:-moz-focusring {
  color: transparent;
  text-shadow: 0 0 0 #53555a;
}
select.form-control:focus::-ms-value {
  color: #53555a;
  background-color: white;
}
.form-control-file,
.form-control-range {
  display: block;
  width: 100%;
}
.col-form-label {
  padding-top: calc(0.375rem + 1px);
  padding-bottom: calc(0.375rem + 1px);
  margin-bottom: 0;
  font-size: inherit;
  line-height: 1.5;
}
.col-form-label-lg {
  padding-top: calc(0.5rem + 1px);
  padding-bottom: calc(0.5rem + 1px);
  font-size: 1.25rem;
  line-height: 1.5;
}
.col-form-label-sm {
  padding-top: calc(0.25rem + 1px);
  padding-bottom: calc(0.25rem + 1px);
  font-size: 0.875rem;
  line-height: 1.5;
}
.form-control-plaintext {
  display: block;
  width: 100%;
  padding: 0.375rem 0;
  margin-bottom: 0;
  font-size: 1rem;
  line-height: 1.5;
  color: #3a3c41;
  background-color: transparent;
  border: solid transparent;
  border-width: 1px 0;
}
.form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg {
  padding-right: 0;
  padding-left: 0;
}
.form-control-sm {
  height: calc(1.5em + 0.5rem + 2px);
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
  border-radius: 0.2rem;
}
.form-control-lg {
  height: calc(1.5em + 1rem + 2px);
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 0.3rem;
}
select.form-control[size], select.form-control[multiple] {
  height: auto;
}
textarea.form-control {
  height: auto;
}
.form-group {
  margin-bottom: 1rem;
}
.form-text {
  display: block;
  margin-top: 0.25rem;
}
.form-row {
  display: flex;
  flex-wrap: wrap;
  margin-right: -5px;
  margin-left: -5px;
}
.form-row > .col,
.form-row > [class*=col-] {
  padding-right: 5px;
  padding-left: 5px;
}
.form-check {
  position: relative;
  display: block;
  padding-left: 1.25rem;
}
.form-check-input {
  position: absolute;
  margin-top: 0.3rem;
  margin-left: -1.25rem;
}
.form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label {
  color: #98999b;
}
.form-check-label {
  margin-bottom: 0;
}
.form-check-inline {
  display: inline-flex;
  align-items: center;
  padding-left: 0;
  margin-right: 0.75rem;
}
.form-check-inline .form-check-input {
  position: static;
  margin-top: 0;
  margin-right: 0.3125rem;
  margin-left: 0;
}
.valid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: #6aa539;
}
.valid-tooltip {
  position: absolute;
  top: 100%;
  left: 0;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  line-height: 1.5;
  color: white;
  background-color: rgba(106, 165, 57, 0.9);
  border-radius: 0.25rem;
}
.form-row > .col > .valid-tooltip, .form-row > [class*=col-] > .valid-tooltip {
  left: 5px;
}
.was-validated :valid ~ .valid-feedback,
.was-validated :valid ~ .valid-tooltip,
.is-valid ~ .valid-feedback,
.is-valid ~ .valid-tooltip {
  display: block;
}
.was-validated .form-control:valid, .form-control.is-valid {
  border-color: #6aa539;
  padding-right: calc(1.5em + 0.75rem) !important;
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%236aa539' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(0.375em + 0.1875rem) center;
  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
}
.was-validated .form-control:valid:focus, .form-control.is-valid:focus {
  border-color: #6aa539;
  box-shadow: 0 0 0 0.2rem rgba(106, 165, 57, 0.25);
}
.was-validated select.form-control:valid, select.form-control.is-valid {
  padding-right: 3rem !important;
  background-position: right 1.5rem center;
}
.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
  padding-right: calc(1.5em + 0.75rem);
  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
}
.was-validated .custom-select:valid, .custom-select.is-valid {
  border-color: #6aa539;
  padding-right: calc(0.75em + 2.3125rem) !important;
  background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%2353555a' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") right 0.75rem center/8px 10px no-repeat, white url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%236aa539' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem) no-repeat;
}
.was-validated .custom-select:valid:focus, .custom-select.is-valid:focus {
  border-color: #6aa539;
  box-shadow: 0 0 0 0.2rem rgba(106, 165, 57, 0.25);
}
.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
  color: #6aa539;
}
.was-validated .form-check-input:valid ~ .valid-feedback,
.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback,
.form-check-input.is-valid ~ .valid-tooltip {
  display: block;
}
.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label {
  color: #6aa539;
}
.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before {
  border-color: #6aa539;
}
.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before {
  border-color: #83c24f;
  background-color: #83c24f;
}
.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 0.2rem rgba(106, 165, 57, 0.25);
}
.was-validated .custom-control-input:valid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-valid:focus:not(:checked) ~ .custom-control-label::before {
  border-color: #6aa539;
}
.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label {
  border-color: #6aa539;
}
.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label {
  border-color: #6aa539;
  box-shadow: 0 0 0 0.2rem rgba(106, 165, 57, 0.25);
}
.invalid-feedback {
  display: none;
  width: 100%;
  margin-top: 0.25rem;
  font-size: 0.875em;
  color: #E12326;
}
.invalid-tooltip {
  position: absolute;
  top: 100%;
  left: 0;
  z-index: 5;
  display: none;
  max-width: 100%;
  padding: 0.25rem 0.5rem;
  margin-top: 0.1rem;
  font-size: 0.875rem;
  line-height: 1.5;
  color: white;
  background-color: rgba(225, 35, 38, 0.9);
  border-radius: 0.25rem;
}
.form-row > .col > .invalid-tooltip, .form-row > [class*=col-] > .invalid-tooltip {
  left: 5px;
}
.was-validated :invalid ~ .invalid-feedback,
.was-validated :invalid ~ .invalid-tooltip,
.is-invalid ~ .invalid-feedback,
.is-invalid ~ .invalid-tooltip {
  display: block;
}
.was-validated .form-control:invalid, .form-control.is-invalid {
  border-color: #E12326;
  padding-right: calc(1.5em + 0.75rem) !important;
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23E12326' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23E12326' stroke='none'/%3e%3c/svg%3e");
  background-repeat: no-repeat;
  background-position: right calc(0.375em + 0.1875rem) center;
  background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
}
.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus {
  border-color: #E12326;
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.25);
}
.was-validated select.form-control:invalid, select.form-control.is-invalid {
  padding-right: 3rem !important;
  background-position: right 1.5rem center;
}
.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
  padding-right: calc(1.5em + 0.75rem);
  background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
}
.was-validated .custom-select:invalid, .custom-select.is-invalid {
  border-color: #E12326;
  padding-right: calc(0.75em + 2.3125rem) !important;
  background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%2353555a' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") right 0.75rem center/8px 10px no-repeat, white url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23E12326' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23E12326' stroke='none'/%3e%3c/svg%3e") center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem) no-repeat;
}
.was-validated .custom-select:invalid:focus, .custom-select.is-invalid:focus {
  border-color: #E12326;
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.25);
}
.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
  color: #E12326;
}
.was-validated .form-check-input:invalid ~ .invalid-feedback,
.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback,
.form-check-input.is-invalid ~ .invalid-tooltip {
  display: block;
}
.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label {
  color: #E12326;
}
.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before {
  border-color: #E12326;
}
.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before {
  border-color: #e75052;
  background-color: #e75052;
}
.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.25);
}
.was-validated .custom-control-input:invalid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-invalid:focus:not(:checked) ~ .custom-control-label::before {
  border-color: #E12326;
}
.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label {
  border-color: #E12326;
}
.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label {
  border-color: #E12326;
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.25);
}
.form-inline {
  display: flex;
  flex-flow: row wrap;
  align-items: center;
}
.form-inline .form-check {
  width: 100%;
}
@media (min-width: 576px) {
  .form-inline label {
    display: flex;
    align-items: center;
    justify-content: center;
    margin-bottom: 0;
  }
  .form-inline .form-group {
    display: flex;
    flex: 0 0 auto;
    flex-flow: row wrap;
    align-items: center;
    margin-bottom: 0;
  }
  .form-inline .form-control {
    display: inline-block;
    width: auto;
    vertical-align: middle;
  }
  .form-inline .form-control-plaintext {
    display: inline-block;
  }
  .form-inline .input-group,
  .form-inline .custom-select {
    width: auto;
  }
  .form-inline .form-check {
    display: flex;
    align-items: center;
    justify-content: center;
    width: auto;
    padding-left: 0;
  }
  .form-inline .form-check-input {
    position: relative;
    flex-shrink: 0;
    margin-top: 0;
    margin-right: 0.25rem;
    margin-left: 0;
  }
  .form-inline .custom-control {
    align-items: center;
    justify-content: center;
  }
  .form-inline .custom-control-label {
    margin-bottom: 0;
  }
}
.btn {
  display: inline-block;
  font-weight: 400;
  color: #3a3c41;
  text-align: center;
  vertical-align: middle;
  user-select: none;
  background-color: transparent;
  border: 1px solid transparent;
  padding: 0.375rem 0.75rem;
  font-size: 1rem;
  line-height: 1.5;
  border-radius: 0.25rem;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .btn {
    transition: none;
  }
}
.btn:hover {
  color: #3a3c41;
  text-decoration: none;
}
.btn:focus, .btn.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.btn.disabled, .btn:disabled {
  opacity: 0.65;
}
.btn:not(:disabled):not(.disabled) {
  cursor: pointer;
}
a.btn.disabled,
fieldset:disabled a.btn {
  pointer-events: none;
}
.btn-primary {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-primary:hover {
  color: white;
  background-color: #c31b1d;
  border-color: #b8191c;
}
.btn-primary:focus, .btn-primary.focus {
  color: white;
  background-color: #c31b1d;
  border-color: #b8191c;
  box-shadow: 0 0 0 0.2rem rgba(230, 68, 71, 0.5);
}
.btn-primary.disabled, .btn-primary:disabled {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, .show > .btn-primary.dropdown-toggle {
  color: white;
  background-color: #b8191c;
  border-color: #ad181a;
}
.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, .show > .btn-primary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(230, 68, 71, 0.5);
}
.btn-secondary {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-secondary:hover {
  color: white;
  background-color: #414246;
  border-color: #3b3c3f;
}
.btn-secondary:focus, .btn-secondary.focus {
  color: white;
  background-color: #414246;
  border-color: #3b3c3f;
  box-shadow: 0 0 0 0.2rem rgba(109, 111, 115, 0.5);
}
.btn-secondary.disabled, .btn-secondary:disabled {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, .show > .btn-secondary.dropdown-toggle {
  color: white;
  background-color: #3b3c3f;
  border-color: #343639;
}
.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, .show > .btn-secondary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(109, 111, 115, 0.5);
}
.btn-success {
  color: white;
  background-color: #6aa539;
  border-color: #6aa539;
}
.btn-success:hover {
  color: white;
  background-color: #58892f;
  border-color: #527f2c;
}
.btn-success:focus, .btn-success.focus {
  color: white;
  background-color: #58892f;
  border-color: #527f2c;
  box-shadow: 0 0 0 0.2rem rgba(128, 179, 87, 0.5);
}
.btn-success.disabled, .btn-success:disabled {
  color: white;
  background-color: #6aa539;
  border-color: #6aa539;
}
.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, .show > .btn-success.dropdown-toggle {
  color: white;
  background-color: #527f2c;
  border-color: #4c7629;
}
.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, .show > .btn-success.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(128, 179, 87, 0.5);
}
.btn-info {
  color: white;
  background-color: #17a2b8;
  border-color: #17a2b8;
}
.btn-info:hover {
  color: white;
  background-color: #138496;
  border-color: #117a8b;
}
.btn-info:focus, .btn-info.focus {
  color: white;
  background-color: #138496;
  border-color: #117a8b;
  box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5);
}
.btn-info.disabled, .btn-info:disabled {
  color: white;
  background-color: #17a2b8;
  border-color: #17a2b8;
}
.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, .show > .btn-info.dropdown-toggle {
  color: white;
  background-color: #117a8b;
  border-color: #10707f;
}
.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, .show > .btn-info.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5);
}
.btn-warning {
  color: #3a3c41;
  background-color: #fed600;
  border-color: #fed600;
}
.btn-warning:hover {
  color: #3a3c41;
  background-color: #d8b600;
  border-color: #cbab00;
}
.btn-warning:focus, .btn-warning.focus {
  color: #3a3c41;
  background-color: #d8b600;
  border-color: #cbab00;
  box-shadow: 0 0 0 0.2rem rgba(225, 191, 10, 0.5);
}
.btn-warning.disabled, .btn-warning:disabled {
  color: #3a3c41;
  background-color: #fed600;
  border-color: #fed600;
}
.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, .show > .btn-warning.dropdown-toggle {
  color: #3a3c41;
  background-color: #cbab00;
  border-color: #bea000;
}
.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, .show > .btn-warning.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(225, 191, 10, 0.5);
}
.btn-danger {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-danger:hover {
  color: white;
  background-color: #c31b1d;
  border-color: #b8191c;
}
.btn-danger:focus, .btn-danger.focus {
  color: white;
  background-color: #c31b1d;
  border-color: #b8191c;
  box-shadow: 0 0 0 0.2rem rgba(230, 68, 71, 0.5);
}
.btn-danger.disabled, .btn-danger:disabled {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, .show > .btn-danger.dropdown-toggle {
  color: white;
  background-color: #b8191c;
  border-color: #ad181a;
}
.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, .show > .btn-danger.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(230, 68, 71, 0.5);
}
.btn-light {
  color: #3a3c41;
  background-color: #f2f2f2;
  border-color: #f2f2f2;
}
.btn-light:hover {
  color: #3a3c41;
  background-color: #dfdfdf;
  border-color: #d9d9d9;
}
.btn-light:focus, .btn-light.focus {
  color: #3a3c41;
  background-color: #dfdfdf;
  border-color: #d9d9d9;
  box-shadow: 0 0 0 0.2rem rgba(214, 215, 215, 0.5);
}
.btn-light.disabled, .btn-light:disabled {
  color: #3a3c41;
  background-color: #f2f2f2;
  border-color: #f2f2f2;
}
.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, .show > .btn-light.dropdown-toggle {
  color: #3a3c41;
  background-color: #d9d9d9;
  border-color: #d2d2d2;
}
.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, .show > .btn-light.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(214, 215, 215, 0.5);
}
.btn-dark {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-dark:hover {
  color: white;
  background-color: #414246;
  border-color: #3b3c3f;
}
.btn-dark:focus, .btn-dark.focus {
  color: white;
  background-color: #414246;
  border-color: #3b3c3f;
  box-shadow: 0 0 0 0.2rem rgba(109, 111, 115, 0.5);
}
.btn-dark.disabled, .btn-dark:disabled {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, .show > .btn-dark.dropdown-toggle {
  color: white;
  background-color: #3b3c3f;
  border-color: #343639;
}
.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, .show > .btn-dark.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(109, 111, 115, 0.5);
}
.btn-border {
  color: #3a3c41;
  background-color: #d4d4d5;
  border-color: #d4d4d5;
}
.btn-border:hover {
  color: #3a3c41;
  background-color: #c1c1c2;
  border-color: #bababc;
}
.btn-border:focus, .btn-border.focus {
  color: #3a3c41;
  background-color: #c1c1c2;
  border-color: #bababc;
  box-shadow: 0 0 0 0.2rem rgba(189, 189, 191, 0.5);
}
.btn-border.disabled, .btn-border:disabled {
  color: #3a3c41;
  background-color: #d4d4d5;
  border-color: #d4d4d5;
}
.btn-border:not(:disabled):not(.disabled):active, .btn-border:not(:disabled):not(.disabled).active, .show > .btn-border.dropdown-toggle {
  color: #3a3c41;
  background-color: #bababc;
  border-color: #b4b4b6;
}
.btn-border:not(:disabled):not(.disabled):active:focus, .btn-border:not(:disabled):not(.disabled).active:focus, .show > .btn-border.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(189, 189, 191, 0.5);
}
.btn-headings {
  color: #3a3c41;
  background-color: #cb8671;
  border-color: #cb8671;
}
.btn-headings:hover {
  color: white;
  background-color: #c16e55;
  border-color: #bd664c;
}
.btn-headings:focus, .btn-headings.focus {
  color: white;
  background-color: #c16e55;
  border-color: #bd664c;
  box-shadow: 0 0 0 0.2rem rgba(181, 123, 106, 0.5);
}
.btn-headings.disabled, .btn-headings:disabled {
  color: #3a3c41;
  background-color: #cb8671;
  border-color: #cb8671;
}
.btn-headings:not(:disabled):not(.disabled):active, .btn-headings:not(:disabled):not(.disabled).active, .show > .btn-headings.dropdown-toggle {
  color: white;
  background-color: #bd664c;
  border-color: #b95f44;
}
.btn-headings:not(:disabled):not(.disabled):active:focus, .btn-headings:not(:disabled):not(.disabled).active:focus, .show > .btn-headings.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(181, 123, 106, 0.5);
}
.btn-outline-primary {
  color: #E12326;
  border-color: #E12326;
}
.btn-outline-primary:hover {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-outline-primary:focus, .btn-outline-primary.focus {
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.5);
}
.btn-outline-primary.disabled, .btn-outline-primary:disabled {
  color: #E12326;
  background-color: transparent;
}
.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, .show > .btn-outline-primary.dropdown-toggle {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-primary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.5);
}
.btn-outline-secondary {
  color: #53555a;
  border-color: #53555a;
}
.btn-outline-secondary:hover {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-outline-secondary:focus, .btn-outline-secondary.focus {
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.5);
}
.btn-outline-secondary.disabled, .btn-outline-secondary:disabled {
  color: #53555a;
  background-color: transparent;
}
.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, .show > .btn-outline-secondary.dropdown-toggle {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-secondary.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.5);
}
.btn-outline-success {
  color: #6aa539;
  border-color: #6aa539;
}
.btn-outline-success:hover {
  color: white;
  background-color: #6aa539;
  border-color: #6aa539;
}
.btn-outline-success:focus, .btn-outline-success.focus {
  box-shadow: 0 0 0 0.2rem rgba(106, 165, 57, 0.5);
}
.btn-outline-success.disabled, .btn-outline-success:disabled {
  color: #6aa539;
  background-color: transparent;
}
.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, .show > .btn-outline-success.dropdown-toggle {
  color: white;
  background-color: #6aa539;
  border-color: #6aa539;
}
.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-success.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(106, 165, 57, 0.5);
}
.btn-outline-info {
  color: #17a2b8;
  border-color: #17a2b8;
}
.btn-outline-info:hover {
  color: white;
  background-color: #17a2b8;
  border-color: #17a2b8;
}
.btn-outline-info:focus, .btn-outline-info.focus {
  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
}
.btn-outline-info.disabled, .btn-outline-info:disabled {
  color: #17a2b8;
  background-color: transparent;
}
.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, .show > .btn-outline-info.dropdown-toggle {
  color: white;
  background-color: #17a2b8;
  border-color: #17a2b8;
}
.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-info.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
}
.btn-outline-warning {
  color: #fed600;
  border-color: #fed600;
}
.btn-outline-warning:hover {
  color: #3a3c41;
  background-color: #fed600;
  border-color: #fed600;
}
.btn-outline-warning:focus, .btn-outline-warning.focus {
  box-shadow: 0 0 0 0.2rem rgba(254, 214, 0, 0.5);
}
.btn-outline-warning.disabled, .btn-outline-warning:disabled {
  color: #fed600;
  background-color: transparent;
}
.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, .show > .btn-outline-warning.dropdown-toggle {
  color: #3a3c41;
  background-color: #fed600;
  border-color: #fed600;
}
.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-warning.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(254, 214, 0, 0.5);
}
.btn-outline-danger {
  color: #E12326;
  border-color: #E12326;
}
.btn-outline-danger:hover {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-outline-danger:focus, .btn-outline-danger.focus {
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.5);
}
.btn-outline-danger.disabled, .btn-outline-danger:disabled {
  color: #E12326;
  background-color: transparent;
}
.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, .show > .btn-outline-danger.dropdown-toggle {
  color: white;
  background-color: #E12326;
  border-color: #E12326;
}
.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-danger.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.5);
}
.btn-outline-light {
  color: #f2f2f2;
  border-color: #f2f2f2;
}
.btn-outline-light:hover {
  color: #3a3c41;
  background-color: #f2f2f2;
  border-color: #f2f2f2;
}
.btn-outline-light:focus, .btn-outline-light.focus {
  box-shadow: 0 0 0 0.2rem rgba(242, 242, 242, 0.5);
}
.btn-outline-light.disabled, .btn-outline-light:disabled {
  color: #f2f2f2;
  background-color: transparent;
}
.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, .show > .btn-outline-light.dropdown-toggle {
  color: #3a3c41;
  background-color: #f2f2f2;
  border-color: #f2f2f2;
}
.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-light.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(242, 242, 242, 0.5);
}
.btn-outline-dark {
  color: #53555a;
  border-color: #53555a;
}
.btn-outline-dark:hover {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-outline-dark:focus, .btn-outline-dark.focus {
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.5);
}
.btn-outline-dark.disabled, .btn-outline-dark:disabled {
  color: #53555a;
  background-color: transparent;
}
.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, .show > .btn-outline-dark.dropdown-toggle {
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-dark.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.5);
}
.btn-outline-border {
  color: #d4d4d5;
  border-color: #d4d4d5;
}
.btn-outline-border:hover {
  color: #3a3c41;
  background-color: #d4d4d5;
  border-color: #d4d4d5;
}
.btn-outline-border:focus, .btn-outline-border.focus {
  box-shadow: 0 0 0 0.2rem rgba(212, 212, 213, 0.5);
}
.btn-outline-border.disabled, .btn-outline-border:disabled {
  color: #d4d4d5;
  background-color: transparent;
}
.btn-outline-border:not(:disabled):not(.disabled):active, .btn-outline-border:not(:disabled):not(.disabled).active, .show > .btn-outline-border.dropdown-toggle {
  color: #3a3c41;
  background-color: #d4d4d5;
  border-color: #d4d4d5;
}
.btn-outline-border:not(:disabled):not(.disabled):active:focus, .btn-outline-border:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-border.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(212, 212, 213, 0.5);
}
.btn-outline-headings {
  color: #cb8671;
  border-color: #cb8671;
}
.btn-outline-headings:hover {
  color: #3a3c41;
  background-color: #cb8671;
  border-color: #cb8671;
}
.btn-outline-headings:focus, .btn-outline-headings.focus {
  box-shadow: 0 0 0 0.2rem rgba(203, 134, 113, 0.5);
}
.btn-outline-headings.disabled, .btn-outline-headings:disabled {
  color: #cb8671;
  background-color: transparent;
}
.btn-outline-headings:not(:disabled):not(.disabled):active, .btn-outline-headings:not(:disabled):not(.disabled).active, .show > .btn-outline-headings.dropdown-toggle {
  color: #3a3c41;
  background-color: #cb8671;
  border-color: #cb8671;
}
.btn-outline-headings:not(:disabled):not(.disabled):active:focus, .btn-outline-headings:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-headings.dropdown-toggle:focus {
  box-shadow: 0 0 0 0.2rem rgba(203, 134, 113, 0.5);
}
.btn-link {
  font-weight: 400;
  color: #E12326;
  text-decoration: none;
}
.btn-link:hover {
  color: #a11618;
  text-decoration: underline;
}
.btn-link:focus, .btn-link.focus {
  text-decoration: underline;
}
.btn-link:disabled, .btn-link.disabled {
  color: #98999b;
  pointer-events: none;
}
.btn-lg, .btn-group-lg > .btn {
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 0.3rem;
}
.btn-sm, .btn-group-sm > .btn {
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
  border-radius: 0.2rem;
}
.btn-block {
  display: block;
  width: 100%;
}
.btn-block + .btn-block {
  margin-top: 0.5rem;
}
input[type=submit].btn-block,
input[type=reset].btn-block,
input[type=button].btn-block {
  width: 100%;
}
.fade {
  transition: opacity 0.15s linear;
}
@media (prefers-reduced-motion: reduce) {
  .fade {
    transition: none;
  }
}
.fade:not(.show) {
  opacity: 0;
}
.collapse:not(.show) {
  display: none;
}
.collapsing {
  position: relative;
  height: 0;
  overflow: hidden;
  transition: height 0.35s ease;
}
@media (prefers-reduced-motion: reduce) {
  .collapsing {
    transition: none;
  }
}
.collapsing.width {
  width: 0;
  height: auto;
  transition: width 0.35s ease;
}
@media (prefers-reduced-motion: reduce) {
  .collapsing.width {
    transition: none;
  }
}
.dropup,
.dropright,
.dropdown,
.dropleft {
  position: relative;
}
.dropdown-toggle {
  white-space: nowrap;
}
.dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid;
  border-right: 0.3em solid transparent;
  border-bottom: 0;
  border-left: 0.3em solid transparent;
}
.dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropdown-menu {
  position: absolute;
  top: 100%;
  left: 0;
  z-index: 1000;
  display: none;
  float: left;
  min-width: 10rem;
  padding: 0.5rem 0;
  margin: 0.125rem 0 0;
  font-size: 1rem;
  color: #3a3c41;
  text-align: left;
  list-style: none;
  background-color: white;
  background-clip: padding-box;
  border: 1px solid rgba(33, 37, 41, 0.15);
  border-radius: 0.25rem;
}
.dropdown-menu-left {
  right: auto;
  left: 0;
}
.dropdown-menu-right {
  right: 0;
  left: auto;
}
@media (min-width: 576px) {
  .dropdown-menu-sm-left {
    right: auto;
    left: 0;
  }
  .dropdown-menu-sm-right {
    right: 0;
    left: auto;
  }
}
@media (min-width: 768px) {
  .dropdown-menu-md-left {
    right: auto;
    left: 0;
  }
  .dropdown-menu-md-right {
    right: 0;
    left: auto;
  }
}
@media (min-width: 992px) {
  .dropdown-menu-lg-left {
    right: auto;
    left: 0;
  }
  .dropdown-menu-lg-right {
    right: 0;
    left: auto;
  }
}
@media (min-width: 1200px) {
  .dropdown-menu-xl-left {
    right: auto;
    left: 0;
  }
  .dropdown-menu-xl-right {
    right: 0;
    left: auto;
  }
}
.dropup .dropdown-menu {
  top: auto;
  bottom: 100%;
  margin-top: 0;
  margin-bottom: 0.125rem;
}
.dropup .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0;
  border-right: 0.3em solid transparent;
  border-bottom: 0.3em solid;
  border-left: 0.3em solid transparent;
}
.dropup .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropright .dropdown-menu {
  top: 0;
  right: auto;
  left: 100%;
  margin-top: 0;
  margin-left: 0.125rem;
}
.dropright .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0;
  border-bottom: 0.3em solid transparent;
  border-left: 0.3em solid;
}
.dropright .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropright .dropdown-toggle::after {
  vertical-align: 0;
}
.dropleft .dropdown-menu {
  top: 0;
  right: 100%;
  left: auto;
  margin-top: 0;
  margin-right: 0.125rem;
}
.dropleft .dropdown-toggle::after {
  display: inline-block;
  margin-left: 0.255em;
  vertical-align: 0.255em;
  content: "";
}
.dropleft .dropdown-toggle::after {
  display: none;
}
.dropleft .dropdown-toggle::before {
  display: inline-block;
  margin-right: 0.255em;
  vertical-align: 0.255em;
  content: "";
  border-top: 0.3em solid transparent;
  border-right: 0.3em solid;
  border-bottom: 0.3em solid transparent;
}
.dropleft .dropdown-toggle:empty::after {
  margin-left: 0;
}
.dropleft .dropdown-toggle::before {
  vertical-align: 0;
}
.dropdown-menu[x-placement^=top], .dropdown-menu[x-placement^=right], .dropdown-menu[x-placement^=bottom], .dropdown-menu[x-placement^=left] {
  right: auto;
  bottom: auto;
}
.dropdown-divider {
  height: 0;
  margin: 0.5rem 0;
  overflow: hidden;
  border-top: 1px solid #e3e4e4;
}
.dropdown-item {
  display: block;
  width: 100%;
  padding: 0.25rem 1.5rem;
  clear: both;
  font-weight: 400;
  color: #3a3c41;
  text-align: inherit;
  white-space: nowrap;
  background-color: transparent;
  border: 0;
}
.dropdown-item:hover, .dropdown-item:focus {
  color: #2e3034;
  text-decoration: none;
  background-color: #e3e4e4;
}
.dropdown-item.active, .dropdown-item:active {
  color: white;
  text-decoration: none;
  background-color: #53555a;
}
.dropdown-item.disabled, .dropdown-item:disabled {
  color: #afb0b1;
  pointer-events: none;
  background-color: transparent;
}
.dropdown-menu.show {
  display: block;
}
.dropdown-header {
  display: block;
  padding: 0.5rem 1.5rem;
  margin-bottom: 0;
  font-size: 0.875rem;
  color: #98999b;
  white-space: nowrap;
}
.dropdown-item-text {
  display: block;
  padding: 0.25rem 1.5rem;
  color: #3a3c41;
}
.btn-group,
.btn-group-vertical {
  position: relative;
  display: inline-flex;
  vertical-align: middle;
}
.btn-group > .btn,
.btn-group-vertical > .btn {
  position: relative;
  flex: 1 1 auto;
}
.btn-group > .btn:hover,
.btn-group-vertical > .btn:hover {
  z-index: 1;
}
.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active,
.btn-group-vertical > .btn:focus,
.btn-group-vertical > .btn:active,
.btn-group-vertical > .btn.active {
  z-index: 1;
}
.btn-toolbar {
  display: flex;
  flex-wrap: wrap;
  justify-content: flex-start;
}
.btn-toolbar .input-group {
  width: auto;
}
.btn-group > .btn:not(:first-child),
.btn-group > .btn-group:not(:first-child) {
  margin-left: -1px;
}
.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
.btn-group > .btn-group:not(:last-child) > .btn {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.btn-group > .btn:not(:first-child),
.btn-group > .btn-group:not(:first-child) > .btn {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.dropdown-toggle-split {
  padding-right: 0.5625rem;
  padding-left: 0.5625rem;
}
.dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropright .dropdown-toggle-split::after {
  margin-left: 0;
}
.dropleft .dropdown-toggle-split::before {
  margin-right: 0;
}
.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
  padding-right: 0.375rem;
  padding-left: 0.375rem;
}
.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
  padding-right: 0.75rem;
  padding-left: 0.75rem;
}
.btn-group-vertical {
  flex-direction: column;
  align-items: flex-start;
  justify-content: center;
}
.btn-group-vertical > .btn,
.btn-group-vertical > .btn-group {
  width: 100%;
}
.btn-group-vertical > .btn:not(:first-child),
.btn-group-vertical > .btn-group:not(:first-child) {
  margin-top: -1px;
}
.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
.btn-group-vertical > .btn-group:not(:last-child) > .btn {
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0;
}
.btn-group-vertical > .btn:not(:first-child),
.btn-group-vertical > .btn-group:not(:first-child) > .btn {
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}
.btn-group-toggle > .btn,
.btn-group-toggle > .btn-group > .btn {
  margin-bottom: 0;
}
.btn-group-toggle > .btn input[type=radio],
.btn-group-toggle > .btn input[type=checkbox],
.btn-group-toggle > .btn-group > .btn input[type=radio],
.btn-group-toggle > .btn-group > .btn input[type=checkbox] {
  position: absolute;
  clip: rect(0, 0, 0, 0);
  pointer-events: none;
}
.input-group {
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: stretch;
  width: 100%;
}
.input-group > .form-control,
.input-group > .form-control-plaintext,
.input-group > .custom-select,
.input-group > .custom-file {
  position: relative;
  flex: 1 1 auto;
  width: 1%;
  min-width: 0;
  margin-bottom: 0;
}
.input-group > .form-control + .form-control,
.input-group > .form-control + .custom-select,
.input-group > .form-control + .custom-file,
.input-group > .form-control-plaintext + .form-control,
.input-group > .form-control-plaintext + .custom-select,
.input-group > .form-control-plaintext + .custom-file,
.input-group > .custom-select + .form-control,
.input-group > .custom-select + .custom-select,
.input-group > .custom-select + .custom-file,
.input-group > .custom-file + .form-control,
.input-group > .custom-file + .custom-select,
.input-group > .custom-file + .custom-file {
  margin-left: -1px;
}
.input-group > .form-control:focus,
.input-group > .custom-select:focus,
.input-group > .custom-file .custom-file-input:focus ~ .custom-file-label {
  z-index: 3;
}
.input-group > .custom-file .custom-file-input:focus {
  z-index: 4;
}
.input-group > .form-control:not(:first-child),
.input-group > .custom-select:not(:first-child) {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.input-group > .custom-file {
  display: flex;
  align-items: center;
}
.input-group > .custom-file:not(:last-child) .custom-file-label, .input-group > .custom-file:not(:last-child) .custom-file-label::after {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group > .custom-file:not(:first-child) .custom-file-label {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.input-group:not(.has-validation) > .form-control:not(:last-child),
.input-group:not(.has-validation) > .custom-select:not(:last-child),
.input-group:not(.has-validation) > .custom-file:not(:last-child) .custom-file-label,
.input-group:not(.has-validation) > .custom-file:not(:last-child) .custom-file-label::after {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group.has-validation > .form-control:nth-last-child(n+3),
.input-group.has-validation > .custom-select:nth-last-child(n+3),
.input-group.has-validation > .custom-file:nth-last-child(n+3) .custom-file-label,
.input-group.has-validation > .custom-file:nth-last-child(n+3) .custom-file-label::after {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group-prepend,
.input-group-append {
  display: flex;
}
.input-group-prepend .btn,
.input-group-append .btn {
  position: relative;
  z-index: 2;
}
.input-group-prepend .btn:focus,
.input-group-append .btn:focus {
  z-index: 3;
}
.input-group-prepend .btn + .btn,
.input-group-prepend .btn + .input-group-text,
.input-group-prepend .input-group-text + .input-group-text,
.input-group-prepend .input-group-text + .btn,
.input-group-append .btn + .btn,
.input-group-append .btn + .input-group-text,
.input-group-append .input-group-text + .input-group-text,
.input-group-append .input-group-text + .btn {
  margin-left: -1px;
}
.input-group-prepend {
  margin-right: -1px;
}
.input-group-append {
  margin-left: -1px;
}
.input-group-text {
  display: flex;
  align-items: center;
  padding: 0.375rem 0.75rem;
  margin-bottom: 0;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #53555a;
  text-align: center;
  white-space: nowrap;
  background-color: #e3e4e4;
  border: 1px solid #c3c3c4;
  border-radius: 0.25rem;
}
.input-group-text input[type=radio],
.input-group-text input[type=checkbox] {
  margin-top: 0;
}
.input-group-lg > .form-control:not(textarea),
.input-group-lg > .custom-select {
  height: calc(1.5em + 1rem + 2px);
}
.input-group-lg > .form-control,
.input-group-lg > .custom-select,
.input-group-lg > .input-group-prepend > .input-group-text,
.input-group-lg > .input-group-append > .input-group-text,
.input-group-lg > .input-group-prepend > .btn,
.input-group-lg > .input-group-append > .btn {
  padding: 0.5rem 1rem;
  font-size: 1.25rem;
  line-height: 1.5;
  border-radius: 0.3rem;
}
.input-group-sm > .form-control:not(textarea),
.input-group-sm > .custom-select {
  height: calc(1.5em + 0.5rem + 2px);
}
.input-group-sm > .form-control,
.input-group-sm > .custom-select,
.input-group-sm > .input-group-prepend > .input-group-text,
.input-group-sm > .input-group-append > .input-group-text,
.input-group-sm > .input-group-prepend > .btn,
.input-group-sm > .input-group-append > .btn {
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
  border-radius: 0.2rem;
}
.input-group-lg > .custom-select,
.input-group-sm > .custom-select {
  padding-right: 1.75rem;
}
.input-group > .input-group-prepend > .btn,
.input-group > .input-group-prepend > .input-group-text,
.input-group:not(.has-validation) > .input-group-append:not(:last-child) > .btn,
.input-group:not(.has-validation) > .input-group-append:not(:last-child) > .input-group-text,
.input-group.has-validation > .input-group-append:nth-last-child(n+3) > .btn,
.input-group.has-validation > .input-group-append:nth-last-child(n+3) > .input-group-text,
.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle),
.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
}
.input-group > .input-group-append > .btn,
.input-group > .input-group-append > .input-group-text,
.input-group > .input-group-prepend:not(:first-child) > .btn,
.input-group > .input-group-prepend:not(:first-child) > .input-group-text,
.input-group > .input-group-prepend:first-child > .btn:not(:first-child),
.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
}
.custom-control {
  position: relative;
  z-index: 1;
  display: block;
  min-height: 1.5rem;
  padding-left: 1.5rem;
  print-color-adjust: exact;
}
.custom-control-inline {
  display: inline-flex;
  margin-right: 1rem;
}
.custom-control-input {
  position: absolute;
  left: 0;
  z-index: -1;
  width: 1rem;
  height: 1.25rem;
  opacity: 0;
}
.custom-control-input:checked ~ .custom-control-label::before {
  color: white;
  border-color: #53555a;
  background-color: #53555a;
}
.custom-control-input:focus ~ .custom-control-label::before {
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.custom-control-input:focus:not(:checked) ~ .custom-control-label::before {
  border-color: #92949a;
}
.custom-control-input:not(:disabled):active ~ .custom-control-label::before {
  color: white;
  background-color: #adaeb3;
  border-color: #adaeb3;
}
.custom-control-input[disabled] ~ .custom-control-label, .custom-control-input:disabled ~ .custom-control-label {
  color: #98999b;
}
.custom-control-input[disabled] ~ .custom-control-label::before, .custom-control-input:disabled ~ .custom-control-label::before {
  background-color: #e3e4e4;
}
.custom-control-label {
  position: relative;
  margin-bottom: 0;
  vertical-align: top;
}
.custom-control-label::before {
  position: absolute;
  top: 0.25rem;
  left: -1.5rem;
  display: block;
  width: 1rem;
  height: 1rem;
  pointer-events: none;
  content: "";
  background-color: white;
  border: 1px solid #afb0b1;
}
.custom-control-label::after {
  position: absolute;
  top: 0.25rem;
  left: -1.5rem;
  display: block;
  width: 1rem;
  height: 1rem;
  content: "";
  background: 50%/50% 50% no-repeat;
}
.custom-checkbox .custom-control-label::before {
  border-radius: 0.25rem;
}
.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='white' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26l2.974 2.99L8 2.193z'/%3e%3c/svg%3e");
}
.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before {
  border-color: #53555a;
  background-color: #53555a;
}
.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='4' viewBox='0 0 4 4'%3e%3cpath stroke='white' d='M0 2h4'/%3e%3c/svg%3e");
}
.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: rgba(225, 35, 38, 0.5);
}
.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before {
  background-color: rgba(225, 35, 38, 0.5);
}
.custom-radio .custom-control-label::before {
  border-radius: 50%;
}
.custom-radio .custom-control-input:checked ~ .custom-control-label::after {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='white'/%3e%3c/svg%3e");
}
.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: rgba(225, 35, 38, 0.5);
}
.custom-switch {
  padding-left: 2.25rem;
}
.custom-switch .custom-control-label::before {
  left: -2.25rem;
  width: 1.75rem;
  pointer-events: all;
  border-radius: 0.5rem;
}
.custom-switch .custom-control-label::after {
  top: calc(0.25rem + 2px);
  left: calc(-2.25rem + 2px);
  width: calc(1rem - 4px);
  height: calc(1rem - 4px);
  background-color: #afb0b1;
  border-radius: 0.5rem;
  transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .custom-switch .custom-control-label::after {
    transition: none;
  }
}
.custom-switch .custom-control-input:checked ~ .custom-control-label::after {
  background-color: white;
  transform: translateX(0.75rem);
}
.custom-switch .custom-control-input:disabled:checked ~ .custom-control-label::before {
  background-color: rgba(225, 35, 38, 0.5);
}
.custom-select {
  display: inline-block;
  width: 100%;
  height: calc(1.5em + 0.75rem + 2px);
  padding: 0.375rem 1.75rem 0.375rem 0.75rem;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #53555a;
  vertical-align: middle;
  background: white url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%2353555a' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") right 0.75rem center/8px 10px no-repeat;
  border: 1px solid #c3c3c4;
  border-radius: 0.25rem;
  appearance: none;
}
.custom-select:focus {
  border-color: #92949a;
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.custom-select:focus::-ms-value {
  color: #53555a;
  background-color: white;
}
.custom-select[multiple], .custom-select[size]:not([size="1"]) {
  height: auto;
  padding-right: 0.75rem;
  background-image: none;
}
.custom-select:disabled {
  color: #98999b;
  background-color: #e3e4e4;
}
.custom-select::-ms-expand {
  display: none;
}
.custom-select:-moz-focusring {
  color: transparent;
  text-shadow: 0 0 0 #53555a;
}
.custom-select-sm {
  height: calc(1.5em + 0.5rem + 2px);
  padding-top: 0.25rem;
  padding-bottom: 0.25rem;
  padding-left: 0.5rem;
  font-size: 0.875rem;
}
.custom-select-lg {
  height: calc(1.5em + 1rem + 2px);
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
  padding-left: 1rem;
  font-size: 1.25rem;
}
.custom-file {
  position: relative;
  display: inline-block;
  width: 100%;
  height: calc(1.5em + 0.75rem + 2px);
  margin-bottom: 0;
}
.custom-file-input {
  position: relative;
  z-index: 2;
  width: 100%;
  height: calc(1.5em + 0.75rem + 2px);
  margin: 0;
  overflow: hidden;
  opacity: 0;
}
.custom-file-input:focus ~ .custom-file-label {
  border-color: #92949a;
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.custom-file-input[disabled] ~ .custom-file-label, .custom-file-input:disabled ~ .custom-file-label {
  background-color: #e3e4e4;
}
.custom-file-input:lang(en) ~ .custom-file-label::after {
  content: "Browse";
}
.custom-file-input ~ .custom-file-label[data-browse]::after {
  content: attr(data-browse);
}
.custom-file-label {
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1;
  height: calc(1.5em + 0.75rem + 2px);
  padding: 0.375rem 0.75rem;
  overflow: hidden;
  font-weight: 400;
  line-height: 1.5;
  color: #53555a;
  background-color: white;
  border: 1px solid #c3c3c4;
  border-radius: 0.25rem;
}
.custom-file-label::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  z-index: 3;
  display: block;
  height: calc(1.5em + 0.75rem);
  padding: 0.375rem 0.75rem;
  line-height: 1.5;
  color: #53555a;
  content: "Browse";
  background-color: #e3e4e4;
  border-left: inherit;
  border-radius: 0 0.25rem 0.25rem 0;
}
.custom-range {
  width: 100%;
  height: 1.4rem;
  padding: 0;
  background-color: transparent;
  appearance: none;
}
.custom-range:focus {
  outline: 0;
}
.custom-range:focus::-webkit-slider-thumb {
  box-shadow: 0 0 0 1px white, 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.custom-range:focus::-moz-range-thumb {
  box-shadow: 0 0 0 1px white, 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.custom-range:focus::-ms-thumb {
  box-shadow: 0 0 0 1px white, 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.custom-range::-moz-focus-outer {
  border: 0;
}
.custom-range::-webkit-slider-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: -0.25rem;
  background-color: #53555a;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  appearance: none;
}
@media (prefers-reduced-motion: reduce) {
  .custom-range::-webkit-slider-thumb {
    transition: none;
  }
}
.custom-range::-webkit-slider-thumb:active {
  background-color: #adaeb3;
}
.custom-range::-webkit-slider-runnable-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: #d4d4d5;
  border-color: transparent;
  border-radius: 1rem;
}
.custom-range::-moz-range-thumb {
  width: 1rem;
  height: 1rem;
  background-color: #53555a;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  appearance: none;
}
@media (prefers-reduced-motion: reduce) {
  .custom-range::-moz-range-thumb {
    transition: none;
  }
}
.custom-range::-moz-range-thumb:active {
  background-color: #adaeb3;
}
.custom-range::-moz-range-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: #d4d4d5;
  border-color: transparent;
  border-radius: 1rem;
}
.custom-range::-ms-thumb {
  width: 1rem;
  height: 1rem;
  margin-top: 0;
  margin-right: 0.2rem;
  margin-left: 0.2rem;
  background-color: #53555a;
  border: 0;
  border-radius: 1rem;
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
  appearance: none;
}
@media (prefers-reduced-motion: reduce) {
  .custom-range::-ms-thumb {
    transition: none;
  }
}
.custom-range::-ms-thumb:active {
  background-color: #adaeb3;
}
.custom-range::-ms-track {
  width: 100%;
  height: 0.5rem;
  color: transparent;
  cursor: pointer;
  background-color: transparent;
  border-color: transparent;
  border-width: 0.5rem;
}
.custom-range::-ms-fill-lower {
  background-color: #d4d4d5;
  border-radius: 1rem;
}
.custom-range::-ms-fill-upper {
  margin-right: 15px;
  background-color: #d4d4d5;
  border-radius: 1rem;
}
.custom-range:disabled::-webkit-slider-thumb {
  background-color: #afb0b1;
}
.custom-range:disabled::-webkit-slider-runnable-track {
  cursor: default;
}
.custom-range:disabled::-moz-range-thumb {
  background-color: #afb0b1;
}
.custom-range:disabled::-moz-range-track {
  cursor: default;
}
.custom-range:disabled::-ms-thumb {
  background-color: #afb0b1;
}
.custom-control-label::before,
.custom-file-label,
.custom-select {
  transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .custom-control-label::before,
  .custom-file-label,
  .custom-select {
    transition: none;
  }
}
.nav {
  display: flex;
  flex-wrap: wrap;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}
.nav-link {
  display: block;
  padding: 0.5rem 1rem;
}
.nav-link:hover, .nav-link:focus {
  text-decoration: none;
}
.nav-link.disabled {
  color: #98999b;
  pointer-events: none;
  cursor: default;
}
.nav-tabs {
  border-bottom: 1px solid #d4d4d5;
}
.nav-tabs .nav-link {
  margin-bottom: -1px;
  background-color: transparent;
  border: 1px solid transparent;
  border-top-left-radius: 0.25rem;
  border-top-right-radius: 0.25rem;
}
.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
  isolation: isolate;
  border-color: #e3e4e4 #e3e4e4 #d4d4d5;
}
.nav-tabs .nav-link.disabled {
  color: #98999b;
  background-color: transparent;
  border-color: transparent;
}
.nav-tabs .nav-link.active,
.nav-tabs .nav-item.show .nav-link {
  color: #7c7d80;
  background-color: white;
  border-color: #d4d4d5 #d4d4d5 white;
}
.nav-tabs .dropdown-menu {
  margin-top: -1px;
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}
.nav-pills .nav-link {
  background: none;
  border: 0;
  border-radius: 0.25rem;
}
.nav-pills .nav-link.active,
.nav-pills .show > .nav-link {
  color: white;
  background-color: #53555a;
}
.nav-fill > .nav-link,
.nav-fill .nav-item {
  flex: 1 1 auto;
  text-align: center;
}
.nav-justified > .nav-link,
.nav-justified .nav-item {
  flex-basis: 0;
  flex-grow: 1;
  text-align: center;
}
.tab-content > .tab-pane {
  display: none;
}
.tab-content > .active {
  display: block;
}
.navbar {
  position: relative;
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: space-between;
  padding: 0.5rem 1rem;
}
.navbar .container,
.navbar .container-fluid,
.navbar .container-sm,
.navbar .container-md,
.navbar .container-lg,
.navbar .container-xl {
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: space-between;
}
.navbar-brand {
  display: inline-block;
  padding-top: 0.3125rem;
  padding-bottom: 0.3125rem;
  margin-right: 1rem;
  font-size: 1.25rem;
  line-height: inherit;
  white-space: nowrap;
}
.navbar-brand:hover, .navbar-brand:focus {
  text-decoration: none;
}
.navbar-nav {
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none;
}
.navbar-nav .nav-link {
  padding-right: 0;
  padding-left: 0;
}
.navbar-nav .dropdown-menu {
  position: static;
  float: none;
}
.navbar-text {
  display: inline-block;
  padding-top: 0.5rem;
  padding-bottom: 0.5rem;
}
.navbar-collapse {
  flex-basis: 100%;
  flex-grow: 1;
  align-items: center;
}
.navbar-toggler {
  padding: 0.25rem 0.75rem;
  font-size: 1.25rem;
  line-height: 1;
  background-color: transparent;
  border: 1px solid transparent;
  border-radius: 0.25rem;
}
.navbar-toggler:hover, .navbar-toggler:focus {
  text-decoration: none;
}
.navbar-toggler-icon {
  display: inline-block;
  width: 1.5em;
  height: 1.5em;
  vertical-align: middle;
  content: "";
  background: 50%/100% 100% no-repeat;
}
.navbar-nav-scroll {
  max-height: 75vh;
  overflow-y: auto;
}
@media (max-width: 575.98px) {
  .navbar-expand-sm > .container,
  .navbar-expand-sm > .container-fluid,
  .navbar-expand-sm > .container-sm,
  .navbar-expand-sm > .container-md,
  .navbar-expand-sm > .container-lg,
  .navbar-expand-sm > .container-xl {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 576px) {
  .navbar-expand-sm {
    flex-flow: row nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-sm .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-sm .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-sm .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }
  .navbar-expand-sm > .container,
  .navbar-expand-sm > .container-fluid,
  .navbar-expand-sm > .container-sm,
  .navbar-expand-sm > .container-md,
  .navbar-expand-sm > .container-lg,
  .navbar-expand-sm > .container-xl {
    flex-wrap: nowrap;
  }
  .navbar-expand-sm .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-sm .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-sm .navbar-toggler {
    display: none;
  }
}
@media (max-width: 767.98px) {
  .navbar-expand-md > .container,
  .navbar-expand-md > .container-fluid,
  .navbar-expand-md > .container-sm,
  .navbar-expand-md > .container-md,
  .navbar-expand-md > .container-lg,
  .navbar-expand-md > .container-xl {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 768px) {
  .navbar-expand-md {
    flex-flow: row nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-md .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-md .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-md .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }
  .navbar-expand-md > .container,
  .navbar-expand-md > .container-fluid,
  .navbar-expand-md > .container-sm,
  .navbar-expand-md > .container-md,
  .navbar-expand-md > .container-lg,
  .navbar-expand-md > .container-xl {
    flex-wrap: nowrap;
  }
  .navbar-expand-md .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-md .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-md .navbar-toggler {
    display: none;
  }
}
@media (max-width: 991.98px) {
  .navbar-expand-lg > .container,
  .navbar-expand-lg > .container-fluid,
  .navbar-expand-lg > .container-sm,
  .navbar-expand-lg > .container-md,
  .navbar-expand-lg > .container-lg,
  .navbar-expand-lg > .container-xl {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 992px) {
  .navbar-expand-lg {
    flex-flow: row nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-lg .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-lg .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-lg .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }
  .navbar-expand-lg > .container,
  .navbar-expand-lg > .container-fluid,
  .navbar-expand-lg > .container-sm,
  .navbar-expand-lg > .container-md,
  .navbar-expand-lg > .container-lg,
  .navbar-expand-lg > .container-xl {
    flex-wrap: nowrap;
  }
  .navbar-expand-lg .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-lg .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-lg .navbar-toggler {
    display: none;
  }
}
@media (max-width: 1199.98px) {
  .navbar-expand-xl > .container,
  .navbar-expand-xl > .container-fluid,
  .navbar-expand-xl > .container-sm,
  .navbar-expand-xl > .container-md,
  .navbar-expand-xl > .container-lg,
  .navbar-expand-xl > .container-xl {
    padding-right: 0;
    padding-left: 0;
  }
}
@media (min-width: 1200px) {
  .navbar-expand-xl {
    flex-flow: row nowrap;
    justify-content: flex-start;
  }
  .navbar-expand-xl .navbar-nav {
    flex-direction: row;
  }
  .navbar-expand-xl .navbar-nav .dropdown-menu {
    position: absolute;
  }
  .navbar-expand-xl .navbar-nav .nav-link {
    padding-right: 0.5rem;
    padding-left: 0.5rem;
  }
  .navbar-expand-xl > .container,
  .navbar-expand-xl > .container-fluid,
  .navbar-expand-xl > .container-sm,
  .navbar-expand-xl > .container-md,
  .navbar-expand-xl > .container-lg,
  .navbar-expand-xl > .container-xl {
    flex-wrap: nowrap;
  }
  .navbar-expand-xl .navbar-nav-scroll {
    overflow: visible;
  }
  .navbar-expand-xl .navbar-collapse {
    display: flex !important;
    flex-basis: auto;
  }
  .navbar-expand-xl .navbar-toggler {
    display: none;
  }
}
.navbar-expand {
  flex-flow: row nowrap;
  justify-content: flex-start;
}
.navbar-expand > .container,
.navbar-expand > .container-fluid,
.navbar-expand > .container-sm,
.navbar-expand > .container-md,
.navbar-expand > .container-lg,
.navbar-expand > .container-xl {
  padding-right: 0;
  padding-left: 0;
}
.navbar-expand .navbar-nav {
  flex-direction: row;
}
.navbar-expand .navbar-nav .dropdown-menu {
  position: absolute;
}
.navbar-expand .navbar-nav .nav-link {
  padding-right: 0.5rem;
  padding-left: 0.5rem;
}
.navbar-expand > .container,
.navbar-expand > .container-fluid,
.navbar-expand > .container-sm,
.navbar-expand > .container-md,
.navbar-expand > .container-lg,
.navbar-expand > .container-xl {
  flex-wrap: nowrap;
}
.navbar-expand .navbar-nav-scroll {
  overflow: visible;
}
.navbar-expand .navbar-collapse {
  display: flex !important;
  flex-basis: auto;
}
.navbar-expand .navbar-toggler {
  display: none;
}
.navbar-light .navbar-brand {
  color: rgba(33, 37, 41, 0.9);
}
.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus {
  color: rgba(33, 37, 41, 0.9);
}
.navbar-light .navbar-nav .nav-link {
  color: rgba(33, 37, 41, 0.5);
}
.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus {
  color: rgba(33, 37, 41, 0.7);
}
.navbar-light .navbar-nav .nav-link.disabled {
  color: rgba(33, 37, 41, 0.3);
}
.navbar-light .navbar-nav .show > .nav-link,
.navbar-light .navbar-nav .active > .nav-link,
.navbar-light .navbar-nav .nav-link.show,
.navbar-light .navbar-nav .nav-link.active {
  color: rgba(33, 37, 41, 0.9);
}
.navbar-light .navbar-toggler {
  color: rgba(33, 37, 41, 0.5);
  border-color: rgba(33, 37, 41, 0.1);
}
.navbar-light .navbar-toggler-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.5%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
}
.navbar-light .navbar-text {
  color: rgba(33, 37, 41, 0.5);
}
.navbar-light .navbar-text a {
  color: rgba(33, 37, 41, 0.9);
}
.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus {
  color: rgba(33, 37, 41, 0.9);
}
.navbar-dark .navbar-brand {
  color: white;
}
.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus {
  color: white;
}
.navbar-dark .navbar-nav .nav-link {
  color: rgba(255, 255, 255, 0.5);
}
.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus {
  color: rgba(255, 255, 255, 0.75);
}
.navbar-dark .navbar-nav .nav-link.disabled {
  color: rgba(255, 255, 255, 0.25);
}
.navbar-dark .navbar-nav .show > .nav-link,
.navbar-dark .navbar-nav .active > .nav-link,
.navbar-dark .navbar-nav .nav-link.show,
.navbar-dark .navbar-nav .nav-link.active {
  color: white;
}
.navbar-dark .navbar-toggler {
  color: rgba(255, 255, 255, 0.5);
  border-color: rgba(255, 255, 255, 0.1);
}
.navbar-dark .navbar-toggler-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.5%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
}
.navbar-dark .navbar-text {
  color: rgba(255, 255, 255, 0.5);
}
.navbar-dark .navbar-text a {
  color: white;
}
.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus {
  color: white;
}
.card {
  position: relative;
  display: flex;
  flex-direction: column;
  min-width: 0;
  word-wrap: break-word;
  background-color: white;
  background-clip: border-box;
  border: 1px solid rgba(33, 37, 41, 0.125);
  border-radius: 0.25rem;
}
.card > hr {
  margin-right: 0;
  margin-left: 0;
}
.card > .list-group {
  border-top: inherit;
  border-bottom: inherit;
}
.card > .list-group:first-child {
  border-top-width: 0;
  border-top-left-radius: calc(0.25rem - 1px);
  border-top-right-radius: calc(0.25rem - 1px);
}
.card > .list-group:last-child {
  border-bottom-width: 0;
  border-bottom-right-radius: calc(0.25rem - 1px);
  border-bottom-left-radius: calc(0.25rem - 1px);
}
.card > .card-header + .list-group,
.card > .list-group + .card-footer {
  border-top: 0;
}
.card-body {
  flex: 1 1 auto;
  min-height: 1px;
  padding: 1.25rem;
}
.card-title {
  margin-bottom: 0.75rem;
}
.card-subtitle {
  margin-top: -0.375rem;
  margin-bottom: 0;
}
.card-text:last-child {
  margin-bottom: 0;
}
.card-link:hover {
  text-decoration: none;
}
.card-link + .card-link {
  margin-left: 1.25rem;
}
.card-header {
  padding: 0.75rem 1.25rem;
  margin-bottom: 0;
  background-color: rgba(33, 37, 41, 0.03);
  border-bottom: 1px solid rgba(33, 37, 41, 0.125);
}
.card-header:first-child {
  border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0;
}
.card-footer {
  padding: 0.75rem 1.25rem;
  background-color: rgba(33, 37, 41, 0.03);
  border-top: 1px solid rgba(33, 37, 41, 0.125);
}
.card-footer:last-child {
  border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px);
}
.card-header-tabs {
  margin-right: -0.625rem;
  margin-bottom: -0.75rem;
  margin-left: -0.625rem;
  border-bottom: 0;
}
.card-header-pills {
  margin-right: -0.625rem;
  margin-left: -0.625rem;
}
.card-img-overlay {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  padding: 1.25rem;
  border-radius: calc(0.25rem - 1px);
}
.card-img,
.card-img-top,
.card-img-bottom {
  flex-shrink: 0;
  width: 100%;
}
.card-img,
.card-img-top {
  border-top-left-radius: calc(0.25rem - 1px);
  border-top-right-radius: calc(0.25rem - 1px);
}
.card-img,
.card-img-bottom {
  border-bottom-right-radius: calc(0.25rem - 1px);
  border-bottom-left-radius: calc(0.25rem - 1px);
}
.card-deck .card {
  margin-bottom: 15px;
}
@media (min-width: 576px) {
  .card-deck {
    display: flex;
    flex-flow: row wrap;
    margin-right: -15px;
    margin-left: -15px;
  }
  .card-deck .card {
    flex: 1 0 0%;
    margin-right: 15px;
    margin-bottom: 0;
    margin-left: 15px;
  }
}
.card-group > .card {
  margin-bottom: 15px;
}
@media (min-width: 576px) {
  .card-group {
    display: flex;
    flex-flow: row wrap;
  }
  .card-group > .card {
    flex: 1 0 0%;
    margin-bottom: 0;
  }
  .card-group > .card + .card {
    margin-left: 0;
    border-left: 0;
  }
  .card-group > .card:not(:last-child) {
    border-top-right-radius: 0;
    border-bottom-right-radius: 0;
  }
  .card-group > .card:not(:last-child) .card-img-top,
  .card-group > .card:not(:last-child) .card-header {
    border-top-right-radius: 0;
  }
  .card-group > .card:not(:last-child) .card-img-bottom,
  .card-group > .card:not(:last-child) .card-footer {
    border-bottom-right-radius: 0;
  }
  .card-group > .card:not(:first-child) {
    border-top-left-radius: 0;
    border-bottom-left-radius: 0;
  }
  .card-group > .card:not(:first-child) .card-img-top,
  .card-group > .card:not(:first-child) .card-header {
    border-top-left-radius: 0;
  }
  .card-group > .card:not(:first-child) .card-img-bottom,
  .card-group > .card:not(:first-child) .card-footer {
    border-bottom-left-radius: 0;
  }
}
.card-columns .card {
  margin-bottom: 0.75rem;
}
@media (min-width: 576px) {
  .card-columns {
    column-count: 3;
    column-gap: 1.25rem;
    orphans: 1;
    widows: 1;
  }
  .card-columns .card {
    display: inline-block;
    width: 100%;
  }
}
.accordion {
  overflow-anchor: none;
}
.accordion > .card {
  overflow: hidden;
}
.accordion > .card:not(:last-of-type) {
  border-bottom: 0;
  border-bottom-right-radius: 0;
  border-bottom-left-radius: 0;
}
.accordion > .card:not(:first-of-type) {
  border-top-left-radius: 0;
  border-top-right-radius: 0;
}
.accordion > .card > .card-header {
  border-radius: 0;
  margin-bottom: -1px;
}
.breadcrumb {
  display: flex;
  flex-wrap: wrap;
  padding: 0.75rem 1rem;
  margin-bottom: 1rem;
  list-style: none;
  background-color: #e3e4e4;
  border-radius: 0.25rem;
}
.breadcrumb-item + .breadcrumb-item {
  padding-left: 0.5rem;
}
.breadcrumb-item + .breadcrumb-item::before {
  float: left;
  padding-right: 0.5rem;
  color: #98999b;
  content: "/";
}
.breadcrumb-item + .breadcrumb-item:hover::before {
  text-decoration: underline;
}
.breadcrumb-item + .breadcrumb-item:hover::before {
  text-decoration: none;
}
.breadcrumb-item.active {
  color: #98999b;
}
.pagination {
  display: flex;
  padding-left: 0;
  list-style: none;
  border-radius: 0.25rem;
}
.page-link {
  position: relative;
  display: block;
  padding: 0.5rem 0.75rem;
  margin-left: -1px;
  line-height: 1.25;
  color: #E12326;
  background-color: white;
  border: 1px solid #d4d4d5;
}
.page-link:hover {
  z-index: 2;
  color: #a11618;
  text-decoration: none;
  background-color: #e3e4e4;
  border-color: #d4d4d5;
}
.page-link:focus {
  z-index: 3;
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.25);
}
.page-item:first-child .page-link {
  margin-left: 0;
  border-top-left-radius: 0.25rem;
  border-bottom-left-radius: 0.25rem;
}
.page-item:last-child .page-link {
  border-top-right-radius: 0.25rem;
  border-bottom-right-radius: 0.25rem;
}
.page-item.active .page-link {
  z-index: 3;
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.page-item.disabled .page-link {
  color: #98999b;
  pointer-events: none;
  cursor: auto;
  background-color: white;
  border-color: #d4d4d5;
}
.pagination-lg .page-link {
  padding: 0.75rem 1.5rem;
  font-size: 1.25rem;
  line-height: 1.5;
}
.pagination-lg .page-item:first-child .page-link {
  border-top-left-radius: 0.3rem;
  border-bottom-left-radius: 0.3rem;
}
.pagination-lg .page-item:last-child .page-link {
  border-top-right-radius: 0.3rem;
  border-bottom-right-radius: 0.3rem;
}
.pagination-sm .page-link {
  padding: 0.25rem 0.5rem;
  font-size: 0.875rem;
  line-height: 1.5;
}
.pagination-sm .page-item:first-child .page-link {
  border-top-left-radius: 0.2rem;
  border-bottom-left-radius: 0.2rem;
}
.pagination-sm .page-item:last-child .page-link {
  border-top-right-radius: 0.2rem;
  border-bottom-right-radius: 0.2rem;
}
.badge {
  display: inline-block;
  padding: 0.25em 0.4em;
  font-size: 75%;
  font-weight: 700;
  line-height: 1;
  text-align: center;
  white-space: nowrap;
  vertical-align: baseline;
  border-radius: 0.25rem;
  transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .badge {
    transition: none;
  }
}
a.badge:hover, a.badge:focus {
  text-decoration: none;
}
.badge:empty {
  display: none;
}
.btn .badge {
  position: relative;
  top: -1px;
}
.badge-pill {
  padding-right: 0.6em;
  padding-left: 0.6em;
  border-radius: 10rem;
}
.badge-primary {
  color: white;
  background-color: #E12326;
}
a.badge-primary:hover, a.badge-primary:focus {
  color: white;
  background-color: #b8191c;
}
a.badge-primary:focus, a.badge-primary.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.5);
}
.badge-secondary {
  color: white;
  background-color: #53555a;
}
a.badge-secondary:hover, a.badge-secondary:focus {
  color: white;
  background-color: #3b3c3f;
}
a.badge-secondary:focus, a.badge-secondary.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.5);
}
.badge-success {
  color: white;
  background-color: #6aa539;
}
a.badge-success:hover, a.badge-success:focus {
  color: white;
  background-color: #527f2c;
}
a.badge-success:focus, a.badge-success.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(106, 165, 57, 0.5);
}
.badge-info {
  color: white;
  background-color: #17a2b8;
}
a.badge-info:hover, a.badge-info:focus {
  color: white;
  background-color: #117a8b;
}
a.badge-info:focus, a.badge-info.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5);
}
.badge-warning {
  color: #3a3c41;
  background-color: #fed600;
}
a.badge-warning:hover, a.badge-warning:focus {
  color: #3a3c41;
  background-color: #cbab00;
}
a.badge-warning:focus, a.badge-warning.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(254, 214, 0, 0.5);
}
.badge-danger {
  color: white;
  background-color: #E12326;
}
a.badge-danger:hover, a.badge-danger:focus {
  color: white;
  background-color: #b8191c;
}
a.badge-danger:focus, a.badge-danger.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(225, 35, 38, 0.5);
}
.badge-light {
  color: #3a3c41;
  background-color: #f2f2f2;
}
a.badge-light:hover, a.badge-light:focus {
  color: #3a3c41;
  background-color: #d9d9d9;
}
a.badge-light:focus, a.badge-light.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(242, 242, 242, 0.5);
}
.badge-dark {
  color: white;
  background-color: #53555a;
}
a.badge-dark:hover, a.badge-dark:focus {
  color: white;
  background-color: #3b3c3f;
}
a.badge-dark:focus, a.badge-dark.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(83, 85, 90, 0.5);
}
.badge-border {
  color: #3a3c41;
  background-color: #d4d4d5;
}
a.badge-border:hover, a.badge-border:focus {
  color: #3a3c41;
  background-color: #bababc;
}
a.badge-border:focus, a.badge-border.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(212, 212, 213, 0.5);
}
.badge-headings {
  color: #3a3c41;
  background-color: #cb8671;
}
a.badge-headings:hover, a.badge-headings:focus {
  color: #3a3c41;
  background-color: #bd664c;
}
a.badge-headings:focus, a.badge-headings.focus {
  outline: 0;
  box-shadow: 0 0 0 0.2rem rgba(203, 134, 113, 0.5);
}
.jumbotron {
  padding: 2rem 1rem;
  margin-bottom: 2rem;
  background-color: #e3e4e4;
  border-radius: 0.3rem;
}
@media (min-width: 576px) {
  .jumbotron {
    padding: 4rem 2rem;
  }
}
.jumbotron-fluid {
  padding-right: 0;
  padding-left: 0;
  border-radius: 0;
}
.alert {
  position: relative;
  padding: 0.75rem 1.25rem;
  margin-bottom: 1rem;
  border: 1px solid transparent;
  border-radius: 0.25rem;
}
.alert-heading {
  color: inherit;
}
.alert-link {
  font-weight: 700;
}
.alert-dismissible {
  padding-right: 4rem;
}
.alert-dismissible .close {
  position: absolute;
  top: 0;
  right: 0;
  z-index: 2;
  padding: 0.75rem 1.25rem;
  color: inherit;
}
.alert-primary {
  color: #852427;
  background-color: #f9d3d4;
  border-color: #f7c1c2;
}
.alert-primary hr {
  border-top-color: #f4aaac;
}
.alert-primary .alert-link {
  color: #5d191b;
}
.alert-secondary {
  color: #3b3e42;
  background-color: #ddddde;
  border-color: #cfcfd1;
}
.alert-secondary hr {
  border-top-color: #c2c2c5;
}
.alert-secondary .alert-link {
  color: #232527;
}
.alert-success {
  color: #476831;
  background-color: #e1edd7;
  border-color: #d5e6c8;
}
.alert-success hr {
  border-top-color: #c8deb6;
}
.alert-success .alert-link {
  color: #2f4521;
}
.alert-info {
  color: #1c6673;
  background-color: #d1ecf1;
  border-color: #bee5eb;
}
.alert-info hr {
  border-top-color: #abdde5;
}
.alert-info .alert-link {
  color: #12424a;
}
.alert-warning {
  color: #948114;
  background-color: #fff7cc;
  border-color: #fff4b8;
}
.alert-warning hr {
  border-top-color: #fff09f;
}
.alert-warning .alert-link {
  color: #675a0e;
}
.alert-danger {
  color: #852427;
  background-color: #f9d3d4;
  border-color: #f7c1c2;
}
.alert-danger hr {
  border-top-color: #f4aaac;
}
.alert-danger .alert-link {
  color: #5d191b;
}
.alert-light {
  color: #8e9092;
  background-color: #fcfcfc;
  border-color: #fbfbfb;
}
.alert-light hr {
  border-top-color: #eeeeee;
}
.alert-light .alert-link {
  color: #747779;
}
.alert-dark {
  color: #3b3e42;
  background-color: #ddddde;
  border-color: #cfcfd1;
}
.alert-dark hr {
  border-top-color: #c2c2c5;
}
.alert-dark .alert-link {
  color: #232527;
}
.alert-border {
  color: #7e8082;
  background-color: #f6f6f7;
  border-color: #f3f3f3;
}
.alert-border hr {
  border-top-color: #e6e6e6;
}
.alert-border .alert-link {
  color: #656768;
}
.alert-headings {
  color: #79574e;
  background-color: #f5e7e3;
  border-color: #f0ddd7;
}
.alert-headings hr {
  border-top-color: #e9cdc4;
}
.alert-headings .alert-link {
  color: #5a413a;
}
@keyframes progress-bar-stripes {
  from {
    background-position: 1rem 0;
  }
  to {
    background-position: 0 0;
  }
}
.progress {
  display: flex;
  height: 1rem;
  overflow: hidden;
  line-height: 0;
  font-size: 0.75rem;
  background-color: #e3e4e4;
  border-radius: 0.25rem;
}
.progress-bar {
  display: flex;
  flex-direction: column;
  justify-content: center;
  overflow: hidden;
  color: white;
  text-align: center;
  white-space: nowrap;
  background-color: #E12326;
  transition: width 0.6s ease;
}
@media (prefers-reduced-motion: reduce) {
  .progress-bar {
    transition: none;
  }
}
.progress-bar-striped {
  background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
  background-size: 1rem 1rem;
}
.progress-bar-animated {
  animation: 1s linear infinite progress-bar-stripes;
}
@media (prefers-reduced-motion: reduce) {
  .progress-bar-animated {
    animation: none;
  }
}
.media {
  display: flex;
  align-items: flex-start;
}
.media-body {
  flex: 1;
}
.list-group {
  display: flex;
  flex-direction: column;
  padding-left: 0;
  margin-bottom: 0;
  border-radius: 0.25rem;
}
.list-group-item-action {
  width: 100%;
  color: #7c7d80;
  text-align: inherit;
}
.list-group-item-action:hover, .list-group-item-action:focus {
  z-index: 1;
  color: #7c7d80;
  text-decoration: none;
  background-color: #f2f2f2;
}
.list-group-item-action:active {
  color: #3a3c41;
  background-color: #e3e4e4;
}
.list-group-item {
  position: relative;
  display: block;
  padding: 0.75rem 1.25rem;
  background-color: white;
  border: 1px solid rgba(33, 37, 41, 0.125);
}
.list-group-item:first-child {
  border-top-left-radius: inherit;
  border-top-right-radius: inherit;
}
.list-group-item:last-child {
  border-bottom-right-radius: inherit;
  border-bottom-left-radius: inherit;
}
.list-group-item.disabled, .list-group-item:disabled {
  color: #98999b;
  pointer-events: none;
  background-color: white;
}
.list-group-item.active {
  z-index: 2;
  color: white;
  background-color: #53555a;
  border-color: #53555a;
}
.list-group-item + .list-group-item {
  border-top-width: 0;
}
.list-group-item + .list-group-item.active {
  margin-top: -1px;
  border-top-width: 1px;
}
.list-group-horizontal {
  flex-direction: row;
}
.list-group-horizontal > .list-group-item:first-child {
  border-bottom-left-radius: 0.25rem;
  border-top-right-radius: 0;
}
.list-group-horizontal > .list-group-item:last-child {
  border-top-right-radius: 0.25rem;
  border-bottom-left-radius: 0;
}
.list-group-horizontal > .list-group-item.active {
  margin-top: 0;
}
.list-group-horizontal > .list-group-item + .list-group-item {
  border-top-width: 1px;
  border-left-width: 0;
}
.list-group-horizontal > .list-group-item + .list-group-item.active {
  margin-left: -1px;
  border-left-width: 1px;
}
@media (min-width: 576px) {
  .list-group-horizontal-sm {
    flex-direction: row;
  }
  .list-group-horizontal-sm > .list-group-item:first-child {
    border-bottom-left-radius: 0.25rem;
    border-top-right-radius: 0;
  }
  .list-group-horizontal-sm > .list-group-item:last-child {
    border-top-right-radius: 0.25rem;
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-sm > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-sm > .list-group-item + .list-group-item {
    border-top-width: 1px;
    border-left-width: 0;
  }
  .list-group-horizontal-sm > .list-group-item + .list-group-item.active {
    margin-left: -1px;
    border-left-width: 1px;
  }
}
@media (min-width: 768px) {
  .list-group-horizontal-md {
    flex-direction: row;
  }
  .list-group-horizontal-md > .list-group-item:first-child {
    border-bottom-left-radius: 0.25rem;
    border-top-right-radius: 0;
  }
  .list-group-horizontal-md > .list-group-item:last-child {
    border-top-right-radius: 0.25rem;
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-md > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-md > .list-group-item + .list-group-item {
    border-top-width: 1px;
    border-left-width: 0;
  }
  .list-group-horizontal-md > .list-group-item + .list-group-item.active {
    margin-left: -1px;
    border-left-width: 1px;
  }
}
@media (min-width: 992px) {
  .list-group-horizontal-lg {
    flex-direction: row;
  }
  .list-group-horizontal-lg > .list-group-item:first-child {
    border-bottom-left-radius: 0.25rem;
    border-top-right-radius: 0;
  }
  .list-group-horizontal-lg > .list-group-item:last-child {
    border-top-right-radius: 0.25rem;
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-lg > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-lg > .list-group-item + .list-group-item {
    border-top-width: 1px;
    border-left-width: 0;
  }
  .list-group-horizontal-lg > .list-group-item + .list-group-item.active {
    margin-left: -1px;
    border-left-width: 1px;
  }
}
@media (min-width: 1200px) {
  .list-group-horizontal-xl {
    flex-direction: row;
  }
  .list-group-horizontal-xl > .list-group-item:first-child {
    border-bottom-left-radius: 0.25rem;
    border-top-right-radius: 0;
  }
  .list-group-horizontal-xl > .list-group-item:last-child {
    border-top-right-radius: 0.25rem;
    border-bottom-left-radius: 0;
  }
  .list-group-horizontal-xl > .list-group-item.active {
    margin-top: 0;
  }
  .list-group-horizontal-xl > .list-group-item + .list-group-item {
    border-top-width: 1px;
    border-left-width: 0;
  }
  .list-group-horizontal-xl > .list-group-item + .list-group-item.active {
    margin-left: -1px;
    border-left-width: 1px;
  }
}
.list-group-flush {
  border-radius: 0;
}
.list-group-flush > .list-group-item {
  border-width: 0 0 1px;
}
.list-group-flush > .list-group-item:last-child {
  border-bottom-width: 0;
}
.list-group-item-primary {
  color: #852427;
  background-color: #f7c1c2;
}
.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus {
  color: #852427;
  background-color: #f4aaac;
}
.list-group-item-primary.list-group-item-action.active {
  color: white;
  background-color: #852427;
  border-color: #852427;
}
.list-group-item-secondary {
  color: #3b3e42;
  background-color: #cfcfd1;
}
.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus {
  color: #3b3e42;
  background-color: #c2c2c5;
}
.list-group-item-secondary.list-group-item-action.active {
  color: white;
  background-color: #3b3e42;
  border-color: #3b3e42;
}
.list-group-item-success {
  color: #476831;
  background-color: #d5e6c8;
}
.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus {
  color: #476831;
  background-color: #c8deb6;
}
.list-group-item-success.list-group-item-action.active {
  color: white;
  background-color: #476831;
  border-color: #476831;
}
.list-group-item-info {
  color: #1c6673;
  background-color: #bee5eb;
}
.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus {
  color: #1c6673;
  background-color: #abdde5;
}
.list-group-item-info.list-group-item-action.active {
  color: white;
  background-color: #1c6673;
  border-color: #1c6673;
}
.list-group-item-warning {
  color: #948114;
  background-color: #fff4b8;
}
.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus {
  color: #948114;
  background-color: #fff09f;
}
.list-group-item-warning.list-group-item-action.active {
  color: white;
  background-color: #948114;
  border-color: #948114;
}
.list-group-item-danger {
  color: #852427;
  background-color: #f7c1c2;
}
.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus {
  color: #852427;
  background-color: #f4aaac;
}
.list-group-item-danger.list-group-item-action.active {
  color: white;
  background-color: #852427;
  border-color: #852427;
}
.list-group-item-light {
  color: #8e9092;
  background-color: #fbfbfb;
}
.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus {
  color: #8e9092;
  background-color: #eeeeee;
}
.list-group-item-light.list-group-item-action.active {
  color: white;
  background-color: #8e9092;
  border-color: #8e9092;
}
.list-group-item-dark {
  color: #3b3e42;
  background-color: #cfcfd1;
}
.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus {
  color: #3b3e42;
  background-color: #c2c2c5;
}
.list-group-item-dark.list-group-item-action.active {
  color: white;
  background-color: #3b3e42;
  border-color: #3b3e42;
}
.list-group-item-border {
  color: #7e8082;
  background-color: #f3f3f3;
}
.list-group-item-border.list-group-item-action:hover, .list-group-item-border.list-group-item-action:focus {
  color: #7e8082;
  background-color: #e6e6e6;
}
.list-group-item-border.list-group-item-action.active {
  color: white;
  background-color: #7e8082;
  border-color: #7e8082;
}
.list-group-item-headings {
  color: #79574e;
  background-color: #f0ddd7;
}
.list-group-item-headings.list-group-item-action:hover, .list-group-item-headings.list-group-item-action:focus {
  color: #79574e;
  background-color: #e9cdc4;
}
.list-group-item-headings.list-group-item-action.active {
  color: white;
  background-color: #79574e;
  border-color: #79574e;
}
.close {
  float: right;
  font-size: 1.5rem;
  font-weight: 700;
  line-height: 1;
  color: #212529;
  text-shadow: 0 1px 0 white;
  opacity: 0.5;
}
.close:hover {
  color: #212529;
  text-decoration: none;
}
.close:not(:disabled):not(.disabled):hover, .close:not(:disabled):not(.disabled):focus {
  opacity: 0.75;
}
button.close {
  padding: 0;
  background-color: transparent;
  border: 0;
}
a.close.disabled {
  pointer-events: none;
}
.toast {
  flex-basis: 350px;
  max-width: 350px;
  font-size: 0.875rem;
  background-color: rgba(255, 255, 255, 0.85);
  background-clip: padding-box;
  border: 1px solid rgba(0, 0, 0, 0.1);
  box-shadow: 0 0.25rem 0.75rem rgba(33, 37, 41, 0.1);
  opacity: 0;
  border-radius: 0.25rem;
}
.toast:not(:last-child) {
  margin-bottom: 0.75rem;
}
.toast.showing {
  opacity: 1;
}
.toast.show {
  display: block;
  opacity: 1;
}
.toast.hide {
  display: none;
}
.toast-header {
  display: flex;
  align-items: center;
  padding: 0.25rem 0.75rem;
  color: #98999b;
  background-color: rgba(255, 255, 255, 0.85);
  background-clip: padding-box;
  border-bottom: 1px solid rgba(0, 0, 0, 0.05);
  border-top-left-radius: calc(0.25rem - 1px);
  border-top-right-radius: calc(0.25rem - 1px);
}
.toast-body {
  padding: 0.75rem;
}
.modal-open {
  overflow: hidden;
}
.modal-open .modal {
  overflow-x: hidden;
  overflow-y: auto;
}
.modal {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1059;
  display: none;
  width: 100%;
  height: 100%;
  overflow: hidden;
  outline: 0;
}
.modal-dialog {
  position: relative;
  width: auto;
  margin: 0.5rem;
  pointer-events: none;
}
.modal.fade .modal-dialog {
  transition: transform 0.3s ease-out;
  transform: translate(0, -50px);
}
@media (prefers-reduced-motion: reduce) {
  .modal.fade .modal-dialog {
    transition: none;
  }
}
.modal.show .modal-dialog {
  transform: none;
}
.modal.modal-static .modal-dialog {
  transform: scale(1.02);
}
.modal-dialog-scrollable {
  display: flex;
  max-height: calc(100% - 1rem);
}
.modal-dialog-scrollable .modal-content {
  max-height: calc(100vh - 1rem);
  overflow: hidden;
}
.modal-dialog-scrollable .modal-header,
.modal-dialog-scrollable .modal-footer {
  flex-shrink: 0;
}
.modal-dialog-scrollable .modal-body {
  overflow-y: auto;
}
.modal-dialog-centered {
  display: flex;
  align-items: center;
  min-height: calc(100% - 1rem);
}
.modal-dialog-centered::before {
  display: block;
  height: calc(100vh - 1rem);
  height: min-content;
  content: "";
}
.modal-dialog-centered.modal-dialog-scrollable {
  flex-direction: column;
  justify-content: center;
  height: 100%;
}
.modal-dialog-centered.modal-dialog-scrollable .modal-content {
  max-height: none;
}
.modal-dialog-centered.modal-dialog-scrollable::before {
  content: none;
}
.modal-content {
  position: relative;
  display: flex;
  flex-direction: column;
  width: 100%;
  pointer-events: auto;
  background-color: white;
  background-clip: padding-box;
  border: 1px solid rgba(33, 37, 41, 0.2);
  border-radius: 0.3rem;
  outline: 0;
}
.modal-backdrop {
  position: fixed;
  top: 0;
  left: 0;
  z-index: 1040;
  width: 100vw;
  height: 100vh;
  background-color: #212529;
}
.modal-backdrop.fade {
  opacity: 0;
}
.modal-backdrop.show {
  opacity: 0.5;
}
.modal-header {
  display: flex;
  align-items: flex-start;
  justify-content: space-between;
  padding: 1rem 1rem;
  border-bottom: 1px solid #d4d4d5;
  border-top-left-radius: calc(0.3rem - 1px);
  border-top-right-radius: calc(0.3rem - 1px);
}
.modal-header .close {
  padding: 1rem 1rem;
  margin: -1rem -1rem -1rem auto;
}
.modal-title {
  margin-bottom: 0;
  line-height: 1.5;
}
.modal-body {
  position: relative;
  flex: 1 1 auto;
  padding: 1rem;
}
.modal-footer {
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: flex-end;
  padding: 0.75rem;
  border-top: 1px solid #d4d4d5;
  border-bottom-right-radius: calc(0.3rem - 1px);
  border-bottom-left-radius: calc(0.3rem - 1px);
}
.modal-footer > * {
  margin: 0.25rem;
}
.modal-scrollbar-measure {
  position: absolute;
  top: -9999px;
  width: 50px;
  height: 50px;
  overflow: scroll;
}
@media (min-width: 576px) {
  .modal-dialog {
    max-width: fit-content;
    margin: 5rem auto;
  }
  .modal-dialog-scrollable {
    max-height: calc(100% - 10rem);
  }
  .modal-dialog-scrollable .modal-content {
    max-height: calc(100vh - 10rem);
  }
  .modal-dialog-centered {
    min-height: calc(100% - 10rem);
  }
  .modal-dialog-centered::before {
    height: calc(100vh - 10rem);
    height: min-content;
  }
  .modal-sm {
    max-width: 300px;
  }
}
@media (min-width: 992px) {
  .modal-lg,
  .modal-xl {
    max-width: 800px;
  }
}
@media (min-width: 1200px) {
  .modal-xl {
    max-width: 1140px;
  }
}
.tooltip {
  position: absolute;
  z-index: 1070;
  display: block;
  margin: 0;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  white-space: normal;
  word-spacing: normal;
  line-break: auto;
  font-size: 0.875rem;
  word-wrap: break-word;
  opacity: 0;
}
.tooltip.show {
  opacity: 0.9;
}
.tooltip .arrow {
  position: absolute;
  display: block;
  width: 0.8rem;
  height: 0.4rem;
}
.tooltip .arrow::before {
  position: absolute;
  content: "";
  border-color: transparent;
  border-style: solid;
}
.bs-tooltip-top, .bs-tooltip-auto[x-placement^=top] {
  padding: 0.4rem 0;
}
.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^=top] .arrow {
  bottom: 0;
}
.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^=top] .arrow::before {
  top: 0;
  border-width: 0.4rem 0.4rem 0;
  border-top-color: #212529;
}
.bs-tooltip-right, .bs-tooltip-auto[x-placement^=right] {
  padding: 0 0.4rem;
}
.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^=right] .arrow {
  left: 0;
  width: 0.4rem;
  height: 0.8rem;
}
.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^=right] .arrow::before {
  right: 0;
  border-width: 0.4rem 0.4rem 0.4rem 0;
  border-right-color: #212529;
}
.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^=bottom] {
  padding: 0.4rem 0;
}
.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^=bottom] .arrow {
  top: 0;
}
.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^=bottom] .arrow::before {
  bottom: 0;
  border-width: 0 0.4rem 0.4rem;
  border-bottom-color: #212529;
}
.bs-tooltip-left, .bs-tooltip-auto[x-placement^=left] {
  padding: 0 0.4rem;
}
.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^=left] .arrow {
  right: 0;
  width: 0.4rem;
  height: 0.8rem;
}
.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^=left] .arrow::before {
  left: 0;
  border-width: 0.4rem 0 0.4rem 0.4rem;
  border-left-color: #212529;
}
.tooltip-inner {
  max-width: 200px;
  padding: 0.25rem 0.5rem;
  color: white;
  text-align: center;
  background-color: #212529;
  border-radius: 0.25rem;
}
.popover {
  position: absolute;
  top: 0;
  left: 0;
  z-index: 1060;
  display: block;
  max-width: 276px;
  font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
  font-style: normal;
  font-weight: 400;
  line-height: 1.5;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  letter-spacing: normal;
  word-break: normal;
  white-space: normal;
  word-spacing: normal;
  line-break: auto;
  font-size: 0.875rem;
  word-wrap: break-word;
  background-color: white;
  background-clip: padding-box;
  border: 1px solid rgba(33, 37, 41, 0.2);
  border-radius: 0.3rem;
}
.popover .arrow {
  position: absolute;
  display: block;
  width: 1rem;
  height: 0.5rem;
  margin: 0 0.3rem;
}
.popover .arrow::before, .popover .arrow::after {
  position: absolute;
  display: block;
  content: "";
  border-color: transparent;
  border-style: solid;
}
.bs-popover-top, .bs-popover-auto[x-placement^=top] {
  margin-bottom: 0.5rem;
}
.bs-popover-top > .arrow, .bs-popover-auto[x-placement^=top] > .arrow {
  bottom: calc(-0.5rem - 1px);
}
.bs-popover-top > .arrow::before, .bs-popover-auto[x-placement^=top] > .arrow::before {
  bottom: 0;
  border-width: 0.5rem 0.5rem 0;
  border-top-color: rgba(33, 37, 41, 0.25);
}
.bs-popover-top > .arrow::after, .bs-popover-auto[x-placement^=top] > .arrow::after {
  bottom: 1px;
  border-width: 0.5rem 0.5rem 0;
  border-top-color: white;
}
.bs-popover-right, .bs-popover-auto[x-placement^=right] {
  margin-left: 0.5rem;
}
.bs-popover-right > .arrow, .bs-popover-auto[x-placement^=right] > .arrow {
  left: calc(-0.5rem - 1px);
  width: 0.5rem;
  height: 1rem;
  margin: 0.3rem 0;
}
.bs-popover-right > .arrow::before, .bs-popover-auto[x-placement^=right] > .arrow::before {
  left: 0;
  border-width: 0.5rem 0.5rem 0.5rem 0;
  border-right-color: rgba(33, 37, 41, 0.25);
}
.bs-popover-right > .arrow::after, .bs-popover-auto[x-placement^=right] > .arrow::after {
  left: 1px;
  border-width: 0.5rem 0.5rem 0.5rem 0;
  border-right-color: white;
}
.bs-popover-bottom, .bs-popover-auto[x-placement^=bottom] {
  margin-top: 0.5rem;
}
.bs-popover-bottom > .arrow, .bs-popover-auto[x-placement^=bottom] > .arrow {
  top: calc(-0.5rem - 1px);
}
.bs-popover-bottom > .arrow::before, .bs-popover-auto[x-placement^=bottom] > .arrow::before {
  top: 0;
  border-width: 0 0.5rem 0.5rem 0.5rem;
  border-bottom-color: rgba(33, 37, 41, 0.25);
}
.bs-popover-bottom > .arrow::after, .bs-popover-auto[x-placement^=bottom] > .arrow::after {
  top: 1px;
  border-width: 0 0.5rem 0.5rem 0.5rem;
  border-bottom-color: white;
}
.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^=bottom] .popover-header::before {
  position: absolute;
  top: 0;
  left: 50%;
  display: block;
  width: 1rem;
  margin-left: -0.5rem;
  content: "";
  border-bottom: 1px solid #f7f7f7;
}
.bs-popover-left, .bs-popover-auto[x-placement^=left] {
  margin-right: 0.5rem;
}
.bs-popover-left > .arrow, .bs-popover-auto[x-placement^=left] > .arrow {
  right: calc(-0.5rem - 1px);
  width: 0.5rem;
  height: 1rem;
  margin: 0.3rem 0;
}
.bs-popover-left > .arrow::before, .bs-popover-auto[x-placement^=left] > .arrow::before {
  right: 0;
  border-width: 0.5rem 0 0.5rem 0.5rem;
  border-left-color: rgba(33, 37, 41, 0.25);
}
.bs-popover-left > .arrow::after, .bs-popover-auto[x-placement^=left] > .arrow::after {
  right: 1px;
  border-width: 0.5rem 0 0.5rem 0.5rem;
  border-left-color: white;
}
.popover-header {
  padding: 0.5rem 0.75rem;
  margin-bottom: 0;
  font-size: 1rem;
  background-color: #f7f7f7;
  border-bottom: 1px solid #ebebeb;
  border-top-left-radius: calc(0.3rem - 1px);
  border-top-right-radius: calc(0.3rem - 1px);
}
.popover-header:empty {
  display: none;
}
.popover-body {
  padding: 0.5rem 0.75rem;
  color: #3a3c41;
}
.carousel {
  position: relative;
}
.carousel.pointer-event {
  touch-action: pan-y;
}
.carousel-inner {
  position: relative;
  width: 100%;
  overflow: hidden;
}
.carousel-inner::after {
  display: block;
  clear: both;
  content: "";
}
.carousel-item {
  position: relative;
  display: none;
  float: left;
  width: 100%;
  margin-right: -100%;
  backface-visibility: hidden;
  transition: transform 0.6s ease-in-out;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-item {
    transition: none;
  }
}
.carousel-item.active,
.carousel-item-next,
.carousel-item-prev {
  display: block;
}
.carousel-item-next:not(.carousel-item-left),
.active.carousel-item-right {
  transform: translateX(100%);
}
.carousel-item-prev:not(.carousel-item-right),
.active.carousel-item-left {
  transform: translateX(-100%);
}
.carousel-fade .carousel-item {
  opacity: 0;
  transition-property: opacity;
  transform: none;
}
.carousel-fade .carousel-item.active,
.carousel-fade .carousel-item-next.carousel-item-left,
.carousel-fade .carousel-item-prev.carousel-item-right {
  z-index: 1;
  opacity: 1;
}
.carousel-fade .active.carousel-item-left,
.carousel-fade .active.carousel-item-right {
  z-index: 0;
  opacity: 0;
  transition: opacity 0s 0.6s;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-fade .active.carousel-item-left,
  .carousel-fade .active.carousel-item-right {
    transition: none;
  }
}
.carousel-control-prev,
.carousel-control-next {
  position: absolute;
  top: 0;
  bottom: 0;
  z-index: 1;
  display: flex;
  align-items: center;
  justify-content: center;
  width: 15%;
  padding: 0;
  color: white;
  text-align: center;
  background: none;
  border: 0;
  opacity: 0.5;
  transition: opacity 0.15s ease;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-control-prev,
  .carousel-control-next {
    transition: none;
  }
}
.carousel-control-prev:hover, .carousel-control-prev:focus,
.carousel-control-next:hover,
.carousel-control-next:focus {
  color: white;
  text-decoration: none;
  outline: 0;
  opacity: 0.9;
}
.carousel-control-prev {
  left: 0;
}
.carousel-control-next {
  right: 0;
}
.carousel-control-prev-icon,
.carousel-control-next-icon {
  display: inline-block;
  width: 20px;
  height: 20px;
  background: 50%/100% 100% no-repeat;
}
.carousel-control-prev-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='white' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5L4.25 4l2.5-2.5L5.25 0z'/%3e%3c/svg%3e");
}
.carousel-control-next-icon {
  background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='white' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5L3.75 4l-2.5 2.5L2.75 8l4-4-4-4z'/%3e%3c/svg%3e");
}
.carousel-indicators {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 15;
  display: flex;
  justify-content: center;
  padding-left: 0;
  margin-right: 15%;
  margin-left: 15%;
  list-style: none;
}
.carousel-indicators li {
  box-sizing: content-box;
  flex: 0 1 auto;
  width: 30px;
  height: 3px;
  margin-right: 3px;
  margin-left: 3px;
  text-indent: -999px;
  cursor: pointer;
  background-color: white;
  background-clip: padding-box;
  border-top: 10px solid transparent;
  border-bottom: 10px solid transparent;
  opacity: 0.5;
  transition: opacity 0.6s ease;
}
@media (prefers-reduced-motion: reduce) {
  .carousel-indicators li {
    transition: none;
  }
}
.carousel-indicators .active {
  opacity: 1;
}
.carousel-caption {
  position: absolute;
  right: 15%;
  bottom: 20px;
  left: 15%;
  z-index: 10;
  padding-top: 20px;
  padding-bottom: 20px;
  color: white;
  text-align: center;
}
@keyframes spinner-border {
  to {
    transform: rotate(360deg);
  }
}
.spinner-border {
  display: inline-block;
  width: 2rem;
  height: 2rem;
  vertical-align: -0.125em;
  border: 0.25em solid currentcolor;
  border-right-color: transparent;
  border-radius: 50%;
  animation: 0.75s linear infinite spinner-border;
}
.spinner-border-sm {
  width: 1rem;
  height: 1rem;
  border-width: 0.2em;
}
@keyframes spinner-grow {
  0% {
    transform: scale(0);
  }
  50% {
    opacity: 1;
    transform: none;
  }
}
.spinner-grow {
  display: inline-block;
  width: 2rem;
  height: 2rem;
  vertical-align: -0.125em;
  background-color: currentcolor;
  border-radius: 50%;
  opacity: 0;
  animation: 0.75s linear infinite spinner-grow;
}
.spinner-grow-sm {
  width: 1rem;
  height: 1rem;
}
@media (prefers-reduced-motion: reduce) {
  .spinner-border,
  .spinner-grow {
    animation-duration: 1.5s;
  }
}
.align-baseline {
  vertical-align: baseline !important;
}
.align-top {
  vertical-align: top !important;
}
.align-middle {
  vertical-align: middle !important;
}
.align-bottom {
  vertical-align: bottom !important;
}
.align-text-bottom {
  vertical-align: text-bottom !important;
}
.align-text-top {
  vertical-align: text-top !important;
}
.bg-primary {
  background-color: #E12326 !important;
}
a.bg-primary:hover, a.bg-primary:focus,
button.bg-primary:hover,
button.bg-primary:focus {
  background-color: #b8191c !important;
}
.bg-secondary {
  background-color: #53555a !important;
}
a.bg-secondary:hover, a.bg-secondary:focus,
button.bg-secondary:hover,
button.bg-secondary:focus {
  background-color: #3b3c3f !important;
}
.bg-success {
  background-color: #6aa539 !important;
}
a.bg-success:hover, a.bg-success:focus,
button.bg-success:hover,
button.bg-success:focus {
  background-color: #527f2c !important;
}
.bg-info {
  background-color: #17a2b8 !important;
}
a.bg-info:hover, a.bg-info:focus,
button.bg-info:hover,
button.bg-info:focus {
  background-color: #117a8b !important;
}
.bg-warning {
  background-color: #fed600 !important;
}
a.bg-warning:hover, a.bg-warning:focus,
button.bg-warning:hover,
button.bg-warning:focus {
  background-color: #cbab00 !important;
}
.bg-danger {
  background-color: #E12326 !important;
}
a.bg-danger:hover, a.bg-danger:focus,
button.bg-danger:hover,
button.bg-danger:focus {
  background-color: #b8191c !important;
}
.bg-light {
  background-color: #f2f2f2 !important;
}
a.bg-light:hover, a.bg-light:focus,
button.bg-light:hover,
button.bg-light:focus {
  background-color: #d9d9d9 !important;
}
.bg-dark {
  background-color: #53555a !important;
}
a.bg-dark:hover, a.bg-dark:focus,
button.bg-dark:hover,
button.bg-dark:focus {
  background-color: #3b3c3f !important;
}
.bg-border {
  background-color: #d4d4d5 !important;
}
a.bg-border:hover, a.bg-border:focus,
button.bg-border:hover,
button.bg-border:focus {
  background-color: #bababc !important;
}
.bg-headings {
  background-color: #cb8671 !important;
}
a.bg-headings:hover, a.bg-headings:focus,
button.bg-headings:hover,
button.bg-headings:focus {
  background-color: #bd664c !important;
}
.bg-white {
  background-color: white !important;
}
.bg-transparent {
  background-color: transparent !important;
}
.border {
  border: 1px solid #d4d4d5 !important;
}
.border-top {
  border-top: 1px solid #d4d4d5 !important;
}
.border-right {
  border-right: 1px solid #d4d4d5 !important;
}
.border-bottom {
  border-bottom: 1px solid #d4d4d5 !important;
}
.border-left {
  border-left: 1px solid #d4d4d5 !important;
}
.border-0 {
  border: 0 !important;
}
.border-top-0 {
  border-top: 0 !important;
}
.border-right-0 {
  border-right: 0 !important;
}
.border-bottom-0 {
  border-bottom: 0 !important;
}
.border-left-0 {
  border-left: 0 !important;
}
.border-primary {
  border-color: #E12326 !important;
}
.border-secondary {
  border-color: #53555a !important;
}
.border-success {
  border-color: #6aa539 !important;
}
.border-info {
  border-color: #17a2b8 !important;
}
.border-warning {
  border-color: #fed600 !important;
}
.border-danger {
  border-color: #E12326 !important;
}
.border-light {
  border-color: #f2f2f2 !important;
}
.border-dark {
  border-color: #53555a !important;
}
.border-border {
  border-color: #d4d4d5 !important;
}
.border-headings {
  border-color: #cb8671 !important;
}
.border-white {
  border-color: white !important;
}
.rounded-sm {
  border-radius: 0.2rem !important;
}
.rounded {
  border-radius: 0.25rem !important;
}
.rounded-top {
  border-top-left-radius: 0.25rem !important;
  border-top-right-radius: 0.25rem !important;
}
.rounded-right {
  border-top-right-radius: 0.25rem !important;
  border-bottom-right-radius: 0.25rem !important;
}
.rounded-bottom {
  border-bottom-right-radius: 0.25rem !important;
  border-bottom-left-radius: 0.25rem !important;
}
.rounded-left {
  border-top-left-radius: 0.25rem !important;
  border-bottom-left-radius: 0.25rem !important;
}
.rounded-lg {
  border-radius: 0.3rem !important;
}
.rounded-circle {
  border-radius: 50% !important;
}
.rounded-pill {
  border-radius: 50rem !important;
}
.rounded-0 {
  border-radius: 0 !important;
}
.clearfix::after {
  display: block;
  clear: both;
  content: "";
}
.d-none {
  display: none !important;
}
.d-inline {
  display: inline !important;
}
.d-inline-block {
  display: inline-block !important;
}
.d-block {
  display: block !important;
}
.d-table {
  display: table !important;
}
.d-table-row {
  display: table-row !important;
}
.d-table-cell {
  display: table-cell !important;
}
.d-flex {
  display: flex !important;
}
.d-inline-flex {
  display: inline-flex !important;
}
@media (min-width: 576px) {
  .d-sm-none {
    display: none !important;
  }
  .d-sm-inline {
    display: inline !important;
  }
  .d-sm-inline-block {
    display: inline-block !important;
  }
  .d-sm-block {
    display: block !important;
  }
  .d-sm-table {
    display: table !important;
  }
  .d-sm-table-row {
    display: table-row !important;
  }
  .d-sm-table-cell {
    display: table-cell !important;
  }
  .d-sm-flex {
    display: flex !important;
  }
  .d-sm-inline-flex {
    display: inline-flex !important;
  }
}
@media (min-width: 768px) {
  .d-md-none {
    display: none !important;
  }
  .d-md-inline {
    display: inline !important;
  }
  .d-md-inline-block {
    display: inline-block !important;
  }
  .d-md-block {
    display: block !important;
  }
  .d-md-table {
    display: table !important;
  }
  .d-md-table-row {
    display: table-row !important;
  }
  .d-md-table-cell {
    display: table-cell !important;
  }
  .d-md-flex {
    display: flex !important;
  }
  .d-md-inline-flex {
    display: inline-flex !important;
  }
}
@media (min-width: 992px) {
  .d-lg-none {
    display: none !important;
  }
  .d-lg-inline {
    display: inline !important;
  }
  .d-lg-inline-block {
    display: inline-block !important;
  }
  .d-lg-block {
    display: block !important;
  }
  .d-lg-table {
    display: table !important;
  }
  .d-lg-table-row {
    display: table-row !important;
  }
  .d-lg-table-cell {
    display: table-cell !important;
  }
  .d-lg-flex {
    display: flex !important;
  }
  .d-lg-inline-flex {
    display: inline-flex !important;
  }
}
@media (min-width: 1200px) {
  .d-xl-none {
    display: none !important;
  }
  .d-xl-inline {
    display: inline !important;
  }
  .d-xl-inline-block {
    display: inline-block !important;
  }
  .d-xl-block {
    display: block !important;
  }
  .d-xl-table {
    display: table !important;
  }
  .d-xl-table-row {
    display: table-row !important;
  }
  .d-xl-table-cell {
    display: table-cell !important;
  }
  .d-xl-flex {
    display: flex !important;
  }
  .d-xl-inline-flex {
    display: inline-flex !important;
  }
}
@media print {
  .d-print-none {
    display: none !important;
  }
  .d-print-inline {
    display: inline !important;
  }
  .d-print-inline-block {
    display: inline-block !important;
  }
  .d-print-block {
    display: block !important;
  }
  .d-print-table {
    display: table !important;
  }
  .d-print-table-row {
    display: table-row !important;
  }
  .d-print-table-cell {
    display: table-cell !important;
  }
  .d-print-flex {
    display: flex !important;
  }
  .d-print-inline-flex {
    display: inline-flex !important;
  }
}
.embed-responsive {
  position: relative;
  display: block;
  width: 100%;
  padding: 0;
  overflow: hidden;
}
.embed-responsive::before {
  display: block;
  content: "";
}
.embed-responsive .embed-responsive-item,
.embed-responsive iframe,
.embed-responsive embed,
.embed-responsive object,
.embed-responsive video {
  position: absolute;
  top: 0;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  border: 0;
}
.embed-responsive-21by9::before {
  padding-top: 42.85714286%;
}
.embed-responsive-16by9::before {
  padding-top: 56.25%;
}
.embed-responsive-4by3::before {
  padding-top: 75%;
}
.embed-responsive-1by1::before {
  padding-top: 100%;
}
.flex-row {
  flex-direction: row !important;
}
.flex-column {
  flex-direction: column !important;
}
.flex-row-reverse {
  flex-direction: row-reverse !important;
}
.flex-column-reverse {
  flex-direction: column-reverse !important;
}
.flex-wrap {
  flex-wrap: wrap !important;
}
.flex-nowrap {
  flex-wrap: nowrap !important;
}
.flex-wrap-reverse {
  flex-wrap: wrap-reverse !important;
}
.flex-fill {
  flex: 1 1 auto !important;
}
.flex-grow-0 {
  flex-grow: 0 !important;
}
.flex-grow-1 {
  flex-grow: 1 !important;
}
.flex-shrink-0 {
  flex-shrink: 0 !important;
}
.flex-shrink-1 {
  flex-shrink: 1 !important;
}
.justify-content-start {
  justify-content: flex-start !important;
}
.justify-content-end {
  justify-content: flex-end !important;
}
.justify-content-center {
  justify-content: center !important;
}
.justify-content-between {
  justify-content: space-between !important;
}
.justify-content-around {
  justify-content: space-around !important;
}
.align-items-start {
  align-items: flex-start !important;
}
.align-items-end {
  align-items: flex-end !important;
}
.align-items-center {
  align-items: center !important;
}
.align-items-baseline {
  align-items: baseline !important;
}
.align-items-stretch {
  align-items: stretch !important;
}
.align-content-start {
  align-content: flex-start !important;
}
.align-content-end {
  align-content: flex-end !important;
}
.align-content-center {
  align-content: center !important;
}
.align-content-between {
  align-content: space-between !important;
}
.align-content-around {
  align-content: space-around !important;
}
.align-content-stretch {
  align-content: stretch !important;
}
.align-self-auto {
  align-self: auto !important;
}
.align-self-start {
  align-self: flex-start !important;
}
.align-self-end {
  align-self: flex-end !important;
}
.align-self-center {
  align-self: center !important;
}
.align-self-baseline {
  align-self: baseline !important;
}
.align-self-stretch {
  align-self: stretch !important;
}
@media (min-width: 576px) {
  .flex-sm-row {
    flex-direction: row !important;
  }
  .flex-sm-column {
    flex-direction: column !important;
  }
  .flex-sm-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-sm-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-sm-wrap {
    flex-wrap: wrap !important;
  }
  .flex-sm-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-sm-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .flex-sm-fill {
    flex: 1 1 auto !important;
  }
  .flex-sm-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-sm-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-sm-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-sm-shrink-1 {
    flex-shrink: 1 !important;
  }
  .justify-content-sm-start {
    justify-content: flex-start !important;
  }
  .justify-content-sm-end {
    justify-content: flex-end !important;
  }
  .justify-content-sm-center {
    justify-content: center !important;
  }
  .justify-content-sm-between {
    justify-content: space-between !important;
  }
  .justify-content-sm-around {
    justify-content: space-around !important;
  }
  .align-items-sm-start {
    align-items: flex-start !important;
  }
  .align-items-sm-end {
    align-items: flex-end !important;
  }
  .align-items-sm-center {
    align-items: center !important;
  }
  .align-items-sm-baseline {
    align-items: baseline !important;
  }
  .align-items-sm-stretch {
    align-items: stretch !important;
  }
  .align-content-sm-start {
    align-content: flex-start !important;
  }
  .align-content-sm-end {
    align-content: flex-end !important;
  }
  .align-content-sm-center {
    align-content: center !important;
  }
  .align-content-sm-between {
    align-content: space-between !important;
  }
  .align-content-sm-around {
    align-content: space-around !important;
  }
  .align-content-sm-stretch {
    align-content: stretch !important;
  }
  .align-self-sm-auto {
    align-self: auto !important;
  }
  .align-self-sm-start {
    align-self: flex-start !important;
  }
  .align-self-sm-end {
    align-self: flex-end !important;
  }
  .align-self-sm-center {
    align-self: center !important;
  }
  .align-self-sm-baseline {
    align-self: baseline !important;
  }
  .align-self-sm-stretch {
    align-self: stretch !important;
  }
}
@media (min-width: 768px) {
  .flex-md-row {
    flex-direction: row !important;
  }
  .flex-md-column {
    flex-direction: column !important;
  }
  .flex-md-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-md-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-md-wrap {
    flex-wrap: wrap !important;
  }
  .flex-md-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-md-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .flex-md-fill {
    flex: 1 1 auto !important;
  }
  .flex-md-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-md-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-md-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-md-shrink-1 {
    flex-shrink: 1 !important;
  }
  .justify-content-md-start {
    justify-content: flex-start !important;
  }
  .justify-content-md-end {
    justify-content: flex-end !important;
  }
  .justify-content-md-center {
    justify-content: center !important;
  }
  .justify-content-md-between {
    justify-content: space-between !important;
  }
  .justify-content-md-around {
    justify-content: space-around !important;
  }
  .align-items-md-start {
    align-items: flex-start !important;
  }
  .align-items-md-end {
    align-items: flex-end !important;
  }
  .align-items-md-center {
    align-items: center !important;
  }
  .align-items-md-baseline {
    align-items: baseline !important;
  }
  .align-items-md-stretch {
    align-items: stretch !important;
  }
  .align-content-md-start {
    align-content: flex-start !important;
  }
  .align-content-md-end {
    align-content: flex-end !important;
  }
  .align-content-md-center {
    align-content: center !important;
  }
  .align-content-md-between {
    align-content: space-between !important;
  }
  .align-content-md-around {
    align-content: space-around !important;
  }
  .align-content-md-stretch {
    align-content: stretch !important;
  }
  .align-self-md-auto {
    align-self: auto !important;
  }
  .align-self-md-start {
    align-self: flex-start !important;
  }
  .align-self-md-end {
    align-self: flex-end !important;
  }
  .align-self-md-center {
    align-self: center !important;
  }
  .align-self-md-baseline {
    align-self: baseline !important;
  }
  .align-self-md-stretch {
    align-self: stretch !important;
  }
}
@media (min-width: 992px) {
  .flex-lg-row {
    flex-direction: row !important;
  }
  .flex-lg-column {
    flex-direction: column !important;
  }
  .flex-lg-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-lg-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-lg-wrap {
    flex-wrap: wrap !important;
  }
  .flex-lg-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-lg-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .flex-lg-fill {
    flex: 1 1 auto !important;
  }
  .flex-lg-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-lg-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-lg-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-lg-shrink-1 {
    flex-shrink: 1 !important;
  }
  .justify-content-lg-start {
    justify-content: flex-start !important;
  }
  .justify-content-lg-end {
    justify-content: flex-end !important;
  }
  .justify-content-lg-center {
    justify-content: center !important;
  }
  .justify-content-lg-between {
    justify-content: space-between !important;
  }
  .justify-content-lg-around {
    justify-content: space-around !important;
  }
  .align-items-lg-start {
    align-items: flex-start !important;
  }
  .align-items-lg-end {
    align-items: flex-end !important;
  }
  .align-items-lg-center {
    align-items: center !important;
  }
  .align-items-lg-baseline {
    align-items: baseline !important;
  }
  .align-items-lg-stretch {
    align-items: stretch !important;
  }
  .align-content-lg-start {
    align-content: flex-start !important;
  }
  .align-content-lg-end {
    align-content: flex-end !important;
  }
  .align-content-lg-center {
    align-content: center !important;
  }
  .align-content-lg-between {
    align-content: space-between !important;
  }
  .align-content-lg-around {
    align-content: space-around !important;
  }
  .align-content-lg-stretch {
    align-content: stretch !important;
  }
  .align-self-lg-auto {
    align-self: auto !important;
  }
  .align-self-lg-start {
    align-self: flex-start !important;
  }
  .align-self-lg-end {
    align-self: flex-end !important;
  }
  .align-self-lg-center {
    align-self: center !important;
  }
  .align-self-lg-baseline {
    align-self: baseline !important;
  }
  .align-self-lg-stretch {
    align-self: stretch !important;
  }
}
@media (min-width: 1200px) {
  .flex-xl-row {
    flex-direction: row !important;
  }
  .flex-xl-column {
    flex-direction: column !important;
  }
  .flex-xl-row-reverse {
    flex-direction: row-reverse !important;
  }
  .flex-xl-column-reverse {
    flex-direction: column-reverse !important;
  }
  .flex-xl-wrap {
    flex-wrap: wrap !important;
  }
  .flex-xl-nowrap {
    flex-wrap: nowrap !important;
  }
  .flex-xl-wrap-reverse {
    flex-wrap: wrap-reverse !important;
  }
  .flex-xl-fill {
    flex: 1 1 auto !important;
  }
  .flex-xl-grow-0 {
    flex-grow: 0 !important;
  }
  .flex-xl-grow-1 {
    flex-grow: 1 !important;
  }
  .flex-xl-shrink-0 {
    flex-shrink: 0 !important;
  }
  .flex-xl-shrink-1 {
    flex-shrink: 1 !important;
  }
  .justify-content-xl-start {
    justify-content: flex-start !important;
  }
  .justify-content-xl-end {
    justify-content: flex-end !important;
  }
  .justify-content-xl-center {
    justify-content: center !important;
  }
  .justify-content-xl-between {
    justify-content: space-between !important;
  }
  .justify-content-xl-around {
    justify-content: space-around !important;
  }
  .align-items-xl-start {
    align-items: flex-start !important;
  }
  .align-items-xl-end {
    align-items: flex-end !important;
  }
  .align-items-xl-center {
    align-items: center !important;
  }
  .align-items-xl-baseline {
    align-items: baseline !important;
  }
  .align-items-xl-stretch {
    align-items: stretch !important;
  }
  .align-content-xl-start {
    align-content: flex-start !important;
  }
  .align-content-xl-end {
    align-content: flex-end !important;
  }
  .align-content-xl-center {
    align-content: center !important;
  }
  .align-content-xl-between {
    align-content: space-between !important;
  }
  .align-content-xl-around {
    align-content: space-around !important;
  }
  .align-content-xl-stretch {
    align-content: stretch !important;
  }
  .align-self-xl-auto {
    align-self: auto !important;
  }
  .align-self-xl-start {
    align-self: flex-start !important;
  }
  .align-self-xl-end {
    align-self: flex-end !important;
  }
  .align-self-xl-center {
    align-self: center !important;
  }
  .align-self-xl-baseline {
    align-self: baseline !important;
  }
  .align-self-xl-stretch {
    align-self: stretch !important;
  }
}
.float-left {
  float: left !important;
}
.float-right {
  float: right !important;
}
.float-none {
  float: none !important;
}
@media (min-width: 576px) {
  .float-sm-left {
    float: left !important;
  }
  .float-sm-right {
    float: right !important;
  }
  .float-sm-none {
    float: none !important;
  }
}
@media (min-width: 768px) {
  .float-md-left {
    float: left !important;
  }
  .float-md-right {
    float: right !important;
  }
  .float-md-none {
    float: none !important;
  }
}
@media (min-width: 992px) {
  .float-lg-left {
    float: left !important;
  }
  .float-lg-right {
    float: right !important;
  }
  .float-lg-none {
    float: none !important;
  }
}
@media (min-width: 1200px) {
  .float-xl-left {
    float: left !important;
  }
  .float-xl-right {
    float: right !important;
  }
  .float-xl-none {
    float: none !important;
  }
}
.user-select-all {
  user-select: all !important;
}
.user-select-auto {
  user-select: auto !important;
}
.user-select-none {
  user-select: none !important;
}
.overflow-auto {
  overflow: auto !important;
}
.overflow-hidden {
  overflow: hidden !important;
}
.position-static {
  position: static !important;
}
.position-relative {
  position: relative !important;
}
.position-absolute {
  position: absolute !important;
}
.position-fixed {
  position: fixed !important;
}
.position-sticky {
  position: sticky !important;
}
.fixed-top {
  position: fixed;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1030;
}
.fixed-bottom {
  position: fixed;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1030;
}
@supports (position: sticky) {
  .sticky-top {
    position: sticky;
    top: 0;
    z-index: 1020;
  }
}
.sr-only {
  position: absolute;
  width: 1px;
  height: 1px;
  padding: 0;
  margin: -1px;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  white-space: nowrap;
  border: 0;
}
.sr-only-focusable:active, .sr-only-focusable:focus {
  position: static;
  width: auto;
  height: auto;
  overflow: visible;
  clip: auto;
  white-space: normal;
}
.shadow-sm {
  box-shadow: 0 0.125rem 0.25rem rgba(33, 37, 41, 0.075) !important;
}
.shadow {
  box-shadow: 0 0.5rem 1rem rgba(33, 37, 41, 0.15) !important;
}
.shadow-lg {
  box-shadow: 0 1rem 3rem rgba(33, 37, 41, 0.175) !important;
}
.shadow-none {
  box-shadow: none !important;
}
.w-25 {
  width: 25% !important;
}
.w-50 {
  width: 50% !important;
}
.w-75 {
  width: 75% !important;
}
.w-100 {
  width: 100% !important;
}
.w-auto {
  width: auto !important;
}
.h-25 {
  height: 25% !important;
}
.h-50 {
  height: 50% !important;
}
.h-75 {
  height: 75% !important;
}
.h-100 {
  height: 100% !important;
}
.h-auto {
  height: auto !important;
}
.mw-100 {
  max-width: 100% !important;
}
.mh-100 {
  max-height: 100% !important;
}
.min-vw-100 {
  min-width: 100vw !important;
}
.min-vh-100 {
  min-height: 100vh !important;
}
.vw-100 {
  width: 100vw !important;
}
.vh-100 {
  height: 100vh !important;
}
.m-0 {
  margin: 0 !important;
}
.mt-0,
.my-0 {
  margin-top: 0 !important;
}
.mr-0,
.mx-0 {
  margin-right: 0 !important;
}
.mb-0,
.my-0 {
  margin-bottom: 0 !important;
}
.ml-0,
.mx-0 {
  margin-left: 0 !important;
}
.m-1 {
  margin: 0.25rem !important;
}
.mt-1,
.my-1 {
  margin-top: 0.25rem !important;
}
.mr-1,
.mx-1 {
  margin-right: 0.25rem !important;
}
.mb-1,
.my-1 {
  margin-bottom: 0.25rem !important;
}
.ml-1,
.mx-1 {
  margin-left: 0.25rem !important;
}
.m-2 {
  margin: 0.5rem !important;
}
.mt-2,
.my-2 {
  margin-top: 0.5rem !important;
}
.mr-2,
.mx-2 {
  margin-right: 0.5rem !important;
}
.mb-2,
.my-2 {
  margin-bottom: 0.5rem !important;
}
.ml-2,
.mx-2 {
  margin-left: 0.5rem !important;
}
.m-3 {
  margin: 1rem !important;
}
.mt-3,
.my-3 {
  margin-top: 1rem !important;
}
.mr-3,
.mx-3 {
  margin-right: 1rem !important;
}
.mb-3,
.my-3 {
  margin-bottom: 1rem !important;
}
.ml-3,
.mx-3 {
  margin-left: 1rem !important;
}
.m-4 {
  margin: 1.5rem !important;
}
.mt-4,
.my-4 {
  margin-top: 1.5rem !important;
}
.mr-4,
.mx-4 {
  margin-right: 1.5rem !important;
}
.mb-4,
.my-4 {
  margin-bottom: 1.5rem !important;
}
.ml-4,
.mx-4 {
  margin-left: 1.5rem !important;
}
.m-5 {
  margin: 3rem !important;
}
.mt-5,
.my-5 {
  margin-top: 3rem !important;
}
.mr-5,
.mx-5 {
  margin-right: 3rem !important;
}
.mb-5,
.my-5 {
  margin-bottom: 3rem !important;
}
.ml-5,
.mx-5 {
  margin-left: 3rem !important;
}
.p-0 {
  padding: 0 !important;
}
.pt-0,
.py-0 {
  padding-top: 0 !important;
}
.pr-0,
.px-0 {
  padding-right: 0 !important;
}
.pb-0,
.py-0 {
  padding-bottom: 0 !important;
}
.pl-0,
.px-0 {
  padding-left: 0 !important;
}
.p-1 {
  padding: 0.25rem !important;
}
.pt-1,
.py-1 {
  padding-top: 0.25rem !important;
}
.pr-1,
.px-1 {
  padding-right: 0.25rem !important;
}
.pb-1,
.py-1 {
  padding-bottom: 0.25rem !important;
}
.pl-1,
.px-1 {
  padding-left: 0.25rem !important;
}
.p-2 {
  padding: 0.5rem !important;
}
.pt-2,
.py-2 {
  padding-top: 0.5rem !important;
}
.pr-2,
.px-2 {
  padding-right: 0.5rem !important;
}
.pb-2,
.py-2 {
  padding-bottom: 0.5rem !important;
}
.pl-2,
.px-2 {
  padding-left: 0.5rem !important;
}
.p-3 {
  padding: 1rem !important;
}
.pt-3,
.py-3 {
  padding-top: 1rem !important;
}
.pr-3,
.px-3 {
  padding-right: 1rem !important;
}
.pb-3,
.py-3 {
  padding-bottom: 1rem !important;
}
.pl-3,
.px-3 {
  padding-left: 1rem !important;
}
.p-4 {
  padding: 1.5rem !important;
}
.pt-4,
.py-4 {
  padding-top: 1.5rem !important;
}
.pr-4,
.px-4 {
  padding-right: 1.5rem !important;
}
.pb-4,
.py-4 {
  padding-bottom: 1.5rem !important;
}
.pl-4,
.px-4 {
  padding-left: 1.5rem !important;
}
.p-5 {
  padding: 3rem !important;
}
.pt-5,
.py-5 {
  padding-top: 3rem !important;
}
.pr-5,
.px-5 {
  padding-right: 3rem !important;
}
.pb-5,
.py-5 {
  padding-bottom: 3rem !important;
}
.pl-5,
.px-5 {
  padding-left: 3rem !important;
}
.m-n1 {
  margin: -0.25rem !important;
}
.mt-n1,
.my-n1 {
  margin-top: -0.25rem !important;
}
.mr-n1,
.mx-n1 {
  margin-right: -0.25rem !important;
}
.mb-n1,
.my-n1 {
  margin-bottom: -0.25rem !important;
}
.ml-n1,
.mx-n1 {
  margin-left: -0.25rem !important;
}
.m-n2 {
  margin: -0.5rem !important;
}
.mt-n2,
.my-n2 {
  margin-top: -0.5rem !important;
}
.mr-n2,
.mx-n2 {
  margin-right: -0.5rem !important;
}
.mb-n2,
.my-n2 {
  margin-bottom: -0.5rem !important;
}
.ml-n2,
.mx-n2 {
  margin-left: -0.5rem !important;
}
.m-n3 {
  margin: -1rem !important;
}
.mt-n3,
.my-n3 {
  margin-top: -1rem !important;
}
.mr-n3,
.mx-n3 {
  margin-right: -1rem !important;
}
.mb-n3,
.my-n3 {
  margin-bottom: -1rem !important;
}
.ml-n3,
.mx-n3 {
  margin-left: -1rem !important;
}
.m-n4 {
  margin: -1.5rem !important;
}
.mt-n4,
.my-n4 {
  margin-top: -1.5rem !important;
}
.mr-n4,
.mx-n4 {
  margin-right: -1.5rem !important;
}
.mb-n4,
.my-n4 {
  margin-bottom: -1.5rem !important;
}
.ml-n4,
.mx-n4 {
  margin-left: -1.5rem !important;
}
.m-n5 {
  margin: -3rem !important;
}
.mt-n5,
.my-n5 {
  margin-top: -3rem !important;
}
.mr-n5,
.mx-n5 {
  margin-right: -3rem !important;
}
.mb-n5,
.my-n5 {
  margin-bottom: -3rem !important;
}
.ml-n5,
.mx-n5 {
  margin-left: -3rem !important;
}
.m-auto {
  margin: auto !important;
}
.mt-auto,
.my-auto {
  margin-top: auto !important;
}
.mr-auto,
.mx-auto {
  margin-right: auto !important;
}
.mb-auto,
.my-auto {
  margin-bottom: auto !important;
}
.ml-auto,
.mx-auto {
  margin-left: auto !important;
}
@media (min-width: 576px) {
  .m-sm-0 {
    margin: 0 !important;
  }
  .mt-sm-0,
  .my-sm-0 {
    margin-top: 0 !important;
  }
  .mr-sm-0,
  .mx-sm-0 {
    margin-right: 0 !important;
  }
  .mb-sm-0,
  .my-sm-0 {
    margin-bottom: 0 !important;
  }
  .ml-sm-0,
  .mx-sm-0 {
    margin-left: 0 !important;
  }
  .m-sm-1 {
    margin: 0.25rem !important;
  }
  .mt-sm-1,
  .my-sm-1 {
    margin-top: 0.25rem !important;
  }
  .mr-sm-1,
  .mx-sm-1 {
    margin-right: 0.25rem !important;
  }
  .mb-sm-1,
  .my-sm-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-sm-1,
  .mx-sm-1 {
    margin-left: 0.25rem !important;
  }
  .m-sm-2 {
    margin: 0.5rem !important;
  }
  .mt-sm-2,
  .my-sm-2 {
    margin-top: 0.5rem !important;
  }
  .mr-sm-2,
  .mx-sm-2 {
    margin-right: 0.5rem !important;
  }
  .mb-sm-2,
  .my-sm-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-sm-2,
  .mx-sm-2 {
    margin-left: 0.5rem !important;
  }
  .m-sm-3 {
    margin: 1rem !important;
  }
  .mt-sm-3,
  .my-sm-3 {
    margin-top: 1rem !important;
  }
  .mr-sm-3,
  .mx-sm-3 {
    margin-right: 1rem !important;
  }
  .mb-sm-3,
  .my-sm-3 {
    margin-bottom: 1rem !important;
  }
  .ml-sm-3,
  .mx-sm-3 {
    margin-left: 1rem !important;
  }
  .m-sm-4 {
    margin: 1.5rem !important;
  }
  .mt-sm-4,
  .my-sm-4 {
    margin-top: 1.5rem !important;
  }
  .mr-sm-4,
  .mx-sm-4 {
    margin-right: 1.5rem !important;
  }
  .mb-sm-4,
  .my-sm-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-sm-4,
  .mx-sm-4 {
    margin-left: 1.5rem !important;
  }
  .m-sm-5 {
    margin: 3rem !important;
  }
  .mt-sm-5,
  .my-sm-5 {
    margin-top: 3rem !important;
  }
  .mr-sm-5,
  .mx-sm-5 {
    margin-right: 3rem !important;
  }
  .mb-sm-5,
  .my-sm-5 {
    margin-bottom: 3rem !important;
  }
  .ml-sm-5,
  .mx-sm-5 {
    margin-left: 3rem !important;
  }
  .p-sm-0 {
    padding: 0 !important;
  }
  .pt-sm-0,
  .py-sm-0 {
    padding-top: 0 !important;
  }
  .pr-sm-0,
  .px-sm-0 {
    padding-right: 0 !important;
  }
  .pb-sm-0,
  .py-sm-0 {
    padding-bottom: 0 !important;
  }
  .pl-sm-0,
  .px-sm-0 {
    padding-left: 0 !important;
  }
  .p-sm-1 {
    padding: 0.25rem !important;
  }
  .pt-sm-1,
  .py-sm-1 {
    padding-top: 0.25rem !important;
  }
  .pr-sm-1,
  .px-sm-1 {
    padding-right: 0.25rem !important;
  }
  .pb-sm-1,
  .py-sm-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-sm-1,
  .px-sm-1 {
    padding-left: 0.25rem !important;
  }
  .p-sm-2 {
    padding: 0.5rem !important;
  }
  .pt-sm-2,
  .py-sm-2 {
    padding-top: 0.5rem !important;
  }
  .pr-sm-2,
  .px-sm-2 {
    padding-right: 0.5rem !important;
  }
  .pb-sm-2,
  .py-sm-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-sm-2,
  .px-sm-2 {
    padding-left: 0.5rem !important;
  }
  .p-sm-3 {
    padding: 1rem !important;
  }
  .pt-sm-3,
  .py-sm-3 {
    padding-top: 1rem !important;
  }
  .pr-sm-3,
  .px-sm-3 {
    padding-right: 1rem !important;
  }
  .pb-sm-3,
  .py-sm-3 {
    padding-bottom: 1rem !important;
  }
  .pl-sm-3,
  .px-sm-3 {
    padding-left: 1rem !important;
  }
  .p-sm-4 {
    padding: 1.5rem !important;
  }
  .pt-sm-4,
  .py-sm-4 {
    padding-top: 1.5rem !important;
  }
  .pr-sm-4,
  .px-sm-4 {
    padding-right: 1.5rem !important;
  }
  .pb-sm-4,
  .py-sm-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-sm-4,
  .px-sm-4 {
    padding-left: 1.5rem !important;
  }
  .p-sm-5 {
    padding: 3rem !important;
  }
  .pt-sm-5,
  .py-sm-5 {
    padding-top: 3rem !important;
  }
  .pr-sm-5,
  .px-sm-5 {
    padding-right: 3rem !important;
  }
  .pb-sm-5,
  .py-sm-5 {
    padding-bottom: 3rem !important;
  }
  .pl-sm-5,
  .px-sm-5 {
    padding-left: 3rem !important;
  }
  .m-sm-n1 {
    margin: -0.25rem !important;
  }
  .mt-sm-n1,
  .my-sm-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-sm-n1,
  .mx-sm-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-sm-n1,
  .my-sm-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-sm-n1,
  .mx-sm-n1 {
    margin-left: -0.25rem !important;
  }
  .m-sm-n2 {
    margin: -0.5rem !important;
  }
  .mt-sm-n2,
  .my-sm-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-sm-n2,
  .mx-sm-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-sm-n2,
  .my-sm-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-sm-n2,
  .mx-sm-n2 {
    margin-left: -0.5rem !important;
  }
  .m-sm-n3 {
    margin: -1rem !important;
  }
  .mt-sm-n3,
  .my-sm-n3 {
    margin-top: -1rem !important;
  }
  .mr-sm-n3,
  .mx-sm-n3 {
    margin-right: -1rem !important;
  }
  .mb-sm-n3,
  .my-sm-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-sm-n3,
  .mx-sm-n3 {
    margin-left: -1rem !important;
  }
  .m-sm-n4 {
    margin: -1.5rem !important;
  }
  .mt-sm-n4,
  .my-sm-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-sm-n4,
  .mx-sm-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-sm-n4,
  .my-sm-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-sm-n4,
  .mx-sm-n4 {
    margin-left: -1.5rem !important;
  }
  .m-sm-n5 {
    margin: -3rem !important;
  }
  .mt-sm-n5,
  .my-sm-n5 {
    margin-top: -3rem !important;
  }
  .mr-sm-n5,
  .mx-sm-n5 {
    margin-right: -3rem !important;
  }
  .mb-sm-n5,
  .my-sm-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-sm-n5,
  .mx-sm-n5 {
    margin-left: -3rem !important;
  }
  .m-sm-auto {
    margin: auto !important;
  }
  .mt-sm-auto,
  .my-sm-auto {
    margin-top: auto !important;
  }
  .mr-sm-auto,
  .mx-sm-auto {
    margin-right: auto !important;
  }
  .mb-sm-auto,
  .my-sm-auto {
    margin-bottom: auto !important;
  }
  .ml-sm-auto,
  .mx-sm-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 768px) {
  .m-md-0 {
    margin: 0 !important;
  }
  .mt-md-0,
  .my-md-0 {
    margin-top: 0 !important;
  }
  .mr-md-0,
  .mx-md-0 {
    margin-right: 0 !important;
  }
  .mb-md-0,
  .my-md-0 {
    margin-bottom: 0 !important;
  }
  .ml-md-0,
  .mx-md-0 {
    margin-left: 0 !important;
  }
  .m-md-1 {
    margin: 0.25rem !important;
  }
  .mt-md-1,
  .my-md-1 {
    margin-top: 0.25rem !important;
  }
  .mr-md-1,
  .mx-md-1 {
    margin-right: 0.25rem !important;
  }
  .mb-md-1,
  .my-md-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-md-1,
  .mx-md-1 {
    margin-left: 0.25rem !important;
  }
  .m-md-2 {
    margin: 0.5rem !important;
  }
  .mt-md-2,
  .my-md-2 {
    margin-top: 0.5rem !important;
  }
  .mr-md-2,
  .mx-md-2 {
    margin-right: 0.5rem !important;
  }
  .mb-md-2,
  .my-md-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-md-2,
  .mx-md-2 {
    margin-left: 0.5rem !important;
  }
  .m-md-3 {
    margin: 1rem !important;
  }
  .mt-md-3,
  .my-md-3 {
    margin-top: 1rem !important;
  }
  .mr-md-3,
  .mx-md-3 {
    margin-right: 1rem !important;
  }
  .mb-md-3,
  .my-md-3 {
    margin-bottom: 1rem !important;
  }
  .ml-md-3,
  .mx-md-3 {
    margin-left: 1rem !important;
  }
  .m-md-4 {
    margin: 1.5rem !important;
  }
  .mt-md-4,
  .my-md-4 {
    margin-top: 1.5rem !important;
  }
  .mr-md-4,
  .mx-md-4 {
    margin-right: 1.5rem !important;
  }
  .mb-md-4,
  .my-md-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-md-4,
  .mx-md-4 {
    margin-left: 1.5rem !important;
  }
  .m-md-5 {
    margin: 3rem !important;
  }
  .mt-md-5,
  .my-md-5 {
    margin-top: 3rem !important;
  }
  .mr-md-5,
  .mx-md-5 {
    margin-right: 3rem !important;
  }
  .mb-md-5,
  .my-md-5 {
    margin-bottom: 3rem !important;
  }
  .ml-md-5,
  .mx-md-5 {
    margin-left: 3rem !important;
  }
  .p-md-0 {
    padding: 0 !important;
  }
  .pt-md-0,
  .py-md-0 {
    padding-top: 0 !important;
  }
  .pr-md-0,
  .px-md-0 {
    padding-right: 0 !important;
  }
  .pb-md-0,
  .py-md-0 {
    padding-bottom: 0 !important;
  }
  .pl-md-0,
  .px-md-0 {
    padding-left: 0 !important;
  }
  .p-md-1 {
    padding: 0.25rem !important;
  }
  .pt-md-1,
  .py-md-1 {
    padding-top: 0.25rem !important;
  }
  .pr-md-1,
  .px-md-1 {
    padding-right: 0.25rem !important;
  }
  .pb-md-1,
  .py-md-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-md-1,
  .px-md-1 {
    padding-left: 0.25rem !important;
  }
  .p-md-2 {
    padding: 0.5rem !important;
  }
  .pt-md-2,
  .py-md-2 {
    padding-top: 0.5rem !important;
  }
  .pr-md-2,
  .px-md-2 {
    padding-right: 0.5rem !important;
  }
  .pb-md-2,
  .py-md-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-md-2,
  .px-md-2 {
    padding-left: 0.5rem !important;
  }
  .p-md-3 {
    padding: 1rem !important;
  }
  .pt-md-3,
  .py-md-3 {
    padding-top: 1rem !important;
  }
  .pr-md-3,
  .px-md-3 {
    padding-right: 1rem !important;
  }
  .pb-md-3,
  .py-md-3 {
    padding-bottom: 1rem !important;
  }
  .pl-md-3,
  .px-md-3 {
    padding-left: 1rem !important;
  }
  .p-md-4 {
    padding: 1.5rem !important;
  }
  .pt-md-4,
  .py-md-4 {
    padding-top: 1.5rem !important;
  }
  .pr-md-4,
  .px-md-4 {
    padding-right: 1.5rem !important;
  }
  .pb-md-4,
  .py-md-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-md-4,
  .px-md-4 {
    padding-left: 1.5rem !important;
  }
  .p-md-5 {
    padding: 3rem !important;
  }
  .pt-md-5,
  .py-md-5 {
    padding-top: 3rem !important;
  }
  .pr-md-5,
  .px-md-5 {
    padding-right: 3rem !important;
  }
  .pb-md-5,
  .py-md-5 {
    padding-bottom: 3rem !important;
  }
  .pl-md-5,
  .px-md-5 {
    padding-left: 3rem !important;
  }
  .m-md-n1 {
    margin: -0.25rem !important;
  }
  .mt-md-n1,
  .my-md-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-md-n1,
  .mx-md-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-md-n1,
  .my-md-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-md-n1,
  .mx-md-n1 {
    margin-left: -0.25rem !important;
  }
  .m-md-n2 {
    margin: -0.5rem !important;
  }
  .mt-md-n2,
  .my-md-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-md-n2,
  .mx-md-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-md-n2,
  .my-md-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-md-n2,
  .mx-md-n2 {
    margin-left: -0.5rem !important;
  }
  .m-md-n3 {
    margin: -1rem !important;
  }
  .mt-md-n3,
  .my-md-n3 {
    margin-top: -1rem !important;
  }
  .mr-md-n3,
  .mx-md-n3 {
    margin-right: -1rem !important;
  }
  .mb-md-n3,
  .my-md-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-md-n3,
  .mx-md-n3 {
    margin-left: -1rem !important;
  }
  .m-md-n4 {
    margin: -1.5rem !important;
  }
  .mt-md-n4,
  .my-md-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-md-n4,
  .mx-md-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-md-n4,
  .my-md-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-md-n4,
  .mx-md-n4 {
    margin-left: -1.5rem !important;
  }
  .m-md-n5 {
    margin: -3rem !important;
  }
  .mt-md-n5,
  .my-md-n5 {
    margin-top: -3rem !important;
  }
  .mr-md-n5,
  .mx-md-n5 {
    margin-right: -3rem !important;
  }
  .mb-md-n5,
  .my-md-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-md-n5,
  .mx-md-n5 {
    margin-left: -3rem !important;
  }
  .m-md-auto {
    margin: auto !important;
  }
  .mt-md-auto,
  .my-md-auto {
    margin-top: auto !important;
  }
  .mr-md-auto,
  .mx-md-auto {
    margin-right: auto !important;
  }
  .mb-md-auto,
  .my-md-auto {
    margin-bottom: auto !important;
  }
  .ml-md-auto,
  .mx-md-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 992px) {
  .m-lg-0 {
    margin: 0 !important;
  }
  .mt-lg-0,
  .my-lg-0 {
    margin-top: 0 !important;
  }
  .mr-lg-0,
  .mx-lg-0 {
    margin-right: 0 !important;
  }
  .mb-lg-0,
  .my-lg-0 {
    margin-bottom: 0 !important;
  }
  .ml-lg-0,
  .mx-lg-0 {
    margin-left: 0 !important;
  }
  .m-lg-1 {
    margin: 0.25rem !important;
  }
  .mt-lg-1,
  .my-lg-1 {
    margin-top: 0.25rem !important;
  }
  .mr-lg-1,
  .mx-lg-1 {
    margin-right: 0.25rem !important;
  }
  .mb-lg-1,
  .my-lg-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-lg-1,
  .mx-lg-1 {
    margin-left: 0.25rem !important;
  }
  .m-lg-2 {
    margin: 0.5rem !important;
  }
  .mt-lg-2,
  .my-lg-2 {
    margin-top: 0.5rem !important;
  }
  .mr-lg-2,
  .mx-lg-2 {
    margin-right: 0.5rem !important;
  }
  .mb-lg-2,
  .my-lg-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-lg-2,
  .mx-lg-2 {
    margin-left: 0.5rem !important;
  }
  .m-lg-3 {
    margin: 1rem !important;
  }
  .mt-lg-3,
  .my-lg-3 {
    margin-top: 1rem !important;
  }
  .mr-lg-3,
  .mx-lg-3 {
    margin-right: 1rem !important;
  }
  .mb-lg-3,
  .my-lg-3 {
    margin-bottom: 1rem !important;
  }
  .ml-lg-3,
  .mx-lg-3 {
    margin-left: 1rem !important;
  }
  .m-lg-4 {
    margin: 1.5rem !important;
  }
  .mt-lg-4,
  .my-lg-4 {
    margin-top: 1.5rem !important;
  }
  .mr-lg-4,
  .mx-lg-4 {
    margin-right: 1.5rem !important;
  }
  .mb-lg-4,
  .my-lg-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-lg-4,
  .mx-lg-4 {
    margin-left: 1.5rem !important;
  }
  .m-lg-5 {
    margin: 3rem !important;
  }
  .mt-lg-5,
  .my-lg-5 {
    margin-top: 3rem !important;
  }
  .mr-lg-5,
  .mx-lg-5 {
    margin-right: 3rem !important;
  }
  .mb-lg-5,
  .my-lg-5 {
    margin-bottom: 3rem !important;
  }
  .ml-lg-5,
  .mx-lg-5 {
    margin-left: 3rem !important;
  }
  .p-lg-0 {
    padding: 0 !important;
  }
  .pt-lg-0,
  .py-lg-0 {
    padding-top: 0 !important;
  }
  .pr-lg-0,
  .px-lg-0 {
    padding-right: 0 !important;
  }
  .pb-lg-0,
  .py-lg-0 {
    padding-bottom: 0 !important;
  }
  .pl-lg-0,
  .px-lg-0 {
    padding-left: 0 !important;
  }
  .p-lg-1 {
    padding: 0.25rem !important;
  }
  .pt-lg-1,
  .py-lg-1 {
    padding-top: 0.25rem !important;
  }
  .pr-lg-1,
  .px-lg-1 {
    padding-right: 0.25rem !important;
  }
  .pb-lg-1,
  .py-lg-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-lg-1,
  .px-lg-1 {
    padding-left: 0.25rem !important;
  }
  .p-lg-2 {
    padding: 0.5rem !important;
  }
  .pt-lg-2,
  .py-lg-2 {
    padding-top: 0.5rem !important;
  }
  .pr-lg-2,
  .px-lg-2 {
    padding-right: 0.5rem !important;
  }
  .pb-lg-2,
  .py-lg-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-lg-2,
  .px-lg-2 {
    padding-left: 0.5rem !important;
  }
  .p-lg-3 {
    padding: 1rem !important;
  }
  .pt-lg-3,
  .py-lg-3 {
    padding-top: 1rem !important;
  }
  .pr-lg-3,
  .px-lg-3 {
    padding-right: 1rem !important;
  }
  .pb-lg-3,
  .py-lg-3 {
    padding-bottom: 1rem !important;
  }
  .pl-lg-3,
  .px-lg-3 {
    padding-left: 1rem !important;
  }
  .p-lg-4 {
    padding: 1.5rem !important;
  }
  .pt-lg-4,
  .py-lg-4 {
    padding-top: 1.5rem !important;
  }
  .pr-lg-4,
  .px-lg-4 {
    padding-right: 1.5rem !important;
  }
  .pb-lg-4,
  .py-lg-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-lg-4,
  .px-lg-4 {
    padding-left: 1.5rem !important;
  }
  .p-lg-5 {
    padding: 3rem !important;
  }
  .pt-lg-5,
  .py-lg-5 {
    padding-top: 3rem !important;
  }
  .pr-lg-5,
  .px-lg-5 {
    padding-right: 3rem !important;
  }
  .pb-lg-5,
  .py-lg-5 {
    padding-bottom: 3rem !important;
  }
  .pl-lg-5,
  .px-lg-5 {
    padding-left: 3rem !important;
  }
  .m-lg-n1 {
    margin: -0.25rem !important;
  }
  .mt-lg-n1,
  .my-lg-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-lg-n1,
  .mx-lg-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-lg-n1,
  .my-lg-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-lg-n1,
  .mx-lg-n1 {
    margin-left: -0.25rem !important;
  }
  .m-lg-n2 {
    margin: -0.5rem !important;
  }
  .mt-lg-n2,
  .my-lg-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-lg-n2,
  .mx-lg-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-lg-n2,
  .my-lg-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-lg-n2,
  .mx-lg-n2 {
    margin-left: -0.5rem !important;
  }
  .m-lg-n3 {
    margin: -1rem !important;
  }
  .mt-lg-n3,
  .my-lg-n3 {
    margin-top: -1rem !important;
  }
  .mr-lg-n3,
  .mx-lg-n3 {
    margin-right: -1rem !important;
  }
  .mb-lg-n3,
  .my-lg-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-lg-n3,
  .mx-lg-n3 {
    margin-left: -1rem !important;
  }
  .m-lg-n4 {
    margin: -1.5rem !important;
  }
  .mt-lg-n4,
  .my-lg-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-lg-n4,
  .mx-lg-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-lg-n4,
  .my-lg-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-lg-n4,
  .mx-lg-n4 {
    margin-left: -1.5rem !important;
  }
  .m-lg-n5 {
    margin: -3rem !important;
  }
  .mt-lg-n5,
  .my-lg-n5 {
    margin-top: -3rem !important;
  }
  .mr-lg-n5,
  .mx-lg-n5 {
    margin-right: -3rem !important;
  }
  .mb-lg-n5,
  .my-lg-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-lg-n5,
  .mx-lg-n5 {
    margin-left: -3rem !important;
  }
  .m-lg-auto {
    margin: auto !important;
  }
  .mt-lg-auto,
  .my-lg-auto {
    margin-top: auto !important;
  }
  .mr-lg-auto,
  .mx-lg-auto {
    margin-right: auto !important;
  }
  .mb-lg-auto,
  .my-lg-auto {
    margin-bottom: auto !important;
  }
  .ml-lg-auto,
  .mx-lg-auto {
    margin-left: auto !important;
  }
}
@media (min-width: 1200px) {
  .m-xl-0 {
    margin: 0 !important;
  }
  .mt-xl-0,
  .my-xl-0 {
    margin-top: 0 !important;
  }
  .mr-xl-0,
  .mx-xl-0 {
    margin-right: 0 !important;
  }
  .mb-xl-0,
  .my-xl-0 {
    margin-bottom: 0 !important;
  }
  .ml-xl-0,
  .mx-xl-0 {
    margin-left: 0 !important;
  }
  .m-xl-1 {
    margin: 0.25rem !important;
  }
  .mt-xl-1,
  .my-xl-1 {
    margin-top: 0.25rem !important;
  }
  .mr-xl-1,
  .mx-xl-1 {
    margin-right: 0.25rem !important;
  }
  .mb-xl-1,
  .my-xl-1 {
    margin-bottom: 0.25rem !important;
  }
  .ml-xl-1,
  .mx-xl-1 {
    margin-left: 0.25rem !important;
  }
  .m-xl-2 {
    margin: 0.5rem !important;
  }
  .mt-xl-2,
  .my-xl-2 {
    margin-top: 0.5rem !important;
  }
  .mr-xl-2,
  .mx-xl-2 {
    margin-right: 0.5rem !important;
  }
  .mb-xl-2,
  .my-xl-2 {
    margin-bottom: 0.5rem !important;
  }
  .ml-xl-2,
  .mx-xl-2 {
    margin-left: 0.5rem !important;
  }
  .m-xl-3 {
    margin: 1rem !important;
  }
  .mt-xl-3,
  .my-xl-3 {
    margin-top: 1rem !important;
  }
  .mr-xl-3,
  .mx-xl-3 {
    margin-right: 1rem !important;
  }
  .mb-xl-3,
  .my-xl-3 {
    margin-bottom: 1rem !important;
  }
  .ml-xl-3,
  .mx-xl-3 {
    margin-left: 1rem !important;
  }
  .m-xl-4 {
    margin: 1.5rem !important;
  }
  .mt-xl-4,
  .my-xl-4 {
    margin-top: 1.5rem !important;
  }
  .mr-xl-4,
  .mx-xl-4 {
    margin-right: 1.5rem !important;
  }
  .mb-xl-4,
  .my-xl-4 {
    margin-bottom: 1.5rem !important;
  }
  .ml-xl-4,
  .mx-xl-4 {
    margin-left: 1.5rem !important;
  }
  .m-xl-5 {
    margin: 3rem !important;
  }
  .mt-xl-5,
  .my-xl-5 {
    margin-top: 3rem !important;
  }
  .mr-xl-5,
  .mx-xl-5 {
    margin-right: 3rem !important;
  }
  .mb-xl-5,
  .my-xl-5 {
    margin-bottom: 3rem !important;
  }
  .ml-xl-5,
  .mx-xl-5 {
    margin-left: 3rem !important;
  }
  .p-xl-0 {
    padding: 0 !important;
  }
  .pt-xl-0,
  .py-xl-0 {
    padding-top: 0 !important;
  }
  .pr-xl-0,
  .px-xl-0 {
    padding-right: 0 !important;
  }
  .pb-xl-0,
  .py-xl-0 {
    padding-bottom: 0 !important;
  }
  .pl-xl-0,
  .px-xl-0 {
    padding-left: 0 !important;
  }
  .p-xl-1 {
    padding: 0.25rem !important;
  }
  .pt-xl-1,
  .py-xl-1 {
    padding-top: 0.25rem !important;
  }
  .pr-xl-1,
  .px-xl-1 {
    padding-right: 0.25rem !important;
  }
  .pb-xl-1,
  .py-xl-1 {
    padding-bottom: 0.25rem !important;
  }
  .pl-xl-1,
  .px-xl-1 {
    padding-left: 0.25rem !important;
  }
  .p-xl-2 {
    padding: 0.5rem !important;
  }
  .pt-xl-2,
  .py-xl-2 {
    padding-top: 0.5rem !important;
  }
  .pr-xl-2,
  .px-xl-2 {
    padding-right: 0.5rem !important;
  }
  .pb-xl-2,
  .py-xl-2 {
    padding-bottom: 0.5rem !important;
  }
  .pl-xl-2,
  .px-xl-2 {
    padding-left: 0.5rem !important;
  }
  .p-xl-3 {
    padding: 1rem !important;
  }
  .pt-xl-3,
  .py-xl-3 {
    padding-top: 1rem !important;
  }
  .pr-xl-3,
  .px-xl-3 {
    padding-right: 1rem !important;
  }
  .pb-xl-3,
  .py-xl-3 {
    padding-bottom: 1rem !important;
  }
  .pl-xl-3,
  .px-xl-3 {
    padding-left: 1rem !important;
  }
  .p-xl-4 {
    padding: 1.5rem !important;
  }
  .pt-xl-4,
  .py-xl-4 {
    padding-top: 1.5rem !important;
  }
  .pr-xl-4,
  .px-xl-4 {
    padding-right: 1.5rem !important;
  }
  .pb-xl-4,
  .py-xl-4 {
    padding-bottom: 1.5rem !important;
  }
  .pl-xl-4,
  .px-xl-4 {
    padding-left: 1.5rem !important;
  }
  .p-xl-5 {
    padding: 3rem !important;
  }
  .pt-xl-5,
  .py-xl-5 {
    padding-top: 3rem !important;
  }
  .pr-xl-5,
  .px-xl-5 {
    padding-right: 3rem !important;
  }
  .pb-xl-5,
  .py-xl-5 {
    padding-bottom: 3rem !important;
  }
  .pl-xl-5,
  .px-xl-5 {
    padding-left: 3rem !important;
  }
  .m-xl-n1 {
    margin: -0.25rem !important;
  }
  .mt-xl-n1,
  .my-xl-n1 {
    margin-top: -0.25rem !important;
  }
  .mr-xl-n1,
  .mx-xl-n1 {
    margin-right: -0.25rem !important;
  }
  .mb-xl-n1,
  .my-xl-n1 {
    margin-bottom: -0.25rem !important;
  }
  .ml-xl-n1,
  .mx-xl-n1 {
    margin-left: -0.25rem !important;
  }
  .m-xl-n2 {
    margin: -0.5rem !important;
  }
  .mt-xl-n2,
  .my-xl-n2 {
    margin-top: -0.5rem !important;
  }
  .mr-xl-n2,
  .mx-xl-n2 {
    margin-right: -0.5rem !important;
  }
  .mb-xl-n2,
  .my-xl-n2 {
    margin-bottom: -0.5rem !important;
  }
  .ml-xl-n2,
  .mx-xl-n2 {
    margin-left: -0.5rem !important;
  }
  .m-xl-n3 {
    margin: -1rem !important;
  }
  .mt-xl-n3,
  .my-xl-n3 {
    margin-top: -1rem !important;
  }
  .mr-xl-n3,
  .mx-xl-n3 {
    margin-right: -1rem !important;
  }
  .mb-xl-n3,
  .my-xl-n3 {
    margin-bottom: -1rem !important;
  }
  .ml-xl-n3,
  .mx-xl-n3 {
    margin-left: -1rem !important;
  }
  .m-xl-n4 {
    margin: -1.5rem !important;
  }
  .mt-xl-n4,
  .my-xl-n4 {
    margin-top: -1.5rem !important;
  }
  .mr-xl-n4,
  .mx-xl-n4 {
    margin-right: -1.5rem !important;
  }
  .mb-xl-n4,
  .my-xl-n4 {
    margin-bottom: -1.5rem !important;
  }
  .ml-xl-n4,
  .mx-xl-n4 {
    margin-left: -1.5rem !important;
  }
  .m-xl-n5 {
    margin: -3rem !important;
  }
  .mt-xl-n5,
  .my-xl-n5 {
    margin-top: -3rem !important;
  }
  .mr-xl-n5,
  .mx-xl-n5 {
    margin-right: -3rem !important;
  }
  .mb-xl-n5,
  .my-xl-n5 {
    margin-bottom: -3rem !important;
  }
  .ml-xl-n5,
  .mx-xl-n5 {
    margin-left: -3rem !important;
  }
  .m-xl-auto {
    margin: auto !important;
  }
  .mt-xl-auto,
  .my-xl-auto {
    margin-top: auto !important;
  }
  .mr-xl-auto,
  .mx-xl-auto {
    margin-right: auto !important;
  }
  .mb-xl-auto,
  .my-xl-auto {
    margin-bottom: auto !important;
  }
  .ml-xl-auto,
  .mx-xl-auto {
    margin-left: auto !important;
  }
}
.stretched-link::after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1;
  pointer-events: auto;
  content: "";
  background-color: rgba(0, 0, 0, 0);
}
.text-monospace {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace !important;
}
.text-justify {
  text-align: justify !important;
}
.text-wrap {
  white-space: normal !important;
}
.text-nowrap {
  white-space: nowrap !important;
}
.text-truncate {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}
.text-left {
  text-align: left !important;
}
.text-right {
  text-align: right !important;
}
.text-center {
  text-align: center !important;
}
@media (min-width: 576px) {
  .text-sm-left {
    text-align: left !important;
  }
  .text-sm-right {
    text-align: right !important;
  }
  .text-sm-center {
    text-align: center !important;
  }
}
@media (min-width: 768px) {
  .text-md-left {
    text-align: left !important;
  }
  .text-md-right {
    text-align: right !important;
  }
  .text-md-center {
    text-align: center !important;
  }
}
@media (min-width: 992px) {
  .text-lg-left {
    text-align: left !important;
  }
  .text-lg-right {
    text-align: right !important;
  }
  .text-lg-center {
    text-align: center !important;
  }
}
@media (min-width: 1200px) {
  .text-xl-left {
    text-align: left !important;
  }
  .text-xl-right {
    text-align: right !important;
  }
  .text-xl-center {
    text-align: center !important;
  }
}
.text-lowercase {
  text-transform: lowercase !important;
}
.text-uppercase {
  text-transform: uppercase !important;
}
.text-capitalize {
  text-transform: capitalize !important;
}
.font-weight-light {
  font-weight: 300 !important;
}
.font-weight-lighter {
  font-weight: lighter !important;
}
.font-weight-normal {
  font-weight: 400 !important;
}
.font-weight-bold {
  font-weight: 700 !important;
}
.font-weight-bolder {
  font-weight: bolder !important;
}
.font-italic {
  font-style: italic !important;
}
.text-white {
  color: white !important;
}
.text-primary {
  color: #E12326 !important;
}
a.text-primary:hover, a.text-primary:focus {
  color: #a11618 !important;
}
.text-secondary {
  color: #53555a !important;
}
a.text-secondary:hover, a.text-secondary:focus {
  color: #2e2f32 !important;
}
.text-success {
  color: #6aa539 !important;
}
a.text-success:hover, a.text-success:focus {
  color: #456c25 !important;
}
.text-info {
  color: #17a2b8 !important;
}
a.text-info:hover, a.text-info:focus {
  color: #0f6674 !important;
}
.text-warning {
  color: #fed600 !important;
}
a.text-warning:hover, a.text-warning:focus {
  color: #b29600 !important;
}
.text-danger {
  color: #E12326 !important;
}
a.text-danger:hover, a.text-danger:focus {
  color: #a11618 !important;
}
.text-light {
  color: #f2f2f2 !important;
}
a.text-light:hover, a.text-light:focus {
  color: #cccccc !important;
}
.text-dark {
  color: #53555a !important;
}
a.text-dark:hover, a.text-dark:focus {
  color: #2e2f32 !important;
}
.text-border {
  color: #d4d4d5 !important;
}
a.text-border:hover, a.text-border:focus {
  color: #adadaf !important;
}
.text-headings {
  color: #cb8671 !important;
}
a.text-headings:hover, a.text-headings:focus {
  color: #af5a40 !important;
}
.text-body {
  color: #3a3c41 !important;
}
.text-muted {
  color: #98999b !important;
}
.text-black-50 {
  color: rgba(33, 37, 41, 0.5) !important;
}
.text-white-50 {
  color: rgba(255, 255, 255, 0.5) !important;
}
.text-hide {
  font: 0/0 a;
  color: transparent;
  text-shadow: none;
  background-color: transparent;
  border: 0;
}
.text-decoration-none {
  text-decoration: none !important;
}
.text-break {
  word-break: break-word !important;
  word-wrap: break-word !important;
}
.text-reset {
  color: inherit !important;
}
.visible {
  visibility: visible !important;
}
.invisible {
  visibility: hidden !important;
}
@media print {
  *,
  *::before,
  *::after {
    text-shadow: none !important;
    box-shadow: none !important;
  }
  a:not(.btn) {
    text-decoration: underline;
  }
  abbr[title]::after {
    content: " (" attr(title) ")";
  }
  pre {
    white-space: pre-wrap !important;
  }
  pre,
  blockquote {
    border: 1px solid #afb0b1;
    page-break-inside: avoid;
  }
  tr,
  img {
    page-break-inside: avoid;
  }
  p,
  h2,
  h3 {
    orphans: 3;
    widows: 3;
  }
  h2,
  h3 {
    page-break-after: avoid;
  }
  @page {
    size: a3;
  }
  body {
    min-width: 992px !important;
  }
  .container {
    min-width: 992px !important;
  }
  .navbar {
    display: none;
  }
  .badge {
    border: 1px solid #212529;
  }
  .table {
    border-collapse: collapse !important;
  }
  .table td,
  .table th {
    background-color: white !important;
  }
  .table-bordered th,
  .table-bordered td {
    border: 1px solid #d4d4d5 !important;
  }
  .table-dark {
    color: inherit;
  }
  .table-dark th,
  .table-dark td,
  .table-dark thead th,
  .table-dark tbody + tbody {
    border-color: #d4d4d5;
  }
  .table .thead-dark th {
    color: inherit;
    border-color: #d4d4d5;
  }
}
.multiselect {
  position: relative;
  margin: 0 auto;
  width: 100%;
  display: flex;
  align-items: center;
  justify-content: flex-end;
  box-sizing: border-box;
  cursor: pointer;
  outline: none;
  border: 1px solid #D1D5DB;
  border-radius: 4px;
  background: #FFFFFF;
  font-size: 1rem;
  min-height: calc(2px + 1.375rem + 1rem);
}
.multiselect.is-open {
  border-radius: 4px 4px 0 0;
}
.multiselect.is-open-top {
  border-radius: 0 0 4px 4px;
}
.multiselect.is-disabled {
  cursor: default;
  background: #F3F4F6;
}
.multiselect.is-active {
  box-shadow: 0 0 0 3px rgba(16, 185, 129, 0.1882352941);
}
.multiselect-multiple-label,
.multiselect-single-label,
.multiselect-placeholder {
  display: flex;
  align-items: center;
  height: 100%;
  position: absolute;
  left: 0;
  top: 0;
  pointer-events: none;
  background: transparent;
  line-height: 1.375;
  padding-left: 0.875rem;
  padding-right: 3.875rem;
  box-sizing: border-box;
  max-width: 100%;
}
.multiselect-placeholder {
  color: #9CA3AF;
}
.multiselect-single-label-text {
  overflow: hidden;
  display: block;
  white-space: nowrap;
  text-overflow: ellipsis;
  max-width: 100%;
  padding-top: 17px;
}
.multiselect-search {
  width: 100%;
  height: 100%;
  position: absolute;
  top: 0px;
  bottom: 0px;
  left: 0px;
  right: 0px;
  outline: none;
  box-sizing: border-box;
  border: 0;
  appearance: none;
  font-size: inherit;
  font-family: inherit;
  background: #FFFFFF;
  border-radius: 4px;
  padding-left: 0.875rem;
}
.multiselect-search::-webkit-search-decoration, .multiselect-search::-webkit-search-cancel-button, .multiselect-search::-webkit-search-results-button, .multiselect-search::-webkit-search-results-decoration {
  -webkit-appearance: none;
}
.multiselect-tags {
  flex-grow: 1;
  flex-shrink: 1;
  display: flex;
  flex-wrap: wrap;
  margin: 0.25rem 0 0;
  padding-left: 0.5rem;
  align-items: center;
}
.multiselect-tag {
  background: #e3e4e4;
  color: #212529;
  font-size: 0.875rem;
  line-height: 1.25rem;
  font-weight: 400;
  padding: 0.125rem 0 0.125rem 0.5rem;
  border-radius: 4px;
  margin-right: 0.25rem;
  margin-bottom: 0.25rem;
  display: flex;
  align-items: center;
  white-space: nowrap;
}
.multiselect-tag.is-disabled {
  padding-right: 0.5rem;
  background: #9CA3AF;
  color: #FFFFFF;
}
.multiselect-tag-remove {
  display: flex;
  align-items: center;
  justify-content: center;
  padding: 0.25rem 0.25rem;
  margin: 0rem 0.125rem;
  border-radius: 4px;
}
.multiselect-tag-remove:hover {
  background: rgba(0, 0, 0, 0.062745098);
}
.multiselect-tag-remove-icon {
  -webkit-mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 320 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M207.6 256l107.72-107.72c6.23-6.23 6.23-16.34 0-22.58l-25.03-25.03c-6.23-6.23-16.34-6.23-22.58 0L160 208.4 52.28 100.68c-6.23-6.23-16.34-6.23-22.58 0L4.68 125.7c-6.23 6.23-6.23 16.34 0 22.58L112.4 256 4.68 363.72c-6.23 6.23-6.23 16.34 0 22.58l25.03 25.03c6.23 6.23 16.34 6.23 22.58 0L160 303.6l107.72 107.72c6.23 6.23 16.34 6.23 22.58 0l25.03-25.03c6.23-6.23 6.23-16.34 0-22.58L207.6 256z'%3E%3C/path%3E%3C/svg%3E");
  mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 320 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M207.6 256l107.72-107.72c6.23-6.23 6.23-16.34 0-22.58l-25.03-25.03c-6.23-6.23-16.34-6.23-22.58 0L160 208.4 52.28 100.68c-6.23-6.23-16.34-6.23-22.58 0L4.68 125.7c-6.23 6.23-6.23 16.34 0 22.58L112.4 256 4.68 363.72c-6.23 6.23-6.23 16.34 0 22.58l25.03 25.03c6.23 6.23 16.34 6.23 22.58 0L160 303.6l107.72 107.72c6.23 6.23 16.34 6.23 22.58 0l25.03-25.03c6.23-6.23 6.23-16.34 0-22.58L207.6 256z'%3E%3C/path%3E%3C/svg%3E");
  -webkit-mask-position: center;
  mask-position: center;
  -webkit-mask-repeat: no-repeat;
  mask-repeat: no-repeat;
  -webkit-mask-size: contain;
  mask-size: contain;
  background-color: currentColor;
  opacity: 0.8;
  display: inline-block;
  width: 0.75rem;
  height: 0.75rem;
}
.multiselect-tags-search-wrapper {
  display: inline-block;
  position: relative;
  margin: 0 0.25rem 0.25rem;
  flex-grow: 1;
  flex-shrink: 1;
  height: 100%;
}
.multiselect-tags-search-copy {
  visibility: hidden;
  white-space: pre-wrap;
  display: inline-block;
  height: 1px;
  width: 100%;
}
.multiselect-tags-search {
  position: absolute;
  left: 0;
  right: 0;
  top: 0;
  bottom: 0;
  border: 0;
  appearance: none;
  outline: none;
  padding: 0;
  font-size: inherit;
  font-family: inherit;
  box-sizing: border-box;
  width: 100%;
  appearance: none;
}
.multiselect-tags-search::-webkit-search-decoration, .multiselect-tags-search::-webkit-search-cancel-button, .multiselect-tags-search::-webkit-search-results-button, .multiselect-tags-search::-webkit-search-results-decoration {
  -webkit-appearance: none;
}
.multiselect-inifite {
  display: flex;
  width: 100%;
  justify-content: center;
  align-items: center;
  min-height: calc(2px + 1.375rem + 1rem);
}
.multiselect-spinner,
.multiselect-inifite-spinner {
  -webkit-mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 512 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M456.433 371.72l-27.79-16.045c-7.192-4.152-10.052-13.136-6.487-20.636 25.82-54.328 23.566-118.602-6.768-171.03-30.265-52.529-84.802-86.621-144.76-91.424C262.35 71.922 256 64.953 256 56.649V24.56c0-9.31 7.916-16.609 17.204-15.96 81.795 5.717 156.412 51.902 197.611 123.408 41.301 71.385 43.99 159.096 8.042 232.792-4.082 8.369-14.361 11.575-22.424 6.92z'%3E%3C/path%3E%3C/svg%3E");
  mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 512 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M456.433 371.72l-27.79-16.045c-7.192-4.152-10.052-13.136-6.487-20.636 25.82-54.328 23.566-118.602-6.768-171.03-30.265-52.529-84.802-86.621-144.76-91.424C262.35 71.922 256 64.953 256 56.649V24.56c0-9.31 7.916-16.609 17.204-15.96 81.795 5.717 156.412 51.902 197.611 123.408 41.301 71.385 43.99 159.096 8.042 232.792-4.082 8.369-14.361 11.575-22.424 6.92z'%3E%3C/path%3E%3C/svg%3E");
  -webkit-mask-position: center;
  mask-position: center;
  -webkit-mask-repeat: no-repeat;
  mask-repeat: no-repeat;
  -webkit-mask-size: contain;
  mask-size: contain;
  background-color: #10B981;
  width: 1rem;
  height: 1rem;
  z-index: 10;
  animation: multiselect-spin 1s linear infinite;
  flex-shrink: 0;
  flex-grow: 0;
}
.multiselect-spinner {
  margin: 0 0.875rem 0 0;
}
.multiselect-clear {
  padding: 0 0.875rem 0 0px;
  position: relative;
  z-index: 10;
  opacity: 1;
  transition: 0.3s;
  flex-shrink: 0;
  flex-grow: 0;
  display: flex;
}
.multiselect-clear:hover .multiselect-clear-icon {
  background-color: #000000;
}
.multiselect-clear-icon {
  -webkit-mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 320 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M207.6 256l107.72-107.72c6.23-6.23 6.23-16.34 0-22.58l-25.03-25.03c-6.23-6.23-16.34-6.23-22.58 0L160 208.4 52.28 100.68c-6.23-6.23-16.34-6.23-22.58 0L4.68 125.7c-6.23 6.23-6.23 16.34 0 22.58L112.4 256 4.68 363.72c-6.23 6.23-6.23 16.34 0 22.58l25.03 25.03c6.23 6.23 16.34 6.23 22.58 0L160 303.6l107.72 107.72c6.23 6.23 16.34 6.23 22.58 0l25.03-25.03c6.23-6.23 6.23-16.34 0-22.58L207.6 256z'%3E%3C/path%3E%3C/svg%3E");
  mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 320 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M207.6 256l107.72-107.72c6.23-6.23 6.23-16.34 0-22.58l-25.03-25.03c-6.23-6.23-16.34-6.23-22.58 0L160 208.4 52.28 100.68c-6.23-6.23-16.34-6.23-22.58 0L4.68 125.7c-6.23 6.23-6.23 16.34 0 22.58L112.4 256 4.68 363.72c-6.23 6.23-6.23 16.34 0 22.58l25.03 25.03c6.23 6.23 16.34 6.23 22.58 0L160 303.6l107.72 107.72c6.23 6.23 16.34 6.23 22.58 0l25.03-25.03c6.23-6.23 6.23-16.34 0-22.58L207.6 256z'%3E%3C/path%3E%3C/svg%3E");
  -webkit-mask-position: center;
  mask-position: center;
  -webkit-mask-repeat: no-repeat;
  mask-repeat: no-repeat;
  -webkit-mask-size: contain;
  mask-size: contain;
  background-color: #999999;
  width: 0.625rem;
  height: 1.125rem;
  display: inline-block;
  transition: 0.3s;
}
.multiselect-caret {
  transform: rotate(0deg);
  transition: 0.3s transform;
  -webkit-mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 320 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M31.3 192h257.3c17.8 0 26.7 21.5 14.1 34.1L174.1 354.8c-7.8 7.8-20.5 7.8-28.3 0L17.2 226.1C4.6 213.5 13.5 192 31.3 192z'%3E%3C/path%3E%3C/svg%3E");
  mask-image: url("data:image/svg+xml,%3Csvg viewBox='0 0 320 512' fill='currentColor' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath d='M31.3 192h257.3c17.8 0 26.7 21.5 14.1 34.1L174.1 354.8c-7.8 7.8-20.5 7.8-28.3 0L17.2 226.1C4.6 213.5 13.5 192 31.3 192z'%3E%3C/path%3E%3C/svg%3E");
  -webkit-mask-position: center;
  mask-position: center;
  -webkit-mask-repeat: no-repeat;
  mask-repeat: no-repeat;
  -webkit-mask-size: contain;
  mask-size: contain;
  background-color: #53555a;
  width: 0.625rem;
  height: 1.125rem;
  margin: 0 0.875rem 0 0;
  position: relative;
  z-index: 10;
  flex-shrink: 0;
  flex-grow: 0;
  pointer-events: none;
}
.multiselect-caret.is-open {
  transform: rotate(180deg);
  pointer-events: auto;
}
.multiselect-dropdown {
  position: absolute;
  left: -1px;
  right: -1px;
  bottom: 0;
  transform: translateY(100%);
  border: 1px solid #D1D5DB;
  margin-top: -1px;
  max-height: 15rem;
  overflow-y: scroll;
  -webkit-overflow-scrolling: touch;
  z-index: 100;
  background: #FFFFFF;
  display: flex;
  flex-direction: column;
  border-radius: 0 0 4px 4px;
  outline: none;
  max-height: 10rem;
}
.multiselect-dropdown.is-top {
  transform: translateY(-100%);
  top: 1px;
  bottom: auto;
  border-radius: 4px 4px 0 0;
}
.multiselect-dropdown.is-hidden {
  display: none;
}
.multiselect-options {
  padding: 0;
  margin: 0;
  list-style: none;
  display: flex;
  flex-direction: column;
}
.multiselect-group {
  padding: 0;
  margin: 0;
}
.multiselect-group-label {
  padding: 0.3rem 0.75rem;
  font-size: 0.875rem;
  font-weight: 600;
  background: #E5E7EB;
  color: #374151;
  cursor: default;
  line-height: 1.375;
  display: flex;
  box-sizing: border-box;
  text-decoration: none;
  align-items: center;
  justify-content: flex-start;
  text-align: left;
}
.multiselect-group-label.is-pointable {
  cursor: pointer;
}
.multiselect-group-label.is-pointed {
  background: #D1D5DB;
  color: #374151;
}
.multiselect-group-label.is-selected {
  background: #98999b;
  color: #FFFFFF;
}
.multiselect-group-label.is-disabled {
  background: #F3F4F6;
  color: #D1D5DB;
  cursor: not-allowed;
}
.multiselect-group-label.is-selected.is-pointed {
  background: #98999b;
  color: #FFFFFF;
}
.multiselect-group-label.is-selected.is-disabled {
  background: #75cfb1;
  color: #D1FAE5;
}
.multiselect-group-options {
  padding: 0;
  margin: 0;
}
.multiselect-option {
  padding: 0.5rem 0.75rem;
  font-size: 1rem;
  line-height: 1.375;
  cursor: pointer;
  display: flex;
  box-sizing: border-box;
  text-decoration: none;
  align-items: center;
  justify-content: flex-start;
  text-align: left;
}
.multiselect-option.is-pointed {
  background: #FFFFFF;
  color: #1F2937;
}
.multiselect-option.is-selected {
  background: #98999b;
  color: #FFFFFF;
}
.multiselect-option.is-disabled {
  background: #FFFFFF;
  color: #D1D5DB;
  cursor: not-allowed;
}
.multiselect-option.is-selected.is-pointed {
  background: #98999b;
  color: #FFFFFF;
}
.multiselect-option.is-selected.is-disabled {
  background: #FFFFFF;
  color: #D1FAE5;
}
.multiselect-no-options,
.multiselect-no-results {
  padding: 0.5rem 0.75rem;
  color: #4B5563;
}
.multiselect-fake-input {
  background: transparent;
  position: absolute;
  left: 0;
  right: 0;
  bottom: -1px;
  width: 100%;
  height: 1px;
  border: 0;
  padding: 0;
  font-size: 0;
  outline: none;
}
.multiselect-fake-input:active, .multiselect-fake-input:focus {
  outline: none;
}
.multiselect-spacer {
  display: none;
}
[dir=rtl] .multiselect-multiple-label,
[dir=rtl] .multiselect-single-label,
[dir=rtl] .multiselect-placeholder {
  padding-right: 0.875rem;
  padding-left: 3.875rem;
  left: auto;
  right: 0;
}
[dir=rtl] .multiselect-search {
  padding-left: 0;
  padding-right: 0.875rem;
}
[dir=rtl] .multiselect-tags {
  padding-left: 0;
  padding-right: 0.5rem;
}
[dir=rtl] .multiselect-tag {
  padding: 0.125rem 0.5rem 0.125rem 0;
  margin-right: 0;
  margin-left: 0.25rem;
}
[dir=rtl] .multiselect-tag.is-disabled {
  padding-left: 0.5rem;
}
[dir=rtl] .multiselect-spinner,
[dir=rtl] .multiselect-caret {
  margin: 0 0 0 0.875rem;
}
[dir=rtl] .multiselect-clear {
  padding: 0 0 0 0.875rem;
}
@keyframes multiselect-spin {
  from {
    transform: rotate(0);
  }
  to {
    transform: rotate(360deg);
  }
}
h1, h2, h3, h4, h5, h6 {
  margin: 0 0 8px;
  padding: 0;
}
h1 {
  color: rgb(33, 37, 41);
}
h2 {
  color: rgb(33, 37, 41);
}
h1.copper,
h2.copper,
h3.copper,
h4.copper,
h5.copper {
  color: #cb8671;
}
h1.grey,
h2.grey,
h3.grey,
h4.grey,
h5.grey {
  color: #98999b;
}
a {
  outline: 0;
  text-decoration: none;
}
a:hover {
  color: #E12326;
  outline: 0;
  text-decoration: none;
}
a[href^="mailto:"] {
  color: #212529;
}
a[href^="mailto:"]:before {
  background-size: 20px 20px;
  background-position: 0px 42%;
  content: " ";
  display: inline-block;
  width: 20px;
  height: 20px;
  margin-right: 8px;
  top: 4px;
  position: relative;
}
a[href^="mailto:"]:hover {
  color: #E12326 !important;
}
a[href^="phoneto:"],
a[href^="tel:"] {
  color: #212529;
}
a[href^="phoneto:"]:before,
a[href^="tel:"]:before {
  content: " ";
  display: inline-block;
  width: 20px;
  height: 20px;
  margin-right: 6px;
  top: 3px;
  position: relative;
  color: #e3001e;
  background-size: 18px 18px;
  background-position: 0 42%;
}
a[href^="phoneto:"]:hover,
a[href^="tel:"]:hover {
  color: #E12326 !important;
}
a[href^="fax:"] {
  color: #212529;
}
a[href^="fax:"]:before {
  background: url("../../images/icon_sprite_30x30.svg");
  background-size: auto 90px;
  background-position: 82px 55px;
  content: " ";
  display: inline-block;
  width: 20px;
  height: 18px;
  top: 2px;
  position: relative;
}
a[href^="fax:"]:hover {
  color: #E12326 !important;
}
a[title*=noarrow] {
  color: #E12326 !important;
}
a[title*=noarrow]:before {
  display: none !important;
}
/*
a[title*="arrow"],
.arrow {
    @include link-icon;
}

.arrow-white {
    @include link-icon;
    @include link-icon-white;
}
*/
a.no-icon:before {
  content: none !important;
}
.h1, h1 {
  font-size: clamp(30px, 2.5vw, 45px);
  font-weight: 700;
  line-height: 50px;
}
@media (max-width: 768px) {
  .h1, h1 {
    line-height: 35px;
  }
}
.h2, h2 {
  font-size: clamp(25px, 2.5vw, 40px);
  font-weight: 700;
  line-height: 45px;
}
@media (max-width: 768px) {
  .h2, h2 {
    line-height: 30px;
  }
}
.h3, h3 {
  font-size: clamp(22px, 2.5vw, 30px);
  font-weight: 700;
  line-height: 35px;
}
@media (max-width: 768px) {
  .h3, h3 {
    line-height: 27px;
  }
}
.h4, h4 {
  font-size: clamp(20px, 2.5vw, 25px);
  font-weight: 700;
  line-height: 30px;
}
@media (max-width: 768px) {
  .h4, h4 {
    line-height: 25px;
  }
}
.h5, h5 {
  font-size: clamp(18px, 2.5vw, 20px);
  font-weight: 700;
  line-height: 25px;
}
@media (max-width: 768px) {
  .h5, h5 {
    line-height: 23px;
  }
}
p, a, button, a.btn, .btn {
  font-size: 18px;
  font-weight: 300;
  line-height: 1.5;
}
.dp__theme_light {
  --dp-primary-color: #53555a;
  --dp-hover-color: #e3e4e4;
  --dp-text-color: #212529;
  --dp-icon-color: #212529;
}
.multiselect-option.is-selected {
  background: #53555a;
}
.multiselect-option.is-pointed {
  background: #53555a;
  color: white;
}
.multiselect-option.is-selected.is-pointed {
  background: #53555a;
}
.multiselect-caret {
  background: none;
  mask-image: none;
  -webkit-mask-image: none;
  padding: 10px;
  margin-right: 0px;
  transition: none;
  transform: none;
}
.multiselect-caret.is-open {
  transition: none;
  transform: none;
}
.multiselect-caret::before {
  position: absolute;
  font-family: "Font Awesome 7 Pro";
  font-weight: 300;
  top: -3px;
  left: 1px;
  content: "\f107";
}
.multiselect-assistive-text {
  display: none;
}
.multiselect.is-open, .multiselect.is-active {
  border-color: black !important;
}
.container {
  max-width: 1440px;
}
#mywieland-app {
  font-family: museo-sans, sans-serif;
  font-weight: 300;
  /* Chrome, Safari, Edge, Opera */
  /* Firefox */
}
#mywieland-app .row {
  flex-shrink: initial !important;
}
#mywieland-app .clickable:hover {
  cursor: pointer !important;
}
#mywieland-app ul:not(.multiselect-options) {
  padding-left: 2rem !important;
}
#mywieland-app button-min {
  width: auto;
}
#mywieland-app .wtable .table {
  display: table;
  width: 100%;
}
#mywieland-app .wtable .table .mobile-th {
  display: none;
}
#mywieland-app .wtable .table thead th:not(.no-bg) {
  background-color: #53555a;
  color: white;
  border: none;
  font-weight: 400;
  vertical-align: top;
  white-space: normal;
}
#mywieland-app .wtable .table thead th:not(.no-bg) .sort-arrow {
  color: #98999b;
}
#mywieland-app .wtable .table thead th:not(.no-bg) .sort-arrow.active {
  color: white;
}
#mywieland-app .wtable .table thead th:first-child {
  border-top-left-radius: 0.25rem;
}
#mywieland-app .wtable .table thead th:last-child {
  border-top-right-radius: 0.25rem;
}
#mywieland-app .wtable .table tbody tr {
  background-color: white;
  cursor: default;
  border-bottom: 1px solid #e3e4e4;
}
#mywieland-app .wtable .table tbody tr.overDue {
  color: #E12326;
}
#mywieland-app .wtable .table tbody tr.dunninglvl2 {
  font-weight: 600;
}
#mywieland-app .wtable .table tbody tr.webLabellingTableRow {
  height: 70px;
  max-height: 70px;
}
#mywieland-app .wtable .table tbody td {
  border: none;
  background-color: initial;
  white-space: normal;
}
#mywieland-app .wtable .table tbody tr:nth-child(2n) td {
  background-color: initial;
}
#mywieland-app .wtable .table .clickable:hover {
  background-color: #e3e4e4;
}
#mywieland-app .wtable .table .clickable:hover td {
  background-color: #e3e4e4;
}
@media only screen and (max-width: 760px), (min-device-width: 768px) and (max-device-width: 1024px) {
  #mywieland-app .wtable .table {
    display: block;
    /* Force table to not be like tables anymore */
    /* Force table to not be like tables anymore */
    /* Hide table headers (but not display: none;, for accessibility) */
  }
  #mywieland-app .wtable .table thead,
  #mywieland-app .wtable .table tbody,
  #mywieland-app .wtable .table th,
  #mywieland-app .wtable .table td,
  #mywieland-app .wtable .table tr,
  #mywieland-app .wtable .table .mobile-th {
    display: block;
  }
  #mywieland-app .wtable .table thead tr {
    position: absolute;
    top: -9999px;
    left: -9999px;
  }
  #mywieland-app .wtable .table thead th {
    background-color: #53555a;
    color: white;
    border: none;
    font-weight: 400;
    vertical-align: top;
  }
  #mywieland-app .wtable .table thead th .sort-arrow {
    color: #98999b;
  }
  #mywieland-app .wtable .table thead th .sort-arrow.active {
    color: white;
  }
  #mywieland-app .wtable .table tbody tr {
    background-color: white;
    cursor: default;
    border-bottom: 1px solid #e3e4e4;
    margin-bottom: 5px;
    margin-top: 5px;
  }
  #mywieland-app .wtable .table tbody tr.overDue {
    background-color: #E12326;
    color: white;
  }
  #mywieland-app .wtable .table tbody tr.overDue td {
    background-color: #E12326;
    color: white;
  }
  #mywieland-app .wtable .table tbody tr.webLabellingTableRow {
    height: 70px;
    max-height: 70px;
  }
  #mywieland-app .wtable .table tbody td {
    border: none;
    background-color: white;
    margin: 0px 0 0px 55%;
    position: relative;
    padding-top: 0px;
  }
  #mywieland-app .wtable .table tbody .mobile-th {
    border: none;
    font-weight: 400;
    vertical-align: top;
    float: left;
    width: 50%;
    padding: 3px 10px 3px 20px;
  }
}
#mywieland-app #popup {
  display: none;
  position: fixed;
  left: 50%;
  top: 50%;
  transform: translate(-50%, -50%);
  padding: 20px;
  border: 2px solid #000;
  background-color: #fff;
  box-shadow: 0 0 10px rgba(0, 0, 0, 0.1);
  z-index: 1000;
}
#mywieland-app .btn {
  min-width: 38px;
  border-radius: 0px !important;
}
#mywieland-app .btn-primary {
  background-color: #E12326;
}
#mywieland-app .btn-primary:hover, #mywieland-app .btn-primary:active, #mywieland-app .btn-primary:focus {
  background-color: #AE2323;
}
#mywieland-app .btn-primary:disabled {
  background-color: #D9D9D4;
  border-color: #D9D9D4;
}
#mywieland-app .btn-secondary {
  background-color: #fff;
  color: black;
  border-color: #C8C9C7;
}
#mywieland-app .btn-secondary:hover, #mywieland-app .btn-secondary:active, #mywieland-app .btn-secondary:focus {
  border-color: #E12326;
}
#mywieland-app .btn-secondary:disabled {
  color: #C8C9C7;
}
#mywieland-app .filter-btn {
  height: 3.125rem;
}
#mywieland-app .multiselect-wrapper {
  display: flex;
}
#mywieland-app input.form-control:active, #mywieland-app input.form-control:focus, #mywieland-app input.form-control:hover, #mywieland-app textarea.form-control:active, #mywieland-app textarea.form-control:focus, #mywieland-app textarea.form-control:hover, #mywieland-app select.form-control:active, #mywieland-app select.form-control:focus, #mywieland-app select.form-control:hover {
  border-color: black;
  box-shadow: none;
}
#mywieland-app .form-control {
  font-weight: 400;
  border: 1.5px solid #C8C9C7;
  appearance: auto;
  border-radius: 0px;
  color: #52555A;
}
#mywieland-app .form-control .dp__input {
  border: none;
  padding: 0 0 0 25px;
}
#mywieland-app .form-control .dp__input_icons {
  padding: 0;
}
#mywieland-app select.form-control {
  padding: 0 5px !important;
}
#mywieland-app .form-label-group select.form-control {
  padding-top: 1.25rem;
  padding-bottom: 0.25rem;
  padding-left: 0rem;
}
#mywieland-app .form-control:focus {
  box-shadow: none;
}
#mywieland-app .btn:focus {
  box-shadow: none;
}
#mywieland-app .exportLink {
  cursor: pointer;
  color: black;
  color: #212529;
}
#mywieland-app .exportLink i {
  color: #E12326;
}
#mywieland-app .multiselect-option {
  color: black;
}
#mywieland-app .multiselect-option.is-pointed {
  background: #e3e4e4;
  color: black;
}
#mywieland-app .multiselect-option.is-selected {
  background: white;
  color: black;
}
#mywieland-app .multiselect-option.is-selected.is-pointed {
  background: #e3e4e4;
  color: black;
}
#mywieland-app .multiselect-option::before {
  content: "";
  width: 0.9em;
  height: 0.87em;
  border: 1px solid grey;
  box-shadow: inset 1em 1em #ffffff;
  border-radius: 2px;
  translate: -5px;
  margin-top: -2px;
  margin-right: 6px;
  font-size: 17px;
  line-height: 0.8;
}
#mywieland-app .multiselect-option.is-selected::before {
  content: "✓";
  display: inline-block;
  border: 1px solid #53555a;
  padding: 1px;
  box-shadow: inset 1em 1em #53555a;
  color: white;
}
#mywieland-app .multiselect.form-control {
  padding-top: 0.5rem;
}
#mywieland-app .multiselect-single-label {
  margin-top: -8px;
}
#mywieland-app .detailviewhead {
  background-color: #f3f3f3;
  padding: 25px 0px 25px 25px;
  margin-bottom: 30px;
}
#mywieland-app .negativeAmount {
  color: #E12326;
}
#mywieland-app .detailHeadh3 {
  margin-top: 50px;
  margin-bottom: 20px;
  font-size: 20px;
  font-weight: 400;
}
#mywieland-app .detailHeadh3 .label {
  font-size: 22px;
}
#mywieland-app .homeTiles {
  display: flex;
  flex-wrap: wrap;
  margin-left: -25px;
  margin-right: -25px;
  padding: 30px 0 20px;
}
#mywieland-app .homeTiles .col-sm-6,
#mywieland-app .homeTiles .col-md-4,
#mywieland-app .homeTiles .col-xs-12 {
  padding-left: 25px;
  padding-right: 25px;
}
#mywieland-app .homeTiles .homeTile {
  padding: 20px 0 20px 20px;
  box-shadow: -1px 3px 5px 1px rgba(0, 0, 0, 0.1);
  margin: 0 0.5% 15px;
  background-color: white;
}
#mywieland-app .homeTiles .homeTile i {
  font-size: 1.5rem;
}
#mywieland-app .homeTiles .homeTile span {
  vertical-align: top;
  color: #3a3c41;
}
#mywieland-app .homeTiles .homeTile:hover span {
  color: #E12326;
}
#mywieland-app #outgoingTable td, #mywieland-app #outgoingTable th {
  padding-left: 0.25rem;
  padding-right: 0.25rem;
}
#mywieland-app #deliveredTable td, #mywieland-app #deliveredTable th {
  padding-left: 0.25rem;
  padding-right: 0.25rem;
}
#mywieland-app .container {
  max-width: 1440px;
}
#mywieland-app .input-errors {
  font-size: 0.8rem;
  padding: 0 4px 2px;
}
#mywieland-app .input-errors .warning-msg {
  color: #ffa300;
}
#mywieland-app .pw-rules {
  color: #98999b;
  vertical-align: top;
}
#mywieland-app .pw-rules .pw-rule-block {
  padding-right: 25px;
}
#mywieland-app .pw-rules .pw-rule-block .pw-rule .small {
  font-size: 0.6rem;
  line-height: 0.8rem;
}
#mywieland-app .form-label-group label {
  z-index: 9;
}
#mywieland-app .form-control.error {
  border-color: #E12326;
}
#mywieland-app input::-webkit-outer-spin-button,
#mywieland-app input::-webkit-inner-spin-button {
  -webkit-appearance: none;
  margin: 0;
}
#mywieland-app input[type=number] {
  -moz-appearance: textfield;
}
#mywieland-app input[type=checkbox]:not(.toggle) {
  appearance: none;
  background-color: #fff;
  margin: 0 0.15em 0 0;
  font: inherit;
  color: currentColor;
  width: 1.15em;
  height: 1.15em;
  border: 1px solid #c3c3c4;
  transform: translateX(-1.5rem) translateY(0.1em);
  display: grid;
  place-content: center;
}
#mywieland-app input[type=checkbox]::before {
  content: "✓";
  color: white;
  font-size: 0.9em;
  transform: scale(0);
  transition: 120ms transform ease-in-out;
  padding-top: 2px;
}
#mywieland-app input[type=radio]:checked::before {
  content: "";
  position: absolute;
  top: 59%;
  left: 50%;
  transform: translate(-54%, -60%);
  border: 4px solid #1275A8;
  border-radius: 10px;
  background: white;
  height: 18px;
  width: 18px;
}
#mywieland-app input[type=radio] {
  accent-color: #1275A8;
  transform: scale(1.2);
}
#mywieland-app input[type=checkbox]:checked::before {
  transform: scale(1);
}
#mywieland-app input[type=checkbox]:checked {
  background-color: #1275A8;
  border: 0px;
}
#mywieland-app input[type=checkbox]:hover {
  border-color: #000;
}
#mywieland-app .form-check {
  padding-left: 1.5rem;
}
#mywieland-app .form-check-input.error {
  outline-color: #E12326;
}
#mywieland-app #plantSelect {
  display: none;
}
#mywieland-app .vertical-center {
  display: flex;
  align-items: center;
}
#mywieland-app .vertical-bottom {
  display: grid;
  align-items: end;
}
#mywieland-app .add-button {
  background-color: #c3c3c4;
  border: 1px solid #c3c3c4;
  color: #53555a;
  font-size: 16px !important;
  font-weight: 800;
  padding-left: 14px;
  padding-top: 5px;
}
#mywieland-app .add-button:hover {
  background-color: #53555a;
  border: 1px solid #53555a;
  color: white;
}
#mywieland-app .add-button:focus {
  box-shadow: none;
}
#mywieland-app .add-button[disabled]:hover {
  cursor: not-allowed;
  background-color: #e3e4e4;
  border: 1px solid #e3e4e4;
  color: #53555a;
}
#mywieland-app .add-button[disabled] {
  background-color: #e3e4e4;
  border: 1px solid #e3e4e4;
  color: #53555a;
}
#mywieland-app .wtable {
  position: relative;
}
#mywieland-app .loading-indicator {
  position: absolute;
  top: 1%;
  z-index: 999;
  text-align: center;
  width: 100%;
  height: 100%;
  background: rgba(255, 255, 255, 0.5);
  display: flex;
  align-items: center;
  justify-content: center;
}
#mywieland-app .logoutBtn {
  margin-bottom: 10px;
}
#mywieland-app .alert {
  position: fixed;
  top: 50px;
  width: 98%;
  z-index: 1060;
  box-shadow: 0px 0px 4px 0px white;
  max-width: 1440px;
}
@media (max-width: 767px) {
  #mywieland-app .alert {
    width: 92%;
  }
}
#mywieland-app .search {
  position: relative;
}
@keyframes spinner {
  to {
    transform: rotate(360deg);
  }
}
#mywieland-app .search .spinning {
  animation: spinner 2s linear infinite;
}
#mywieland-app .search .search-button {
  border-color: #d4d4d5;
  background-color: #e3e4e4;
}
#mywieland-app .search .search-button:hover,
#mywieland-app .search .search-button:focus {
  background-color: #c3c3c4;
}
#mywieland-app .search .search-results-dd {
  top: 0px;
  left: 0px;
  transform: translate3d(15px, 39px, 0px);
  will-change: transform;
  position: absolute;
  z-index: 1000;
  border: 1px solid #d4d4d5;
  border-radius: 0.25rem;
  background-color: white;
}
#mywieland-app .search .search-results-dd .dd-menu,
#mywieland-app .search .search-results .dd-menu {
  width: 100%;
  float: left;
  min-width: 10rem;
  margin: 0.125rem 0 0;
  font-size: 1rem;
  text-align: left;
  list-style: none;
  background-clip: padding-box;
}
#mywieland-app .search .search-results-dd .dd-menu .show-more,
#mywieland-app .search .search-results .dd-menu .show-more {
  padding: 0.3rem 0;
  text-align: center;
  background-color: #e3e4e4;
  cursor: pointer;
}
#mywieland-app .search .search-results-dd .dd-menu .show-more:hover,
#mywieland-app .search .search-results .dd-menu .show-more:hover {
  background-color: #d4d4d5;
}
#mywieland-app .search .search-results-dd .search-result-section,
#mywieland-app .search .search-results .search-result-section {
  padding: 0.6rem 1.5rem 0rem;
  font-size: 0.75rem;
}
#mywieland-app .search .search-results-dd .search-result-wrapper,
#mywieland-app .search .search-results .search-result-wrapper {
  padding: 0rem 1.5rem;
  margin: 0.2rem 0rem;
  cursor: pointer;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result,
#mywieland-app .search .search-results .search-result-wrapper .search-result {
  padding: 0px;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .search-result-desc,
#mywieland-app .search .search-results .search-result-wrapper .search-result .search-result-desc {
  font-size: 0.75rem;
  color: #afb0b1;
  margin-top: -3px;
  white-space: normal;
  margin-left: 40px;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas {
  font-size: 15px;
  float: left;
  margin: 4px 0.5rem 0 0;
  color: white;
  padding: 8px;
  border-radius: 16px;
  width: 32px;
  height: 32px;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas.order,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas.order {
  background-color: #0075a8;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas.order:before,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas.order:before {
  margin-left: -1px;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas.shipment,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas.shipment {
  background-color: #ffa300;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas.apz,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas.apz {
  background-color: #afb0b1;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas.invoice,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas.invoice {
  background-color: #6d0d00;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas.invoice:before,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas.invoice:before {
  margin-left: 3px;
}
#mywieland-app .search .search-results-dd .search-result-wrapper .search-result .fas.contract,
#mywieland-app .search .search-results .search-result-wrapper .search-result .fas.contract {
  background-color: #00a787;
}
#mywieland-app .search .search-results-dd .search-result-wrapper:first-child,
#mywieland-app .search .search-results .search-result-wrapper:first-child {
  margin-top: 0rem;
}
#mywieland-app .search .search-results-dd .search-result-wrapper:hover,
#mywieland-app .search .search-results .search-result-wrapper:hover {
  background-color: #e3e4e4;
}
#mywieland-app .search .search-results-dd .search-result-wrapper:hover .search-result-desc,
#mywieland-app .search .search-results .search-result-wrapper:hover .search-result-desc {
  color: #53555a;
}
#mywieland-app .search .search-results-dd .search-result:last-child,
#mywieland-app .search .search-results .search-result:last-child {
  border-bottom-width: 0px;
}
#mywieland-app .search .search-results {
  margin-top: 1rem;
}
#mywieland-app .search .search-results .search-result-wrapper {
  margin: 0.4rem 0;
}
#mywieland-app .search .search-results .search-result-wrapper .search-result {
  border-left: 0;
}
@media (min-width: 768px) {
  #mywieland-app .search .search-results-dd {
    width: calc(33.33333333% - 20px);
    max-width: calc(33.33333333% - 20px);
  }
}
#mywieland-app .nav-tabs .nav-link:hover {
  border-color: transparent;
}
#mywieland-app .nav-tabs .nav-link.active {
  border: 0px solid #d4d4d5;
  border-bottom-width: 3px;
}
#mywieland-app .nav-tabs #order-tab.active {
  border-color: #0075a8;
}
#mywieland-app .nav-tabs #contract-tab.active {
  border-color: #00a787;
}
#mywieland-app .nav-tabs #invoice-tab.active {
  border-color: #6d0d00;
}
#mywieland-app .nav-tabs #shipment-tab.active {
  border-color: #ffa300;
}
#mywieland-app .pagination {
  margin-bottom: 1rem;
}
#mywieland-app .pagination .btn {
  font-size: 13px;
  width: 40px;
  height: 40px;
  margin: 0 0.8rem;
  border-radius: 0px;
}
#mywieland-app .pagination .btn:focus {
  border: none;
  box-shadow: none;
}
#mywieland-app .pagination .btn:hover {
  background-color: #e3e4e4;
}
#mywieland-app .pagination .btn.active {
  font-weight: bold;
  background: none;
  border-width: 0px 0px 3px;
  border-style: solid;
  border-color: #E12326;
}
#mywieland-app .pagination .dots {
  font-size: 1.5rem;
  line-height: 1rem;
}
@keyframes spinner {
  to {
    transform: rotate(360deg);
  }
}
#mywieland-app .exportLink .spinning {
  animation: spinner 2s linear infinite;
}
#mywieland-app .component-breadcrumb {
  padding-bottom: 30px;
}
#mywieland-app .component-breadcrumb ol.breadcrumb {
  padding: 20px 0 0;
  display: flex;
  flex-wrap: wrap;
  margin: 0;
  font-size: 14px;
  list-style: none;
  background: none;
}
#mywieland-app .component-breadcrumb ol.breadcrumb li {
  display: inline-block;
  margin-right: 5px;
  font-size: 15px;
  color: #999;
}
#mywieland-app .component-breadcrumb ol.breadcrumb li i {
  font-size: 0.6rem;
  margin-left: 12px;
  margin-right: 5px;
}
#mywieland-app .component-breadcrumb ol.breadcrumb li a {
  color: #999;
  text-decoration: underline;
  font-size: 15px;
}
#mywieland-app .btn-primary:visited {
  color: white;
}
#mywieland-app .modal-dialog {
  height: fit-content;
}
@media (max-width: 767px) {
  #mywieland-app .modal-dialog {
    height: 100%;
  }
}
#mywieland-app .product .product-headline {
  margin-bottom: 30px;
}
#mywieland-app .product .product-description {
  margin-bottom: 20px;
}
#mywieland-app .product .productImageGalery {
  max-width: 565px;
}
#mywieland-app .product .productImageGalery .carousel__slide {
  align-items: initial;
}
#mywieland-app .product .productImageGalery .productImage.carousel__slide--active {
  z-index: 5;
}
#mywieland-app .product .productImageGalery .thumbnails {
  margin-top: 4px;
}
#mywieland-app .product .productImageGalery .thumbnail {
  border: 1px solid #c3c3c4;
  padding-right: 4px;
}
#mywieland-app .product .productImageGalery .carousel__slide--active .thumbnail {
  border-color: #53555a;
  border-width: 2px;
}
#mywieland-app .product .classificationTableHeadline {
  margin-top: 80px;
}
#mywieland-app .product .classificationTable {
  margin-top: 25px;
}
#mywieland-app .product .classificationTable .row {
  margin: 5px 10px;
}
#mywieland-app .product .classificationTable .value {
  font-weight: bold;
}
#mywieland-app .facetSearch {
  padding: 20px;
}
#mywieland-app .facetSearch .multiselect-clear {
  display: none !important;
}
#mywieland-app .productlist input[type=checkbox]:checked::before {
  box-shadow: inset 1em 1em #E12326;
}
#mywieland-app .productlist .productListImage {
  width: 100%;
}
#mywieland-app .productlist .productListRow {
  margin-bottom: 20px;
}
#mywieland-app .productlist .totalProducts {
  text-align: center;
  font-weight: 700;
  margin-bottom: 30px;
}
#mywieland-app .errorMsg {
  font-size: smaller;
  color: red;
}
#mywieland-app .quote-request .add-panel {
  margin: 0 0 15px 0;
}
#mywieland-app .quote-request .add-panel p {
  font-size: larger;
}
#mywieland-app .quote-request .note {
  font-size: smaller !important;
}
#mywieland-app .quote-request .unit {
  font-size: large !important;
  margin-bottom: 5px;
}
#mywieland-app .dropzone-container {
  padding: 4rem;
  background: #C3E6F6;
  border: 2px solid #C3E6F6;
  text-align: center;
}
#mywieland-app .dropzone-container input {
  overflow: hidden;
  width: 300px;
}
#mywieland-app .dropzone-container:hover {
  border: 2px solid #1275A8;
}
@media only screen and (max-width: 480px) {
  #mywieland-app .dropzone-container label div {
    display: none;
  }
}
#mywieland-app .temper-file-upload .dropzone-container {
  padding: 1rem;
  width: 450px;
  height: 100px;
}
#mywieland-app .temper-file-upload .text-muted {
  text-align: left;
  margin-top: 5px;
  margin-left: 3px;
}
#mywieland-app .temper-file-upload .cards-container {
  max-width: 650px;
  display: flex;
  align-items: center;
  flex-direction: row;
  flex-wrap: wrap;
  margin-top: 0px;
}
#mywieland-app .file-label {
  font-size: 20px;
  display: block;
  cursor: pointer;
}
#mywieland-app .preview-card {
  display: flex;
  padding: 5px;
  margin-left: 5px;
}
#mywieland-app .preview-img {
  margin-left: 30px;
}
#mywieland-app .preview-img img {
  width: 50px;
  height: 50px;
  border-radius: 5px;
  background-color: #a2a2a2;
}
#mywieland-app .cards-container {
  display: flex;
  flex-wrap: wrap;
  gap: 10px;
  margin-top: 20px;
}
#mywieland-app .thecard {
  display: flex;
  flex-direction: column;
  width: 49%;
  height: auto;
  border: 1px solid #C8C9C7;
  margin-bottom: 15px;
  object-fit: cover;
}
#mywieland-app .thecard img {
  border-radius: 5px;
  background-color: #a2a2a2;
  margin-bottom: 15px;
  background-size: cover;
  max-height: 100px;
  overflow: hidden;
  background-image: initial;
}
#mywieland-app .thecard p {
  text-align: center;
  font-size: 12px;
  font-weight: 600;
  margin-top: -22px;
}
#mywieland-app .thecard div, #mywieland-app .thecard span {
  font-size: 20px;
  z-index: 20;
}
#mywieland-app .thecard i {
  font-size: 90px;
  text-align: center;
  margin-bottom: 15px;
}
#mywieland-app .quantity-adder .unit {
  font-size: larger;
}
#mywieland-app .quantity-adder input {
  border-radius: 0;
  max-width: 80px;
  text-align: right;
}
#mywieland-app .quantity-adder .input-group-prepend {
  border-top-right-radius: 0;
  border-bottom-right-radius: 0;
  font-size: smaller;
}
#mywieland-app .quantity-adder .input-group-append {
  border-top-left-radius: 0;
  border-bottom-left-radius: 0;
  font-size: smaller;
}
#mywieland-app .quantity-adder .input-group {
  margin-bottom: 20px;
}
#mywieland-app .quantity-adder .note {
  font-size: small;
  margin: 0;
}
#mywieland-app .quantity-adder .btn-primary, #mywieland-app .quantity-adder .btn-secondary {
  margin: 10px 0 20px 0;
}
#mywieland-app .quantity-adder .btn-primary.float-right, #mywieland-app .quantity-adder .btn-secondary.float-right {
  margin: 0;
  margin-bottom: -45px;
  position: relative;
  top: 40px;
}
.user-notification-settings h2 {
  margin-bottom: 50px;
}
.user-notification-settings p {
  margin-top: 20px;
  margin-bottom: 5px;
}
.toggle {
  --width: 50px;
  --height: calc(var(--width) / 2);
  --top: 0px;
  position: relative;
  display: inline-block;
  width: var(--width);
  height: var(--height);
  top: var(--top);
  border-radius: var(--height);
  cursor: pointer;
  border: 1px solid #C8C9C7;
}
.toggle.small {
  --width: 25px;
}
.toggle:hover {
  border: 1px solid black;
}
.toggle input {
  display: none;
}
.toggle .slider {
  border-radius: calc(var(--height) / 2);
  background-color: #ffffff;
  transition: all 0.4s ease-in-out;
}
.toggle .slider::before {
  content: "";
  position: absolute;
  top: calc(var(--height) / 10);
  left: calc(var(--height) / 10);
  width: calc(var(--height) / 1.5);
  height: calc(var(--height) / 1.5);
  border-radius: calc(var(--height) / 2);
  background-color: #52555A;
  transition: all 0.2s ease-in-out;
}
.toggle.active {
  background-color: #1275A8;
}
.toggle.active .slider::before {
  background-color: white;
}
.toggle.active:hover {
  border-color: #1275A8;
}
.toggle.disabled .slider {
  background-color: #c3c3c4;
}
.toggle.active .slider::before {
  transform: translateX(calc(var(--width) - var(--height)));
}
.info-icon {
  font-size: 11px;
}
.info-icon:before {
  background-color: black;
  color: white;
  padding: 4px;
  border-radius: 5px;
}
.helpLink {
  color: #E12326;
  font-size: 12px;
}
.helpLink:hover {
  cursor: pointer;
}
a[href^="mailto:"].webLabelling {
  color: #E12326;
}
a[href^="mailto:"].webLabelling:before {
  background: url(/assets/envelope.svg) no-repeat;
  content: " ";
  display: inline-block;
  width: 20px;
  height: 20px;
  margin-right: 4px;
  top: 8px;
  position: relative;
}
a[href^="mailto:"].webLabelling:hover {
  text-decoration: underline;
}
.facet-multiselect .multiselect-tag {
  margin-top: 1rem;
}
.totalProducts {
  padding-top: 8px;
  padding-right: 15px;
}
.toggleMode {
  margin-left: 10px;
}
.toggleMode .svg {
  width: 40px;
  height: 40px;
  cursor: pointer;
  user-select: none;
  padding-top: 6px;
  padding-bottom: 6px;
}
.editPen {
  height: 17px;
  width: 17px;
  display: inline-block;
}
.editQtyCol .btn-secondary.float-right {
  top: 0px !important;
}
.modal {
  background-color: rgba(128, 128, 128, 0.3607843137);
}
#productSort {
  width: fit-content !important;
}
.form-check-input:checked {
  background-color: #53555a;
  border-color: #53555a;
}
.multiselect.is-active {
  box-shadow: none;
}
.form-row {
  margin-left: 0px;
}
.alloy-wizard .table thead th {
  background-color: inherit !important;
}
.alloy-wizard table td {
  border: none !important;
  position: inherit !important;
  padding: 1px 2px;
}
.alloy-wizard .zoom-in {
  cursor: zoom-in;
}
.alloy-wizard .zoom-out {
  cursor: zoom-out;
}
[draggable=true]:hover {
  cursor: grab !important;
}
[draggable=true]:active {
  cursor: grabbing !important;
}
.skeleton-placeholder {
  display: block;
  width: 100%;
  height: 20px;
  background: linear-gradient(90deg, #e0e0e0 25%, #f0f0f0 50%, #e0e0e0 75%);
  background-size: 200% 100%;
  animation: skeletonLoading 1.5s infinite;
  border-radius: 4px;
}
@keyframes skeletonLoading {
  0% {
    background-position: 200% 0;
  }
  100% {
    background-position: -200% 0;
  }
}
.grayedout {
  color: #cfcfcf !important;
}
.pdf-styling {
  font-size: 16px;
  color: black !important;
}
.pdf-styling .row {
  display: flex !important;
  flex-wrap: nowrap !important;
}
.pdf-styling .col-md-6 {
  width: 50% !important;
}
.pdf-styling .table:not(.d-none) {
  all: initial !important;
  margin-top: -1rem !important;
  width: 100% !important;
  font-family: inherit !important;
  display: table !important;
}
.pdf-styling .table:not(.d-none) td, .pdf-styling .table:not(.d-none) th, .pdf-styling .table:not(.d-none) tr {
  all: unset !important;
  display: revert !important;
  word-break: break-all !important;
}
.pdf-styling .table:not(.d-none) td, .pdf-styling .table:not(.d-none) th {
  padding: 15px 5px !important;
  border-bottom: 1px solid lightgray !important;
}
.pdf-styling .table:not(.d-none) th {
  font-weight: bold !important;
}
.stickyAWNavBar {
  position: sticky;
  top: -1px;
  z-index: 4;
  padding-top: 20px;
  padding-bottom: 20px;
  background-color: white;
}
.stickyAWNavBar.is-pinned {
  padding-top: 75px;
  transition: 0.5s;
}
.alloyWizardCompareModal .modal-body {
  padding: 5px;
  padding-top: 10px;
}
.alloyWizardCompareModal .legendItemSelected {
  font-weight: 600;
  border-bottom: 3px solid black;
}
.alloyWizardCompareModal .legend {
  display: flex;
  width: 100%;
  flex-wrap: wrap;
  gap: 25px;
  padding: 15px 1px;
}
.alloyWizardCompareModal .legend-item {
  display: flex;
  align-items: center;
  gap: 5px;
  font-size: 15px;
}
.alloyWizardCompareModal .group {
  width: 100%;
  display: flex;
  padding: 20px 0;
  gap: 18px;
  flex-wrap: wrap;
  justify-content: center;
  align-items: center;
}
#general-overview-chart-container .radarArea {
  display: none !important;
}
span.frac {
  display: inline-block;
  text-align: center;
  margin-top: 10px;
}
span.frac > sup {
  display: block;
  border-bottom: 1px solid;
  font: inherit;
}
span.frac > span {
  display: none;
}
span.frac > sub {
  display: block;
  font: inherit;
  margin-top: -10px;
}
.comparisonMenuButton .btn-secondary {
  color: #53555a !important;
  background: none !important;
  border: none !important;
  letter-spacing: 2px !important;
  padding: 0 !important;
  height: 100%;
}
.comparisonMenuButton .btn-secondary:focus {
  box-shadow: none !important;
}
.comparisonMenuButton .comparisonMenuButton {
  box-shadow: none !important;
}
.aw-list-table td {
  padding: 2px 10px 2px 0;
  vertical-align: baseline;
  background: white !important;
}
@media (max-width: 600px) {
  .aw-list-table {
    display: block;
  }
  .aw-list-table tr {
    display: block;
  }
  .aw-list-table td {
    display: block;
    width: 100% !important;
    box-sizing: border-box;
    padding: 2px 0px !important;
  }
  .aw-list-table tbody {
    display: block;
  }
}
#comparison-export table {
  display: table !important;
}
#comparison-export table td {
  padding: 5px !important;
}
.activeTreeEntry > div:first-of-type {
  font-weight: 700;
}
.fw-bold {
  font-weight: bold;
}
.error-msg {
  color: #E12326;
}
.form-label-group {
  display: flex;
  flex-direction: column-reverse;
  margin-bottom: 10px;
}
.label, label:not(.form-check-label) {
  margin-bottom: 0;
  color: black;
}
.text-muted {
  color: #52555A !important;
}
.statusTag{
  border-radius: 5px;
  background-color: gray;
  padding: 5px;
  margin-bottom:50px;
}
.dunningLvL3{
  background-color: rgb(253, 226, 226) !important;
  color: rgb(164, 60, 66) !important;
}
.dunningLvL4{
  background-color: rgba(189, 59, 59, 0.829) !important;
  color: rgb(252, 252, 252) !important;
}
.overDue{
  background-color: rgba(255,232,213) !important;
  color: rgb(179, 120, 45) !important;
}

.rmvBtn[data-v-43695fbc]{
  color: #e0251b;
  font-weight: 600;
  font-size: 17px;
  padding: 5px;
}
.wcollapse {
  margin-bottom: 0.5rem;
}
.wcollapse .header {
  display: flex;
  flex-direction: row;
  font-size: 0.9rem;
  font-weight: 600;
}
.wcollapse .header .collapse-button {
  background-color: #e3e4e4;
  border: none;
  outline: none;
  border-radius: 3px;
  line-height: 0;
  width: 14px;
  height: 14px;
  margin-top: 0.1rem;
  margin-right: 0.3rem;
  padding: 0px 14px 0px 1px;
}
.wcollapse .header .collapse-button .fa-chevron-right {
  padding-left: 2px;
}
.wcollapse .header .collapse-button .fa-chevron-right, .wcollapse .header .collapse-button .fa-chevron-down {
  text-align: left;
}
.wcollapse .collapse {
  margin-left: 1rem;
}tr:nth-child(2n) td[data-v-0558defa] {
  background-color: initial;
}
td.propertyName[data-v-0558defa] {
  border: none;
  padding: 0 1em 0 0;
  font-size: 0.8em;
  color: #98999b;
  vertical-align: middle;
  max-width: 50%;
  text-align: right;
}
td.propertyValue[data-v-0558defa] {
  border: none;
  padding: 0 0;
  font-size: 0.8em;
  color: #53555a;
  vertical-align: middle;
  width: 50%;
}
.md-table td.propertyName[data-v-0558defa], .md-table td.propertyValue[data-v-0558defa] {
  white-space: nowrap;
}
.whover[data-v-0558defa] {
  cursor: auto;
  top: auto;
  left: auto;
  transform: translateX(150px);
  padding: 0.2rem;
}.md-table[data-v-22d45a18] {
  max-height: 100%;
  overflow-y: auto;
  overflow-x: hidden;
}
.actionBullets[data-v-22d45a18] {
  vertical-align: middle;
}
.loading-tr[data-v-22d45a18] {
  padding: 5px;
  height: 120px;
}
.table[data-v-22d45a18] {
  border-collapse: separate;
  border-spacing: 0 0.75em;
  display: table;
}
.table > thead tr[data-v-22d45a18] {
  top: 0;
  z-index: 2;
  position: sticky;
}
.table > thead th[data-v-22d45a18] {
  background-color: #53555a;
  color: white;
  border: none !important;
  font-weight: 400;
}
.table > thead th[data-v-22d45a18]:last-child {
  width: 0.4em;
  padding: 0;
  border-top-right-radius: 0.25rem;
}
.table > thead th[data-v-22d45a18]:first-child {
  border-top-left-radius: 0.25rem;
}
.table > tbody tr:nth-child(2n) td[data-v-22d45a18] {
  background-color: initial;
}
.table > tbody > tr[data-v-22d45a18] {
  cursor: pointer;
}
.table > tbody > tr > td[data-v-22d45a18] {
  padding: 0.75em;
  border: 0px solid #d4d4d5;
  vertical-align: middle;
}
.table > tbody > tr > td.hover[data-v-22d45a18] {
  background-color: #e3e4e4;
}
.table > tbody > tr > td.master[data-v-22d45a18] {
  border-top-width: 1px;
  border-bottom-width: 1px;
}
.table > tbody > tr > td.first[data-v-22d45a18] {
  border-left-width: 1px;
  border-top-left-radius: 0.4em;
  border-bottom-left-radius: 0.4em;
}
.table > tbody > tr > td.detail[data-v-22d45a18] {
  padding: 0 0.75em;
}
.table > tbody > tr > td.top[data-v-22d45a18] {
  padding-top: 0.75em;
  border-top-width: 1px;
}
.table > tbody > tr > td.bottom[data-v-22d45a18] {
  padding-bottom: 0.75em;
  border-bottom-width: 1px;
}
.table > tbody > tr > td.last[data-v-22d45a18] {
  border-width: 1px 1px 1px 0;
  width: 0.4em;
  padding: 0;
  border-top-right-radius: 0.4em;
  border-bottom-right-radius: 0.4em;
}
.table > tbody > tr.selected > td[data-v-22d45a18]:not(.first), .table > tbody > tr.selected td.one[data-v-22d45a18] {
  background-color: #e3e4e4;
}
.table > tbody.loading > tr[data-v-22d45a18] {
  background: linear-gradient(90deg, #e0e0e0 25%, #f0f0f0 50%, #e0e0e0 75%);
  background-size: 200% 100%;
  animation: skeletonLoading-22d45a18 1.5s infinite;
}
.table > tbody.loading > tr td.propertyName[data-v-22d45a18] {
  color: #d4d4d5;
}
.table > tbody.loading > tr td.propertyValue[data-v-22d45a18] {
  color: #98999b;
}
.table a[data-v-22d45a18] {
  cursor: pointer;
}
.filters[data-v-22d45a18] {
  display: flex;
  flex-wrap: wrap;
  padding-top: 1rem;
  background-color: #e3e4e4;
  border-radius: 0.4em;
}
.filters .bottom-line[data-v-22d45a18]::after {
  content: "";
  position: absolute;
  left: 1em;
  right: 1em;
  height: 1px;
  background-color: #d4d4d5;
  bottom: 0.5em;
}
.action-menu[data-v-22d45a18] {
  top: auto;
  left: auto;
  transform: translateX(-200px);
}
.input-group:hover .input-group-text[data-v-22d45a18], .input-group:active .input-group-text[data-v-22d45a18] {
  border-color: black;
}
.input-group-text[data-v-22d45a18] {
  border-color: #C8C9C7;
  border-radius: 0px !important;
}
@keyframes skeletonLoading-22d45a18 {
0% {
    background-position: 200% 0;
}
100% {
    background-position: -200% 0;
}
}.offcanvas {
  position: fixed;
  height: 100vh;
  z-index: 1057;
  display: flex;
  flex-direction: column;
  max-width: 100%;
  background-color: white;
  background-clip: padding-box;
  outline: 0;
}
.offcanvas .offcanvas-header {
  display: flex;
  align-items: center;
  justify-content: space-between;
  height: calc(4rem + 60px);
  padding-top: 60px;
}
.offcanvas .offcanvas-header button {
  margin-right: 1rem;
}
.offcanvas .offcanvas-body {
  position: relative;
  width: 100%;
  height: calc(100vh - 4rem);
  overflow-y: auto;
}
.offcanvas-end {
  top: 0;
  right: 0;
  border-left: 1px solid #c3c3c4;
}.scroller[data-v-293bbcd4] {
  display: flex;
  flex-direction: column;
  gap: 1rem;
  position: fixed;
  width: 3rem;
  text-align: center;
  height: 100%;
  background-color: #f2f2f2;
}.scroll-item[data-v-65f7f5f6] {
  cursor: pointer;
  height: 3rem;
  width: 3rem;
  line-height: 3rem;
}
.scroll-item.selected[data-v-65f7f5f6] {
  background-color: #c3c3c4;
}.scroller-window {
  position: relative;
  height: 100%;
  left: 3rem;
  width: calc(100% - 3rem);
  overflow-y: auto;
  padding: 0.5rem;
  display: flex;
  flex-direction: column;
  gap: 1rem;
}.trackingDD {
  font-size: 0.8rem;
}
.modal-content[data-v-3bfaee96] {
    max-width: 1200px;
    width: 90vw;
@media (max-width: 767px) {
        margin-bottom: 6rem;
        width: 100%;
}
}
.modal-header[data-v-3bfaee96]{
    padding: 0.5rem 0.8rem;
}
.modal[data-v-3bfaee96]{
    background: rgba(0, 0, 0, 0.5);
}
@media(max-width:767px){
.modal[data-v-3bfaee96]{
        margin-top: 60px;
}
}
.modal-body[data-v-3bfaee96]{
    padding-bottom: 0px;
}
.modal-header .close[data-v-3bfaee96] {
    padding: 1rem 1.5rem;
    padding-top: 1.3rem;
}
.form-check[data-v-9dc04d3c] {
  margin-top: 0.5em;
}.orderEntryPos {
  font-size: 1.2em;
  border-right: 1px solid #d4d4d5;
  line-height: 3em;
}
.orderEntryPos > td {
  padding-right: 0.5em !important;
  color: #98999b !important;
}
.orderType {
  font-weight: 600;
}
.posColumn {
  text-align: right;
  vertical-align: middle;
}
.posColumn > table {
  width: 100%;
}
.trkStat td:first-child {
  text-align: right;
}
.green {
  color: #6aa539;
}
.orange {
  color: #ffa300;
}
.red {
  color: #e0251b;
}
.order-entry-details {
  width: 350px;
}
.order-entry-details .details {
  display: flex;
  gap: 1rem;
}
.placeholder {
  opacity: 1;
  width: 3rem;
  height: 200%;
  background-color: #f2f2f2;
  margin-top: -60px;
}
.handlingUnit {
  margin-bottom: 0.5rem;
}
.tracking > td.propertyValue {
  white-space: normal;
}
.tracking > td.propertyValue > div {
  position: relative;
  line-height: 1.25rem;
  display: flex;
  width: fit-content;
  flex-direction: row;
  gap: 1em;
}
.tracking > td.propertyValue > div::before {
  content: "";
  position: absolute;
  top: calc(50% - 1px);
  left: 0;
  width: 100%;
  height: 0px;
  border-bottom: 1px solid #53555a;
  z-index: 0;
}
.tracking > td.propertyValue > div > i {
  display: inline-block;
  height: 10px;
  z-index: 1;
  background-color: white;
}
.tracking > td.propertyValue > div > i.fa-circle-check {
  padding-top: 1px;
}
.action-menu {
  top: auto;
  left: auto;
  min-height: 50px;
  z-index: 1058;
}
.form-label-group .form-control.pw-input[data-v-3f62a9c9]{
    padding-top: 1.25rem !important;
    padding-bottom: 0.25rem !important;
}
.red[data-v-3f62a9c9]{
    color: #e0251b;
}
form[data-v-3f62a9c9]{
    background-color: initial !important;
}

.readOnly[data-v-86ba50b4]{
    user-select: none;
    pointer-events: none;
}
textarea[data-v-86ba50b4] {
  min-height: 150px;
  padding: 15px; 
  font-family: 'Arial', sans-serif;
  font-size: 14px;
  line-height: 1.6;
  background-color: #fff;
  border: 2px solid gray;
  border-radius: 8px;
  resize: vertical;
  transition: border-color 0.3s ease, box-shadow 0.3s ease;
}
textarea[data-v-86ba50b4]::placeholder {
  color: #999;
  font-style: italic;
}
b[data-v-86ba50b4]{
    font-weight: 600;
}
b {
  font-weight: 600;
}
._sustanabilityInfo_1f0mu_5 {
  background-color: rgb(254, 247, 241);
  color: black;
  border: 1px solid orange;
  border-radius: 5px;
  width: fit-content;
  padding: 4px 15px 4px 15px;
}